![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Beagle Bros TimeOut FileMaster.pdf | 2025-02-19 21:56 | 91M | |
![[ ]](/icons/layout.gif) | Seven_Hills_Software_GraphicWriter_III_Reference_Manual_1991-12.pdf | 2023-06-16 15:39 | 32M | |
![[ ]](/icons/layout.gif) | EPYX Art And Film Director manual.pdf | 2023-06-16 15:39 | 39M | |
![[ ]](/icons/layout.gif) | Scholastic_Science_Explorers_Scholastic_Explorers_Library_Volume_1_Grades_1-3.pdf | 2023-06-16 15:39 | 26M | |
![[ ]](/icons/layout.gif) | Human_Edge_The_Negotiation_Edge_Manual.pdf | 2023-06-16 15:39 | 26M | |
![[ ]](/icons/layout.gif) | Seven_Hills_Software_GraphicWriter_III_Getting_Started_Manual_1991-12.pdf | 2023-06-16 15:39 | 21M | |
![[ ]](/icons/layout.gif) | Davidson_Math_and_Me_manual.pdf | 2023-06-16 15:39 | 15M | |
![[ ]](/icons/layout.gif) | Datasoft_Fathoms_40_manual.pdf | 2023-06-16 15:39 | 12M | |
![[ ]](/icons/layout.gif) | Hayden_Software_Apple_II_SARGON_II_Users_Guide.pdf | 2023-06-16 15:39 | 2.7M | |
![[ ]](/icons/layout.gif) | Midwest_Agribusiness_Services_Agri_Quiz_Series_manual.pdf | 2023-06-16 15:39 | 3.2M | |
![[ ]](/icons/layout.gif) | Scholastic_Science_Explorers_Scholastic_Explorers_Library_Volume_2_Grades_4-6.pdf | 2023-06-16 15:39 | 32M | |
![[ ]](/icons/layout.gif) | Hartley_Math_Concepts_I_and_II_manual.pdf | 2023-06-16 15:39 | 13M | |
![[ ]](/icons/layout.gif) | Micrograms_Hugo_Hounds_Vowel_Sounds_teachers_guide.pdf | 2023-06-16 15:39 | 4.7M | |
![[ ]](/icons/layout.gif) | Firebird_Road_Rally_USA_manual.pdf | 2023-06-16 15:39 | 13M | |
![[ ]](/icons/layout.gif) | Micrograms_Uncle_Clydes_Consonant_Slides_teachers_guide.pdf | 2023-06-16 15:39 | 5.6M | |
![[ ]](/icons/layout.gif) | Grolier_Educational_Seek_It_The_Isle_of_Mem_manual.pdf | 2023-06-16 15:34 | 22M | |
![[ ]](/icons/layout.gif) | Grolier_Educational_Seek_It_Dr_Jessies_Dinosaur_manual.pdf | 2023-06-16 15:34 | 18M | |
![[ ]](/icons/layout.gif) | Electronic_Arts_Keef_the_Thief_manual.pdf | 2023-06-16 15:34 | 17M | |
![[ ]](/icons/layout.gif) | Lifeware_Adventures_in_Narnia_manual.pdf | 2023-06-16 15:34 | 15M | |
![[ ]](/icons/layout.gif) | Learning_Technologies_Pipeline_manual.pdf | 2023-06-16 15:34 | 8.1M | |
![[ ]](/icons/layout.gif) | Keypunch_Software_Torpedos_Away.pdf | 2023-06-16 15:34 | 4.8M | |
![[ ]](/icons/layout.gif) | Grolier_Educational_Seek_It_Max_Dublins_Treasure_manual.pdf | 2023-06-16 15:34 | 11M | |
![[ ]](/icons/layout.gif) | George_Earls_Readings_In_Literature_manual.pdf | 2023-06-16 15:34 | 5.2M | |
![[ ]](/icons/layout.gif) | Chelsea_Science_Simulations_Plant_Competition_manual.pdf | 2023-06-16 15:34 | 8.9M | |
![[ ]](/icons/layout.gif) | Focus_Media_Pollution_Control_manual.pdf | 2023-06-16 15:34 | 18M | |
![[ ]](/icons/layout.gif) | Strategic_Simulations_Rails_West_manual.pdf | 2023-06-16 15:33 | 70M | |
![[ ]](/icons/layout.gif) | Dakin5_The_Depreciation_Planner_manual.pdf | 2023-06-16 15:33 | 63M | |
![[ ]](/icons/layout.gif) | Pinpoint_Point_to_Point_manual.pdf | 2023-06-16 15:33 | 26M | |
![[ ]](/icons/layout.gif) | Penguin_Software_Cat_Graphics_manual.pdf | 2023-06-16 15:33 | 12M | |
![[ ]](/icons/layout.gif) | Woodbury_Play_Writer_Adventures_in_Space_manual.pdf | 2023-06-16 15:33 | 20M | |
![[ ]](/icons/layout.gif) | VIsion_Software_Apple_II_Series_Addition_Subtraction.pdf | 2023-06-16 15:33 | 4.1M | |
![[ ]](/icons/layout.gif) | Polarware_The_Spys_Adventures_in_North_America_manual.pdf | 2023-06-16 15:33 | 14M | |
![[ ]](/icons/layout.gif) | William_K._Bradford_Publishing_Educational_Software_for_the_Home_Just_Around_the_Block.pdf | 2023-06-16 15:33 | 36M | |
![[ ]](/icons/layout.gif) | SVE_Microcomputer_Software_Basic_Skill_Boosters_Planet_Earth_teachers_manual.pdf | 2023-06-16 15:33 | 14M | |
![[ ]](/icons/layout.gif) | Scholastic_StoryTree_manual.pdf | 2023-06-16 15:33 | 17M | |
![[ ]](/icons/layout.gif) | Accolade_Fast_Break_manual.pdf | 2023-06-16 15:33 | 9.8M | |
![[ ]](/icons/layout.gif) | William_K._Bradford_Publishing_Educational_Software_for_the_Home_Where_Did_My_Toothbrush_Go__manual.pdf | 2023-06-16 15:27 | 38M | |
![[ ]](/icons/layout.gif) | Strategic_Studies_Group_Halls_of_Montezuma_manual.pdf | 2023-06-16 15:27 | 39M | |
![[ ]](/icons/layout.gif) | Springboard_The_Newsroom_manual.pdf | 2023-06-16 15:27 | 17M | |
![[ ]](/icons/layout.gif) | Springboard_Certificate_Maker_manual.pdf | 2023-06-16 15:27 | 17M | |
![[ ]](/icons/layout.gif) | Springboard_Product_Catalog.pdf | 2023-06-16 15:27 | 7.9M | |
![[ ]](/icons/layout.gif) | Springboard_Piece_of_Cake_Math_manual.pdf | 2023-06-16 15:27 | 5.0M | |
![[ ]](/icons/layout.gif) | CBS_Software_Richard_Scarrys_Best_Electronic_Word_Book_Ever_manual.pdf | 2023-06-16 15:27 | 18M | |
![[ ]](/icons/layout.gif) | I-Openners_Cheer_manual.pdf | 2023-06-16 15:27 | 15M | |
![[ ]](/icons/layout.gif) | CBS_Software_catalog_1984.pdf | 2023-06-16 15:27 | 11M | |
![[ ]](/icons/layout.gif) | Accolade_4th__Inches_Team_Construction_Disk_manual.pdf | 2023-06-16 15:27 | 6.3M | |
![[ ]](/icons/layout.gif) | Edu-Ware_Compu-Spell_Spell_System_Diskette_manual.pdf | 2023-06-16 15:26 | 10M | |
![[ ]](/icons/layout.gif) | Edu-Ware_Statistics_3.0_manual.pdf | 2023-06-16 15:26 | 7.5M | |
![[ ]](/icons/layout.gif) | Entrex_A_Way_To_Learn_With_Waggs_manual.pdf | 2023-06-16 15:26 | 9.0M | |
![[ ]](/icons/layout.gif) | EPYX_Temple_of_Apshai_manual.pdf | 2023-06-16 15:26 | 12M | |
![[ ]](/icons/layout.gif) | Sierra_Online_The_General_Manager_manual.pdf | 2023-06-16 15:26 | 20M | |
![[ ]](/icons/layout.gif) | HRM_Software_Solar_Food.pdf | 2023-06-16 15:26 | 10M | |
![[ ]](/icons/layout.gif) | Ellen_Nelson_Learning_Library_Math_3_Advanced_Word_Problems_manual.pdf | 2023-06-16 15:26 | 18M | |
![[ ]](/icons/layout.gif) | Electronic_Arts_Music_Construction_Set_manual.pdf | 2023-06-16 15:26 | 6.6M | |
![[ ]](/icons/layout.gif) | Activision_Great_American_Cross-Country_Road_Race_manual.pdf | 2023-06-16 15:26 | 2.4M | |
![[ ]](/icons/layout.gif) | Hartley_Facts__Fallacies_manual.pdf | 2023-06-16 15:26 | 8.7M | |
![[ ]](/icons/layout.gif) | Conduit_Osmotic_Pressure_manual.pdf | 2023-06-16 15:26 | 6.9M | |
![[ ]](/icons/layout.gif) | Hi-Tech_Expressions_Win_Lose_or_Draw_Junior_manual.pdf | 2023-06-16 15:26 | 6.0M | |
![[ ]](/icons/layout.gif) | ReadySoft_product_catalog.pdf | 2023-06-16 15:26 | 34M | |
![[ ]](/icons/layout.gif) | Hi-Tech_Expressions_1989-1990_catalog.pdf | 2023-06-16 15:26 | 29M | |
![[ ]](/icons/layout.gif) | Pendulum_Press_Read_and_Review_Tom_Sawyer.pdf | 2023-06-16 15:26 | 24M | |
![[ ]](/icons/layout.gif) | Scholastic_Operation_Frog_manual.pdf | 2023-06-16 15:26 | 17M | |
![[ ]](/icons/layout.gif) | MILLIKEN_Cloze-Plus_manual.pdf | 2023-06-16 15:26 | 34M | |
![[ ]](/icons/layout.gif) | Strategic_Simulations_Catalog_spring_1985.pdf | 2023-06-16 15:26 | 25M | |
![[ ]](/icons/layout.gif) | MECC_Number_Munchers_manual.pdf | 2023-06-16 15:26 | 21M | |
![[ ]](/icons/layout.gif) | Sierra_Online_Kings_Quest_IV_Perils_of_Rosella_manual.pdf | 2023-06-16 15:26 | 16M | |
![[ ]](/icons/layout.gif) | Micro_Power_and_Light_Reproduction_Process_manual.pdf | 2023-06-16 15:26 | 3.6M | |
![[ ]](/icons/layout.gif) | Microsoft_CPM80_Quick_Reference_Guide.pdf | 2023-06-16 15:26 | 3.1M | |
![[ ]](/icons/layout.gif) | Lucasfilm_Games_Pipe_Dream_manual.pdf | 2023-06-16 15:26 | 19M | |
![[ ]](/icons/layout.gif) | SRA_Software_Beano_manual.pdf | 2023-06-16 15:26 | 11M | |
![[ ]](/icons/layout.gif) | Spinnaker_Story_Machine_manual.pdf | 2023-06-16 15:26 | 14M | |
![[ ]](/icons/layout.gif) | Spinnaker_Delta_Drawing_manual.pdf | 2023-06-16 15:26 | 10M | |
![[ ]](/icons/layout.gif) | Software_Publishing_Corporation_PFS_File_and_PFS_Report_for_Macintosh_manual.pdf | 2023-06-16 15:26 | 27M | |
![[ ]](/icons/layout.gif) | Springboard_Quizagon_manual.pdf | 2023-06-16 15:26 | 8.0M | |
![[ ]](/icons/layout.gif) | Weekly_Reader_Family_Software_Car_Builder_manual.pdf | 2023-06-16 15:26 | 17M | |
![[ ]](/icons/layout.gif) | Brittanica_Software_Revolution_76_manual.pdf | 2023-06-16 15:26 | 28M | |
![[ ]](/icons/layout.gif) | Spinnaker_Rhymes__Riddles_manual.pdf | 2023-06-16 15:26 | 18M | |
![[ ]](/icons/layout.gif) | Sierra_Award_Winners_manual.pdf | 2023-06-16 15:13 | 57M | |
![[ ]](/icons/layout.gif) | Strategic_Simulations_Fall_1988_Winter_1989_catalog.pdf | 2023-06-16 15:13 | 46M | |
![[ ]](/icons/layout.gif) | Broderbund_Show_Off_manual.pdf | 2023-06-16 15:13 | 24M | |
![[ ]](/icons/layout.gif) | Strategic_Simulations_Advanced_Dungeons_and_Dragons_Pool_of_Radiance_manual.pdf | 2023-06-16 15:13 | 30M | |
![[ ]](/icons/layout.gif) | Broderbund_Lode_Runner_manual.pdf | 2023-06-16 15:13 | 2.6M | |
![[ ]](/icons/layout.gif) | Advanced_Ideas_Audubon_Wildlife_Adventures_Grizzly_Guidebook_School_Edition_for_Apple_II.pdf | 2023-06-16 15:03 | 16M | |
![[ ]](/icons/layout.gif) | Sterling_Software_The_Arithmetic_Classroom_Subtraction_Whole_Numbers_Apple_II_manual.pdf | 2023-06-16 15:03 | 4.6M | |
![[ ]](/icons/layout.gif) | Sunburst_Communications_Classroom_Toolbox_Teachers_Guide_Apple_II.pdf | 2023-06-16 15:03 | 15M | |
![[ ]](/icons/layout.gif) | Continental_Software_Payroll_manual_Apple_II.pdf | 2023-06-16 15:03 | 6.0M | |
![[ ]](/icons/layout.gif) | Sunburst_Communications_Magic_Slate_Teachers_Guide_Apple_II.pdf | 2023-06-16 15:03 | 18M | |
![[ ]](/icons/layout.gif) | Human_Systems_Dynamics_Calcu-Plot_manual_for_Apple_II.pdf | 2023-06-16 15:03 | 7.8M | |
![[ ]](/icons/layout.gif) | Micro_Lab_The_Data_Factory_Data_Base_Apple_II.pdf | 2023-06-16 15:03 | 38M | |
![[ ]](/icons/layout.gif) | Special_Delivery_Software_Pascal_Animation_Tools_manual.pdf | 2023-06-16 15:03 | 16M | |
![[ ]](/icons/layout.gif) | LDS_Personal_Ancestral_File_Apple_II_manual.pdf | 2023-06-16 15:03 | 25M | |
![[ ]](/icons/layout.gif) | Sunburst_Communications_Learn_About_Animals_Teachers_Guide_Apple_II.pdf | 2023-06-16 15:03 | 8.0M | |
![[ ]](/icons/layout.gif) | Sunburst_Communications_Botanical_Gardens_Teachers_Guide_Apple_II.pdf | 2023-06-16 15:03 | 5.9M | |
![[ ]](/icons/layout.gif) | Society_for_Visual_Education_SVE_Basic_Skill_Boosters_Science_Center_Weather_Watch_Teachers_Manual_Apple_II.pdf | 2023-06-16 15:03 | 4.1M | |
![[ ]](/icons/layout.gif) | Farmplan_Computer_Systems_Farmfiler_Apple_II_manual.pdf | 2023-06-16 15:03 | 15M | |
![[ ]](/icons/layout.gif) | Society_for_Visual_Education_SVE_Basic_Skill_Boosters_Science_Center_Space_Probe_Teachers_Manual_Apple_II.pdf | 2023-06-16 15:03 | 4.3M | |
![[ ]](/icons/layout.gif) | Micrograms_Publishing_Real_Math_Apple_II.pdf | 2023-06-16 14:56 | 9.9M | |
![[ ]](/icons/layout.gif) | HowardSoft_Tax_Preparer_manual_for_Apple_II.pdf | 2023-06-16 14:56 | 9.6M | |
![[ ]](/icons/layout.gif) | Davidson_Word_Attack_manual_for_Apple_II.pdf | 2023-06-16 14:56 | 5.7M | |
![[ ]](/icons/layout.gif) | Sunburst_Education_Teasers_by_Tobbs_manual_Apple_II.pdf | 2023-06-16 14:56 | 7.7M | |
![[ ]](/icons/layout.gif) | EduSoft_Fast_Facts_Apple_II.pdf | 2023-06-16 14:56 | 2.5M | |
![[ ]](/icons/layout.gif) | AEC_Software_World_Geography_Apple_II_and_IBM_PC.pdf | 2023-06-16 14:56 | 4.6M | |
![[ ]](/icons/layout.gif) | AEC_Software_Human_Biology_Apple_II_and_IBM_PC.pdf | 2023-06-16 14:56 | 6.0M | |
![[ ]](/icons/layout.gif) | Micrograms_Publishing_Primary_Mathematics_Calendar_Apple_II.pdf | 2023-06-16 14:56 | 4.2M | |
![[ ]](/icons/layout.gif) | AEC_Software_US_History_Apple_II_and_IBM_PC.pdf | 2023-06-16 14:56 | 6.0M | |
![[ ]](/icons/layout.gif) | Sunburst_Education_Memory_Castle_manual_Apple_II.pdf | 2023-06-16 14:56 | 12M | |
![[ ]](/icons/layout.gif) | Media_Basics_Courseware_Return_to_Reading_Library_Apple_II.pdf | 2023-06-16 14:56 | 4.8M | |
![[ ]](/icons/layout.gif) | Opportunities_for_Learning_Fraction_Tutorial_by_The_Wizard_for_Apple_II.pdf | 2023-06-16 14:56 | 6.7M | |
![[ ]](/icons/layout.gif) | American_Education_Corporation_A-Plus_Users_Manual_Apple_II.pdf | 2023-06-16 14:56 | 3.8M | |
![[ ]](/icons/layout.gif) | Sunburst_Education_Missing_Links_manual_Apple_II.pdf | 2023-06-16 14:56 | 8.6M | |
![[ ]](/icons/layout.gif) | Discovery_Software_Word-Player_manual_Apple_II.pdf | 2023-06-16 14:56 | 17M | |
![[ ]](/icons/layout.gif) | Discovery_Software_Space_Port_Apple_II.pdf | 2023-06-16 14:56 | 16M | |
![[ ]](/icons/layout.gif) | Sunburst_Muppet_Learning_Keys_Flier.pdf | 2023-06-16 14:56 | 13M | |
![[ ]](/icons/layout.gif) | Broderbund_Toy_Shop_manual_Apple_II.pdf | 2023-06-16 14:56 | 48M | |
![[ ]](/icons/layout.gif) | Sunburst_Education_The_Factory_manual_Apple_II.pdf | 2023-06-16 14:56 | 9.8M | |
![[ ]](/icons/layout.gif) | Hartley_Courseware_Print_Your_Own_Bingo_Plus_Apple_II.pdf | 2023-06-16 14:56 | 5.5M | |
![[ ]](/icons/layout.gif) | Unicorn_Educational_Software_Percentage_Panic_Apple_II_manual.pdf | 2023-06-16 14:56 | 24M | |
![[ ]](/icons/layout.gif) | Discovery_Software_Take_Me_North_manual_Apple_II.pdf | 2023-06-16 14:56 | 14M | |
![[ ]](/icons/layout.gif) | Kyodai_Broderbund_Ancient_Land_of_Ys_Apple_IIgs.pdf | 2023-06-16 14:56 | 16M | |
![[ ]](/icons/layout.gif) | Hartley_Moonlight_and_Madness_Level_II_Apple_II.pdf | 2023-06-16 14:55 | 15M | |
![[ ]](/icons/layout.gif) | Discovery_Software_Mighty_Math_Apple_II.pdf | 2023-06-16 14:55 | 14M | |
![[ ]](/icons/layout.gif) | Hartley_Courseware_K-10_Educational_Software_for_Apple_II.pdf | 2023-06-16 14:55 | 30M | |
![[ ]](/icons/layout.gif) | Discovery_Software_A-Mazing_Words_manual_Apple_II.pdf | 2023-06-16 14:55 | 13M | |
![[ ]](/icons/layout.gif) | Hartley_Courseware_Chariots_Cougars_and_Kings_Apple_II.pdf | 2023-06-16 14:55 | 12M | |
![[ ]](/icons/layout.gif) | EMC_Publishing_Praciquemis_espanol_manual_Apple_II.pdf | 2023-06-16 14:55 | 3.5M | |
![[ ]](/icons/layout.gif) | Sunburst_Education_software_catalog_1983.pdf | 2023-06-16 14:55 | 24M | |
![[ ]](/icons/layout.gif) | Hartley_Analogies_Tutorial_manual_Apple_II.pdf | 2023-06-16 14:55 | 12M | |
![[ ]](/icons/layout.gif) | Troll_Courseware_Motorcycles_Apple_II.pdf | 2023-06-16 14:55 | 21M | |
![[ ]](/icons/layout.gif) | Troll_Courseware_The_First_Thanksgiving_Apple_II.pdf | 2023-06-16 14:55 | 19M | |
![[ ]](/icons/layout.gif) | Troll_Courseware_Horses_Apple_II.pdf | 2023-06-16 14:55 | 16M | |
![[ ]](/icons/layout.gif) | Troll_Courseware_Pecos_Bill_Apple_II.pdf | 2023-06-16 14:55 | 22M | |
![[ ]](/icons/layout.gif) | Troll_Courseware_Alligators_and_Crocodiles_Apple_II.pdf | 2023-06-16 14:55 | 16M | |
![[ ]](/icons/layout.gif) | Troll_Courseware_Thunder__Lightning_manual_for_Apple_II.pdf | 2023-06-16 14:48 | 27M | |
![[ ]](/icons/layout.gif) | Focus_Media_Checkerboard_Trials_manual.pdf | 2023-06-16 14:48 | 5.8M | |
![[ ]](/icons/layout.gif) | Spinnaker_Counting_Parade_manual.pdf | 2023-06-16 14:48 | 3.9M | |
![[ ]](/icons/layout.gif) | Scott_Adams_Questprobe_featuring_Fantastic_Four_manual_for_Apple_II.pdf | 2023-06-16 14:48 | 4.9M | |
![[ ]](/icons/layout.gif) | DesignWare_Britannica_Software_Designasaurus_for_Apple_IIGS_manual.pdf | 2023-06-16 14:48 | 5.8M | |
![[ ]](/icons/layout.gif) | DLM_Alligator_Mix_Apple_II.pdf | 2023-06-16 14:48 | 1.2M | |
![[ ]](/icons/layout.gif) | MicroLearn_Computer_Learning_Systems_SAT_Math_I_manual_Apple_II.pdf | 2023-06-16 14:48 | 9.1M | |
![[ ]](/icons/layout.gif) | Hartley_Courseware_Word_Search_for_Apple_II_manual.pdf | 2023-06-16 14:48 | 5.8M | |
![[ ]](/icons/layout.gif) | Barnum_Software_The_Quarter_Mile_manual_for_Apple_II.pdf | 2023-06-16 14:48 | 8.5M | |
![[ ]](/icons/layout.gif) | Vision_Software_Sentences_for_Apple_II_box.pdf | 2023-06-16 14:48 | 6.1M | |
![[ ]](/icons/layout.gif) | Unicorn_Software_Funbunch_Apple_II.pdf | 2023-06-16 14:48 | 4.6M | |
![[ ]](/icons/layout.gif) | Hayden_Software_Factor_Blast_manual_for_Apple_II.pdf | 2023-06-16 14:48 | 9.7M | |
![[ ]](/icons/layout.gif) | Classic_Family_Software_Micro_Mother_Goose_manual_for_Apple_II.pdf | 2023-06-16 14:48 | 11M | |
![[ ]](/icons/layout.gif) | Enlightenment_Inc._Kings_Indian_Defense_for_Apple_II_manual.pdf | 2023-06-16 14:48 | 8.3M | |
![[ ]](/icons/layout.gif) | Broderbund_The_Playroom_manual.pdf | 2023-06-16 14:48 | 12M | |
![[ ]](/icons/layout.gif) | Hartley_Reading_for_Meaning_level_2_for_Apple_II_manual.pdf | 2023-06-16 14:48 | 12M | |
![[ ]](/icons/layout.gif) | Broderbund_The_Playroom_Teachers_Guide.pdf | 2023-06-16 14:48 | 13M | |
![[ ]](/icons/layout.gif) | Computer_Advanced_Ideas_The_Game_Show_for_Apple_II_manual.pdf | 2023-06-16 14:48 | 17M | |
![[ ]](/icons/layout.gif) | Accolade_Serve__Volley_manual.pdf | 2023-06-16 14:48 | 4.1M | |
![[ ]](/icons/layout.gif) | CBS_Software_Sesame_Street_Letter-Go-Round_manual.pdf | 2023-06-16 14:48 | 9.6M | |
![[ ]](/icons/layout.gif) | Random_House_Software_Shifty_Sam_for_Apple_II_manual.pdf | 2023-06-16 14:48 | 6.4M | |
![[ ]](/icons/layout.gif) | Lawrence_Productions_McGee_manual.pdf | 2023-06-16 14:48 | 1.8M | |
![[ ]](/icons/layout.gif) | Silver_Bullet_Systems_Cubic_Tic_Tac_Toe_for_Apple_II_manual.pdf | 2023-06-16 14:48 | 8.0M | |
![[ ]](/icons/layout.gif) | Didatech_Software_Crosscountry_USA_manual.pdf | 2023-06-16 14:48 | 18M | |
![[ ]](/icons/layout.gif) | Hartley_Courseware_Word-A-Tach_for_Apple_II_manual.pdf | 2023-06-16 14:48 | 7.1M | |
![[ ]](/icons/layout.gif) | The_Software_Guild_Cyborg_for_Apple_II_manual.pdf | 2023-06-16 14:48 | 5.2M | |
![[ ]](/icons/layout.gif) | CBS_Software_Sesame_Street_Astro_Grover_manual.pdf | 2023-06-16 14:48 | 17M | |
![[ ]](/icons/layout.gif) | Davidson_Associates_Math_Blaster_Plus_manual.pdf | 2023-06-16 14:48 | 5.8M | |
![[ ]](/icons/layout.gif) | The_Learning_Company_Math_Rabbit_for_Apple_II_manual.pdf | 2023-06-16 14:48 | 14M | |
![[ ]](/icons/layout.gif) | Krell_Software_Issac_Newton_plus_FG_Newton_manual_for_TRS-80Commodore_PET_Apple_II.pdf | 2023-06-16 14:48 | 5.9M | |
![[ ]](/icons/layout.gif) | The_Learning_Company_Think_Quick_for_Apple_II_manual.pdf | 2023-06-16 14:48 | 22M | |
![[ ]](/icons/layout.gif) | Eduware_Websters_Numbers_manual_for_Apple_II_and_Commodore_64.pdf | 2023-06-16 14:48 | 7.4M | |
![[ ]](/icons/layout.gif) | The_Learning_Company_Reader_Rabbit_for_Apple_IIGS_manual.pdf | 2023-06-16 14:48 | 16M | |
![[ ]](/icons/layout.gif) | The_Learning_Company_Writer_Rabbit_for_Apple_II_manual.pdf | 2023-06-16 14:48 | 15M | |
![[ ]](/icons/layout.gif) | Eduware_Introduction_To_Counting_manual.pdf | 2023-06-16 14:48 | 7.2M | |
![[ ]](/icons/layout.gif) | The_Learning_Company_Childrens_Writing_and_Publishing_Center_for_Apple_II_manual.pdf | 2023-06-16 14:48 | 23M | |
![[ ]](/icons/layout.gif) | The_Learning_Company_Writer_Rabbit_for_Apple_IIGS_manual.pdf | 2023-06-16 14:48 | 13M | |
![[ ]](/icons/layout.gif) | The_Learning_Company_Magic_Spells_for_Apple_II_manual.pdf | 2023-06-16 14:48 | 17M | |
![[ ]](/icons/layout.gif) | The_Learning_Company_Reader_Rabbit_for_Apple_II_manual.pdf | 2023-06-16 14:48 | 12M | |
![[ ]](/icons/layout.gif) | COMPress EnBASIC Authoring System Manual.pdf | 2023-06-12 06:20 | 104M | |
![[ ]](/icons/layout.gif) | Digicard 80 Column Card for Apple II II+ Instruction Manual.pdf | 2023-05-24 08:17 | 11M | |
![[ ]](/icons/layout.gif) | Apple Personal Modem Plus Owner's Manual (1988 Apple Computer Australia - NetComm Pty Ltd).pdf | 2023-05-10 08:13 | 31M | |
![[ ]](/icons/layout.gif) | The Apple Australia Special Education Resource Directory 1988.pdf | 2023-04-25 23:39 | 22M | |
![[ ]](/icons/layout.gif) | The User's Guide to the Apple Computers.pdf | 2023-03-14 23:44 | 64M | |
![[ ]](/icons/layout.gif) | Apple_Thesaurus.pdf | 2023-01-22 01:24 | 188M | |
![[ ]](/icons/layout.gif) | Apple II DeskTop System Software User's Guide.pdf | 2020-11-27 21:57 | 9.7M | |
![[ ]](/icons/layout.gif) | Heartbeat_Heartwork_Heartflow_RoyJosh_AHA.pdf | 2020-09-04 20:48 | 7.5M | |
![[ ]](/icons/layout.gif) | Stickybear_Spellgrabber-Users_Guide.pdf | 2020-05-03 19:58 | 83M | |
![[ ]](/icons/layout.gif) | Stickybear_Shapes-Users_Guide.pdf | 2020-05-03 19:57 | 21M | |
![[ ]](/icons/layout.gif) | Stickybear_Reading-Parent_Guide.pdf | 2020-05-03 19:57 | 45M | |
![[ ]](/icons/layout.gif) | Stickybear_Reading_Comprehension-Users_Guide.pdf | 2020-05-03 19:56 | 33M | |
![[ ]](/icons/layout.gif) | Stickybear_Math-Parent_Guide.pdf | 2020-05-03 19:56 | 49M | |
![[ ]](/icons/layout.gif) | Snoopy's_Reading_Machine-Manual.pdf | 2020-05-03 19:55 | 1.0M | |
![[ ]](/icons/layout.gif) | Sentence_Fun-Users_Guide.pdf | 2020-05-03 19:55 | 61M | |
![[ ]](/icons/layout.gif) | Mouse Desk 2.0 User's Manual (English)_OCR.pdf | 2019-10-29 23:04 | 46M | |
![[ ]](/icons/layout.gif) | Ulysses and the Golden Fleece Guide.pdf | 2019-08-11 11:00 | 2.3M | |
![[ ]](/icons/layout.gif) | The_Word_Master-Manual.pdf | 2019-06-13 10:05 | 3.5M | |
![[ ]](/icons/layout.gif) | The_Rain_Forest-Big_Book_Maker_-_Manual.pdf | 2019-06-13 10:05 | 11M | |
![[ ]](/icons/layout.gif) | Myths_and_Legends-Big_Book_Maker-Manual.pdf | 2019-06-13 10:03 | 13M | |
![[ ]](/icons/layout.gif) | ColorPlus-Manual.pdf | 2019-06-13 10:01 | 6.4M | |
![[ ]](/icons/compressed.gif) | Beauty_and_the_Beast_and_The_Little_Mermaid.zip | 2019-06-13 10:01 | 8.9M | |
![[ ]](/icons/compressed.gif) | Animals_with_an_Attitude.zip | 2019-06-13 10:00 | 14M | |
![[ ]](/icons/layout.gif) | Aesops_Fables-Manual_v2.pdf | 2019-06-13 10:00 | 435K | |
![[ ]](/icons/layout.gif) | Scholastic U.S. History Data Bases for PFS File manual.pdf | 2019-05-28 17:50 | 175M | |
![[ ]](/icons/layout.gif) | MECC H-111 Spare Moments manual.pdf | 2019-05-27 21:33 | 3.5M | |
![[ ]](/icons/layout.gif) | Speedy Delivery manual.pdf | 2019-05-27 21:33 | 2.2M | |
![[ ]](/icons/layout.gif) | arcade_machine_grid_paper.pdf | 2019-05-04 08:38 | 1.5M | |
![[ ]](/icons/layout.gif) | Music_Maker_manual.pdf | 2019-04-06 03:59 | 1.2M | |
![[ ]](/icons/layout.gif) | Graphics Package (1979-1980 MP Software).pdf | 2019-03-14 09:54 | 2.2M | |
![[ ]](/icons/unknown.gif) | Computer Cognition Manuals ReadMe.rtf | 2018-12-29 10:48 | 759 | |
![[ ]](/icons/layout.gif) | BOOT34.pdf | 2018-12-29 01:36 | 42K | |
![[ ]](/icons/unknown.gif) | BOOT.SYSTEM Documentation.PDF | 2018-12-29 01:36 | 42K | |
![[ ]](/icons/layout.gif) | MECC Odell Lake Manual.pdf | 2018-11-12 06:09 | 25M | |
![[ ]](/icons/layout.gif) | SuperCalc User's Guide & Reference Manual (1981 1st edition).pdf | 2018-11-02 06:01 | 15M | |
![[ ]](/icons/layout.gif) | World GeoGraph User's Guide plus original box & disks for Apple IIGS (1988 MECC).pdf | 2018-11-02 06:00 | 76M | |
![[ ]](/icons/layout.gif) | The Printerrupt manual for Snapshot IIe Card (1984 Dark Star Systems).pdf | 2018-10-12 21:20 | 7.6M | |
![[ ]](/icons/layout.gif) | Personal Newsletter manual for Apple IIe IIc IIGS.pdf | 2018-09-25 20:56 | 13M | |
![[ ]](/icons/layout.gif) | Zardax Word Processor manual (1981 Computer Solutions).pdf | 2018-09-25 20:55 | 35M | |
![[ ]](/icons/layout.gif) | ZARDAX quick reference card (1981).pdf | 2018-09-25 20:54 | 3.0M | |
![[ ]](/icons/layout.gif) | Word Handler User Guide.pdf | 2018-09-18 04:32 | 54M | |
![[ ]](/icons/layout.gif) | Sideways Configuration Guide.pdf | 2018-09-18 04:31 | 3.3M | |
![[ ]](/icons/layout.gif) | Shoebox Manual.pdf | 2018-09-18 04:30 | 32M | |
![[ ]](/icons/layout.gif) | ProFix Manual.pdf | 2018-09-18 04:28 | 16M | |
![[ ]](/icons/layout.gif) | Print5 Manual.pdf | 2018-09-18 04:28 | 13M | |
![[ ]](/icons/layout.gif) | Mavis Beacon Teaches Typing! Manual.pdf | 2018-09-18 04:26 | 40M | |
![[ ]](/icons/layout.gif) | Mavis Beacon Insert.pdf | 2018-09-18 04:25 | 4.9M | |
![[ ]](/icons/layout.gif) | Goodspell User's Manual.pdf | 2018-09-18 04:24 | 5.1M | |
![[ ]](/icons/layout.gif) | Cut & Paste Reference Card.pdf | 2018-09-18 04:23 | 1.6M | |
![[ ]](/icons/layout.gif) | Cut & Paste Manual.pdf | 2018-09-18 04:23 | 13M | |
![[ ]](/icons/layout.gif) | Childrens_Writing_&_Publishing_Center-Manual.pdf | 2018-08-31 06:45 | 17M | |
![[ ]](/icons/layout.gif) | Audiovisual Equipment Scheduling Program manual.pdf | 2018-08-02 15:38 | 11M | |
![[ ]](/icons/layout.gif) | Muppet Slate manual.pdf | 2018-08-02 15:34 | 117M | |
![[ ]](/icons/layout.gif) | The Babysitting Experience manual.pdf | 2018-08-02 15:33 | 5.9M | |
![[ ]](/icons/layout.gif) | Data Manager manual.pdf | 2018-08-02 15:33 | 13M | |
![[ ]](/icons/layout.gif) | Write A Story manual - for Magic Slate II.pdf | 2018-08-02 15:04 | 155M | |
![[ ]](/icons/layout.gif) | Word Detective manual.pdf | 2018-08-02 14:27 | 19M | |
![[ ]](/icons/layout.gif) | Safari Search manual.pdf | 2018-08-02 14:27 | 26M | |
![[ ]](/icons/layout.gif) | 3-2-1 Contact - Wild Things manual.pdf | 2018-08-02 14:26 | 14M | |
![[ ]](/icons/layout.gif) | The Puzzler manual.pdf | 2018-07-29 15:04 | 30M | |
![[ ]](/icons/layout.gif) | DB Master (Pete and Pam Computers).pdf | 2018-05-03 10:00 | 7.7M | |
![[ ]](/icons/layout.gif) | Sound Ideas Consonants manual.pdf | 2018-04-10 13:15 | 93M | |
![[ ]](/icons/layout.gif) | Sound Ideas Vowels manual.pdf | 2018-04-10 13:15 | 72M | |
![[ ]](/icons/layout.gif) | Sound Ideas Word Attack manual.pdf | 2018-04-10 13:14 | 63M | |
![[ ]](/icons/layout.gif) | The Home Accountant second edition manual.pdf | 2018-04-10 13:13 | 50M | |
![[ ]](/icons/layout.gif) | Kinder Koncepts manual.pdf | 2018-04-10 13:12 | 24M | |
![[ ]](/icons/layout.gif) | Energy Conversions manual.pdf | 2018-04-10 13:08 | 4.2M | |
![[ ]](/icons/layout.gif) | Electric Bill manual.pdf | 2018-04-10 13:08 | 4.3M | |
![[ ]](/icons/layout.gif) | DB Master Manual.pdf | 2018-04-07 07:58 | 89M | |
![[ ]](/icons/layout.gif) | Snapshot Copykit manual for Snapshot IIe Card (1984 Dark Star Systems).pdf | 2018-03-21 22:51 | 13M | |
![[ ]](/icons/layout.gif) | Be A Writer for Magic Slate II user manual.pdf | 2018-03-06 15:53 | 91M | |
![[ ]](/icons/layout.gif) | The Muppet Word Book user manual.pdf | 2018-03-05 19:20 | 55M | |
![[ ]](/icons/layout.gif) | Muppets on Stage user manual.pdf | 2018-03-05 19:20 | 45M | |
![[ ]](/icons/layout.gif) | PlayWrite The Talking Puppets manual.pdf | 2018-01-22 18:57 | 27M | |
![[ ]](/icons/layout.gif) | I Can Write for Magic Slate II manual.pdf | 2018-01-22 18:57 | 67M | |
![[ ]](/icons/layout.gif) | Chaos Plus manual.pdf | 2018-01-21 17:46 | 67M | |
![[ ]](/icons/layout.gif) | The Royal Rules manual.pdf | 2018-01-21 17:44 | 24M | |
![[ ]](/icons/layout.gif) | Micro-LADS manual.pdf | 2018-01-21 17:43 | 32M | |
![[ ]](/icons/layout.gif) | Flights into Fiction manual.pdf | 2018-01-21 17:42 | 26M | |
![[ ]](/icons/layout.gif) | The Physical Science Series - Sound manual.pdf | 2018-01-21 17:41 | 11M | |
![[ ]](/icons/layout.gif) | Discovering the Scientific Method manual.pdf | 2018-01-21 17:40 | 7.6M | |
![[ ]](/icons/layout.gif) | Advanced Math Shop manual.pdf | 2018-01-19 22:14 | 77M | |
![[ ]](/icons/layout.gif) | DeluxeWrite for Apple IIGS scanned original box & disks.pdf | 2018-01-16 23:27 | 1.6M | |
![[ ]](/icons/layout.gif) | Build A Circuit manual.pdf | 2018-01-10 10:11 | 59M | |
![[ ]](/icons/layout.gif) | Solve It manual.pdf | 2018-01-10 10:09 | 56M | |
![[ ]](/icons/compressed.gif) | Hypercard_IIGS-Manuals.zip | 2018-01-08 21:40 | 51M | |
![[ ]](/icons/layout.gif) | Software Arts DIF Technical Specifications.pdf | 2017-11-21 10:31 | 13M | |
![[ ]](/icons/layout.gif) | GraphWorks User's Manual version 1.0 (PBI Software).pdf | 2017-08-15 12:40 | 4.7M | |
![[ ]](/icons/layout.gif) | sublogic-a2-3d1-animation-package-photocopy.pdf | 2017-05-18 03:35 | 62M | |
![[ ]](/icons/layout.gif) | Merlin Pro Full Screen Editor.pdf | 2017-05-17 17:33 | 50M | |
![[ ]](/icons/layout.gif) | Super DIsk Copy - User Manual (Sensible Software, 1981).pdf | 2017-05-17 16:44 | 36M | |
![[ ]](/icons/layout.gif) | Multi-Disk Catalog - User Manual (Sensible Software, 1981).pdf | 2017-05-17 16:31 | 30M | |
![[ ]](/icons/layout.gif) | Disk Organizer - User Manual (Sensible Software, 1982).pdf | 2017-05-17 16:26 | 32M | |
![[ ]](/icons/layout.gif) | The Correspondent - Wagner 1981.pdf | 2017-05-17 16:22 | 11M | |
![[ ]](/icons/layout.gif) | EA_Music_Construction_Set_1987.pdf | 2017-05-17 16:15 | 3.9M | |
![[ ]](/icons/layout.gif) | Squire manual.pdf | 2017-02-23 23:15 | 77M | |
![[ ]](/icons/layout.gif) | Homeworker manual.pdf | 2017-02-23 23:14 | 69M | |
![[ ]](/icons/layout.gif) | Sir Isaac Newton's Games manual.pdf | 2017-02-23 23:14 | 17M | |
![[ ]](/icons/layout.gif) | The World's Greatest Football Game manual.pdf | 2017-02-23 23:13 | 49M | |
![[ ]](/icons/layout.gif) | Grasshopper Dissection manual.pdf | 2017-02-23 23:12 | 13M | |
![[ ]](/icons/layout.gif) | WISC-R sample output.pdf | 2017-02-23 23:11 | 21K | |
![[ ]](/icons/layout.gif) | the-bilestoad-manual.pdf | 2017-02-23 23:11 | 22M | |
![[ ]](/icons/layout.gif) | Snack Attack and Friends manual.pdf | 2017-02-23 23:10 | 4.4M | |
![[ ]](/icons/layout.gif) | Snack Attack and Friends disk.pdf | 2017-02-23 23:09 | 1.5M | |
![[ ]](/icons/layout.gif) | the-bilestoad-disk.pdf | 2017-02-23 23:09 | 1.2M | |
![[ ]](/icons/layout.gif) | Mrs. Wigglesworth's Secret.pdf | 2017-02-23 23:09 | 217M | |
![[ ]](/icons/layout.gif) | Granny Applebee's Cookie Factory manual.pdf | 2017-02-23 23:09 | 37M | |
![[ ]](/icons/layout.gif) | 20161003195514348-acr-cat-binder-ocr600.pdf | 2017-02-23 23:08 | 5.5M | |
![[ ]](/icons/layout.gif) | Platoon manual.pdf | 2017-02-23 23:08 | 20M | |
![[ ]](/icons/layout.gif) | 20161003194859913-acr-troll-money-binder-ocr600.pdf | 2017-02-23 23:08 | 4.7M | |
![[ ]](/icons/layout.gif) | The Semantic Calculator manual.pdf | 2017-02-23 23:07 | 35M | |
![[ ]](/icons/layout.gif) | 20161003194815354-troll-money-disk-ocr600.pdf | 2017-02-23 23:07 | 1.6M | |
![[ ]](/icons/layout.gif) | 20161003194635642-troll-cat-disk-ocr600.pdf | 2017-02-23 23:07 | 2.4M | |
![[ ]](/icons/layout.gif) | Math Leap Frog manual.pdf | 2017-02-23 23:07 | 7.7M | |
![[ ]](/icons/layout.gif) | Tobbs Learns Algebra manual.pdf | 2017-02-23 23:06 | 21M | |
![[ ]](/icons/layout.gif) | The Secrets of Science Island - Science Facts You Won't Believe.pdf | 2017-02-23 23:06 | 77M | |
![[ ]](/icons/layout.gif) | Dinosaur Discovery (Jacaranda Wiley).pdf | 2017-02-23 23:04 | 6.6M | |
![[ ]](/icons/layout.gif) | math-tutor-subtraction-2-disk.pdf | 2017-02-23 23:04 | 1.9M | |
![[ ]](/icons/layout.gif) | math-tutor-fractions-part-ii-disk-2-disk.pdf | 2017-02-23 23:03 | 1.1M | |
![[ ]](/icons/layout.gif) | opus-v10-disk.pdf | 2017-02-23 23:03 | 1.8M | |
![[ ]](/icons/layout.gif) | bumble-plot-manual.pdf | 2017-02-23 23:03 | 11M | |
![[ ]](/icons/layout.gif) | math-tutor-fractions-part-ii-disk-1-disk.pdf | 2017-02-23 23:03 | 1.2M | |
![[ ]](/icons/layout.gif) | dinner-on-a-disk-registration-card.pdf | 2017-02-23 23:03 | 1.8M | |
![[ ]](/icons/layout.gif) | dinner-on-a-disk-manual.pdf | 2017-02-23 23:03 | 2.9M | |
![[ ]](/icons/layout.gif) | dinner-on-a-disk-box.pdf | 2017-02-23 23:03 | 2.7M | |
![[ ]](/icons/layout.gif) | bumble-plot-box.pdf | 2017-02-23 23:03 | 6.2M | |
![[ ]](/icons/layout.gif) | Bumble Games manual.pdf | 2017-02-23 23:02 | 8.9M | |
![[ ]](/icons/layout.gif) | bumble-plot-disk.pdf | 2017-02-23 23:02 | 1.8M | |
![[ ]](/icons/layout.gif) | apple-cillin-ii-manual.pdf | 2017-02-23 23:02 | 2.2M | |
![[ ]](/icons/layout.gif) | The Secrets of Science Island manual.pdf | 2017-02-23 23:02 | 29M | |
![[ ]](/icons/layout.gif) | Sammy Lightfoot manual.pdf | 2017-02-23 23:02 | 481K | |
![[ ]](/icons/layout.gif) | apple-cillin-disk-bw.pdf | 2017-02-23 23:01 | 32K | |
![[ ]](/icons/layout.gif) | Fish scales (Computer file, 1985) [WorldCat.org].pdf | 2017-02-23 23:01 | 109K | |
![[ ]](/icons/layout.gif) | Math Shop manual.pdf | 2017-02-23 23:01 | 36M | |
![[ ]](/icons/layout.gif) | Learning to Read - Letters, Words, and Sentences volume 1 manual.pdf | 2017-02-23 23:01 | 43M | |
![[ ]](/icons/layout.gif) | Return to Reading - Lord of the Flies manual.pdf | 2017-02-23 22:59 | 23M | |
![[ ]](/icons/layout.gif) | 101 Misused Words manual.pdf | 2017-02-23 22:57 | 4.7M | |
![[ ]](/icons/layout.gif) | Math Shop reference card.pdf | 2017-02-23 22:57 | 1.0M | |
![[ ]](/icons/layout.gif) | Word Attack 1983 manual.pdf | 2017-02-23 22:57 | 28M | |
![[ ]](/icons/layout.gif) | Commas (Queue) manual.pdf | 2017-02-23 22:57 | 9.6M | |
![[ ]](/icons/layout.gif) | Basic Vocabulary Builder - Spanish manual.pdf | 2017-02-23 22:57 | 62M | |
![[ ]](/icons/layout.gif) | Case of the Missing Chick.pdf | 2017-02-23 22:56 | 260M | |
![[ ]](/icons/layout.gif) | The Quest for the Scarlet Letter manual.pdf | 2017-02-23 22:56 | 13M | |
![[ ]](/icons/layout.gif) | Reading Magic Library - Jack in the Beanstalk manual.pdf | 2017-02-23 22:54 | 26M | |
![[ ]](/icons/layout.gif) | English Challenge manual.pdf | 2017-02-23 22:53 | 13M | |
![[ ]](/icons/layout.gif) | The Vocabulary Game - Senior Level manual.pdf | 2017-02-23 22:52 | 6.9M | |
![[ ]](/icons/layout.gif) | Rocky's Boots 4.0 disk.pdf | 2017-02-23 22:51 | 1.8M | |
![[ ]](/icons/layout.gif) | The Perfect Score manual.pdf | 2017-02-23 22:51 | 74M | |
![[ ]](/icons/layout.gif) | Story Board manual.pdf | 2017-02-23 22:51 | 18M | |
![[ ]](/icons/layout.gif) | Write It Right user's guide.pdf | 2017-02-23 22:49 | 11M | |
![[ ]](/icons/layout.gif) | Word Attack Plus manual.pdf | 2017-02-23 22:49 | 37M | |
![[ ]](/icons/layout.gif) | Working Together manual.pdf | 2017-02-23 22:48 | 11M | |
![[ ]](/icons/layout.gif) | Working Together box cover.pdf | 2017-02-23 22:47 | 4.8M | |
![[ ]](/icons/layout.gif) | Understanding Maps and Globes user's guide.pdf | 2017-02-23 22:46 | 11M | |
![[ ]](/icons/layout.gif) | Case of the Great Train Robbery.pdf | 2017-02-23 22:45 | 206M | |
![[ ]](/icons/layout.gif) | The Geometric Supposer - Quadrilaterals manual.pdf | 2017-02-23 22:45 | 65M | |
![[ ]](/icons/layout.gif) | The Geometric Supposer - Quadrilaterals reference card.pdf | 2017-02-23 22:41 | 1.8M | |
![[ ]](/icons/layout.gif) | Spell It Plus manual.pdf | 2017-02-23 22:41 | 46M | |
![[ ]](/icons/layout.gif) | Spell It Plus teacher supplement.pdf | 2017-02-23 22:39 | 16M | |
![[ ]](/icons/layout.gif) | Reader Rabbit manual.pdf | 2017-02-23 22:38 | 25M | |
![[ ]](/icons/layout.gif) | PsychDisk manual.pdf | 2017-02-23 22:36 | 2.6M | |
![[ ]](/icons/layout.gif) | Practical Algebra manual.pdf | 2017-02-23 22:36 | 13M | |
![[ ]](/icons/layout.gif) | Practical Grammar II box cover.pdf | 2017-02-23 22:36 | 4.7M | |
![[ ]](/icons/layout.gif) | Math Blaster Plus manual (alt).pdf | 2017-02-23 22:35 | 31M | |
![[ ]](/icons/layout.gif) | Practical Algebra box cover.pdf | 2017-02-23 22:35 | 4.8M | |
![[ ]](/icons/layout.gif) | Parts of Speech - Fun with Verbs manual.pdf | 2017-02-23 22:34 | 10M | |
![[ ]](/icons/layout.gif) | Mrs. Wigglesworth's Secret user's guide.pdf | 2017-02-23 22:33 | 17M | |
![[ ]](/icons/layout.gif) | MasterType manual.pdf | 2017-02-23 22:33 | 42M | |
![[ ]](/icons/layout.gif) | Moptown Hotel manual.pdf | 2017-02-23 22:31 | 19M | |
![[ ]](/icons/layout.gif) | Mission Algebra manual.pdf | 2017-02-23 22:30 | 15M | |
![[ ]](/icons/layout.gif) | Kittens, Kids, and a Frog manual.pdf | 2017-02-23 22:28 | 26M | |
![[ ]](/icons/layout.gif) | Magical Myths manual.pdf | 2017-02-23 22:28 | 17M | |
![[ ]](/icons/layout.gif) | Let's Learn About The Library user's guide.pdf | 2017-02-23 22:28 | 15M | |
![[ ]](/icons/layout.gif) | Gertrude's Puzzles manual.pdf | 2017-02-23 22:26 | 20M | |
![[ ]](/icons/layout.gif) | Keyworks manual.pdf | 2017-02-23 22:25 | 13M | |
![[ ]](/icons/layout.gif) | In the Days of Knights and Castles user's guide.pdf | 2017-02-23 22:25 | 12M | |
![[ ]](/icons/layout.gif) | Dino Dig user's guide.pdf | 2017-02-23 22:24 | 9.2M | |
![[ ]](/icons/layout.gif) | Alge-Blaster manual.pdf | 2017-02-23 22:24 | 31M | |
![[ ]](/icons/layout.gif) | Garfield Double Dares manual.pdf | 2017-02-23 22:23 | 6.6M | |
![[ ]](/icons/layout.gif) | Curious George in Outer Space manual.pdf | 2017-02-23 22:22 | 16M | |
![[ ]](/icons/layout.gif) | Cause and Effect - What Makes It Happen user's guide.pdf | 2017-02-23 22:22 | 15M | |
![[ ]](/icons/layout.gif) | Case of the Great Train Robbery user's guide.pdf | 2017-02-23 22:20 | 12M | |
![[ ]](/icons/layout.gif) | NoteCard Maker User's Guide.pdf | 2017-02-23 22:20 | 18M | |
![[ ]](/icons/layout.gif) | Binomial Multiplication manual.pdf | 2017-02-23 22:20 | 8.5M | |
![[ ]](/icons/layout.gif) | NoteCard Maker Instructor's Guide.pdf | 2017-02-23 22:19 | 8.6M | |
![[ ]](/icons/layout.gif) | German Vocabulary Games manual.pdf | 2017-02-23 22:19 | 22M | |
![[ ]](/icons/layout.gif) | Monty Plays Scrabble 2.0 manual (photocopy).pdf | 2017-02-23 22:19 | 1.4M | |
![[ ]](/icons/layout.gif) | Math Tutor - Multiplication disk 1.pdf | 2017-02-23 22:19 | 2.0M | |
![[ ]](/icons/layout.gif) | NoteCard Maker registration card.pdf | 2017-02-23 22:19 | 4.9M | |
![[ ]](/icons/layout.gif) | NoteCard Maker box front.pdf | 2017-02-23 22:18 | 5.6M | |
![[ ]](/icons/layout.gif) | NoteCard Maker box back.pdf | 2017-02-23 22:18 | 3.9M | |
![[ ]](/icons/layout.gif) | Sentence Diagramming manual.pdf | 2017-02-23 22:18 | 2.4M | |
![[ ]](/icons/layout.gif) | Decimals 1.2 disk.pdf | 2017-02-23 22:18 | 2.0M | |
![[ ]](/icons/layout.gif) | Reading Comprehension disk.pdf | 2017-02-23 22:18 | 1.3M | |
![[ ]](/icons/layout.gif) | Sentence Diagramming disk 4.pdf | 2017-02-23 22:18 | 2.6M | |
![[ ]](/icons/layout.gif) | Sentence Diagramming disk 3.pdf | 2017-02-23 22:18 | 2.2M | |
![[ ]](/icons/layout.gif) | American Government manual.pdf | 2017-02-23 22:17 | 14M | |
![[ ]](/icons/layout.gif) | Weather Forecasting manual.pdf | 2017-02-23 22:17 | 10M | |
![[ ]](/icons/layout.gif) | Sentence Diagramming disk 2.pdf | 2017-02-23 22:17 | 2.2M | |
![[ ]](/icons/layout.gif) | Creature Creator manual.pdf | 2017-02-23 22:17 | 30M | |
![[ ]](/icons/layout.gif) | Sentence Diagramming disk 1.pdf | 2017-02-23 22:17 | 2.7M | |
![[ ]](/icons/layout.gif) | BrainWare Kit Booklet.pdf | 2017-02-23 22:17 | 46M | |
![[ ]](/icons/layout.gif) | Word Man user's guide.pdf | 2017-02-23 22:16 | 6.5M | |
![[ ]](/icons/layout.gif) | Crypto Cube 1984 manual.pdf | 2017-02-23 22:16 | 17M | |
![[ ]](/icons/layout.gif) | VCR Companion manual.pdf | 2017-02-23 22:16 | 66M | |
![[ ]](/icons/layout.gif) | Addition Magician insert.pdf | 2017-02-23 22:16 | 4.3M | |
![[ ]](/icons/layout.gif) | Addition Magician manual.pdf | 2017-02-23 22:15 | 8.5M | |
![[ ]](/icons/layout.gif) | Creature Creator registration card.pdf | 2017-02-23 22:14 | 5.3M | |
![[ ]](/icons/layout.gif) | Memory Castle 1983 program guide.pdf | 2017-02-23 22:14 | 50M | |
![[ ]](/icons/layout.gif) | The Decades Game 3 registration card.pdf | 2017-02-23 22:13 | 10M | |
![[ ]](/icons/layout.gif) | The Decades Game 3 box.pdf | 2017-02-23 22:13 | 19M | |
![[ ]](/icons/layout.gif) | The Decades Game 3 manual.pdf | 2017-02-23 22:12 | 5.9M | |
![[ ]](/icons/layout.gif) | Success with Reading (1985)(Scholastic) story disk F.pdf | 2017-02-23 22:11 | 4.2M | |
![[ ]](/icons/layout.gif) | Success with Reading (1985)(Scholastic) story disk E.pdf | 2017-02-23 22:11 | 3.6M | |
![[ ]](/icons/layout.gif) | Success with Reading (1985)(Scholastic) story disk C.pdf | 2017-02-23 22:11 | 2.8M | |
![[ ]](/icons/layout.gif) | Success with Reading (1985)(Scholastic) story disk D.pdf | 2017-02-23 22:11 | 3.6M | |
![[ ]](/icons/layout.gif) | Success with Reading (1985)(Scholastic) program disk.pdf | 2017-02-23 22:10 | 2.7M | |
![[ ]](/icons/layout.gif) | The Decades Game 2 box.pdf | 2017-02-23 22:10 | 19M | |
![[ ]](/icons/layout.gif) | Curious George Visits The Library user's guide.pdf | 2017-02-23 22:10 | 17M | |
![[ ]](/icons/layout.gif) | Memory Castle 1983 box.pdf | 2017-02-23 22:10 | 13M | |
![[ ]](/icons/layout.gif) | The Decades Game 2 manual.pdf | 2017-02-23 22:09 | 6.4M | |
![[ ]](/icons/layout.gif) | VCR Companion Teacher's Guide.pdf | 2017-02-23 22:08 | 5.2M | |
![[ ]](/icons/layout.gif) | VCR Companion reference card.pdf | 2017-02-23 22:08 | 5.2M | |
![[ ]](/icons/layout.gif) | Mr. and Mrs. Potato Head manual.pdf | 2017-02-23 22:08 | 7.8M | |
![[ ]](/icons/layout.gif) | Mr. and Mrs. Potato Head box back.pdf | 2017-02-23 22:08 | 9.0M | |
![[ ]](/icons/layout.gif) | Mr. and Mrs. Potato Head box inside cover.pdf | 2017-02-23 22:08 | 4.5M | |
![[ ]](/icons/layout.gif) | Mr. and Mrs. Potato Head box front.pdf | 2017-02-23 22:07 | 5.7M | |
![[ ]](/icons/layout.gif) | Mr. and Mrs. Potato Head registration card.pdf | 2017-02-23 22:07 | 369K | |
![[ ]](/icons/layout.gif) | The States game box front.pdf | 2017-02-23 22:07 | 10M | |
![[ ]](/icons/layout.gif) | The States Game manual.pdf | 2017-02-23 22:07 | 4.2M | |
![[ ]](/icons/layout.gif) | Tales of Fantasy disk.pdf | 2017-02-23 22:07 | 1.4M | |
![[ ]](/icons/layout.gif) | The States Game manual cover.pdf | 2017-02-23 22:07 | 1.9M | |
![[ ]](/icons/layout.gif) | Survey Taker manual.pdf | 2017-02-23 22:07 | 38M | |
![[ ]](/icons/layout.gif) | Basic Electronics - Fundamentals of DC Circuitry disks.pdf | 2017-02-23 22:07 | 13M | |
![[ ]](/icons/layout.gif) | The States Game box back.pdf | 2017-02-23 22:07 | 10M | |
![[ ]](/icons/layout.gif) | Basic Electronics - Electronic Fundamentals disks.pdf | 2017-02-23 22:07 | 12M | |
![[ ]](/icons/layout.gif) | Basic Electronics - Electronic Math disks.pdf | 2017-02-23 22:06 | 12M | |
![[ ]](/icons/layout.gif) | Logic Levels disk.pdf | 2017-02-23 22:05 | 2.3M | |
![[ ]](/icons/layout.gif) | Math Tutor - Fractions Part I disk 2.pdf | 2017-02-23 22:05 | 1.9M | |
![[ ]](/icons/layout.gif) | Math Tutor - Fractions Part I disk 1.pdf | 2017-02-23 22:05 | 1.3M | |
![[ ]](/icons/layout.gif) | Math Tutor - Division disk 2.pdf | 2017-02-23 22:05 | 1.4M | |
![[ ]](/icons/layout.gif) | Spell It manual.pdf | 2017-02-23 22:05 | 23M | |
![[ ]](/icons/layout.gif) | Math Tutor - Division disk 1.pdf | 2017-02-23 22:05 | 1.7M | |
![[ ]](/icons/layout.gif) | Math Tutor - Addition disk 2.pdf | 2017-02-23 22:05 | 1.7M | |
![[ ]](/icons/layout.gif) | Math Blaster Plus manual.pdf | 2017-02-23 22:05 | 24M | |
![[ ]](/icons/layout.gif) | Math Tutor - Addition disk 1.pdf | 2017-02-23 22:04 | 1.7M | |
![[ ]](/icons/layout.gif) | BurgerTime disk.pdf | 2017-02-23 22:04 | 1.8M | |
![[ ]](/icons/layout.gif) | The Flying Carpet disk.pdf | 2017-02-23 22:04 | 2.3M | |
![[ ]](/icons/layout.gif) | Word Invasion disk.pdf | 2017-02-23 22:04 | 3.2M | |
![[ ]](/icons/layout.gif) | Math Tutor - Decimals disk 2.pdf | 2017-02-23 22:04 | 1.7M | |
![[ ]](/icons/layout.gif) | Math Tutor - Decimals disk 1.pdf | 2017-02-23 22:03 | 1.8M | |
![[ ]](/icons/layout.gif) | Baron 2.1 disk.pdf | 2017-02-23 22:03 | 1.6M | |
![[ ]](/icons/layout.gif) | Delta Drawing 3.33 manual.pdf | 2017-02-23 22:03 | 10M | |
![[ ]](/icons/layout.gif) | Gertrude's Secrets 1.3 disk.pdf | 2017-02-23 22:03 | 3.0M | |
![[ ]](/icons/layout.gif) | Delta Drawing 3.33 box front.pdf | 2017-02-23 22:03 | 7.7M | |
![[ ]](/icons/layout.gif) | Spell It registration card.pdf | 2017-02-23 22:03 | 475K | |
![[ ]](/icons/layout.gif) | Spell It disk swap offer.pdf | 2017-02-23 22:03 | 271K | |
![[ ]](/icons/layout.gif) | Typing Is A Ball, Charlie Brown manual.pdf | 2017-02-23 22:02 | 6.6M | |
![[ ]](/icons/layout.gif) | Delta Drawing 3.33 box back.pdf | 2017-02-23 22:02 | 6.0M | |
![[ ]](/icons/layout.gif) | Typing Is A Ball, Charlie Brown disk.pdf | 2017-02-23 22:02 | 2.8M | |
![[ ]](/icons/layout.gif) | Typing Is A Ball, Charlie Brown binder.pdf | 2017-02-23 22:02 | 5.2M | |
![[ ]](/icons/layout.gif) | Typing Is A Ball, Charlie Brown cover.pdf | 2017-02-23 22:02 | 1.9M | |
![[ ]](/icons/layout.gif) | Graph Maker user's guide.pdf | 2017-02-23 22:02 | 6.1M | |
![[ ]](/icons/layout.gif) | Make A Face user's guide.pdf | 2017-02-23 22:02 | 5.7M | |
![[ ]](/icons/layout.gif) | Graph Maker disk.pdf | 2017-02-23 22:01 | 2.7M | |
![[ ]](/icons/layout.gif) | First Start Writing Program user's guide.pdf | 2017-02-23 22:01 | 11M | |
![[ ]](/icons/layout.gif) | Make A Face disk.pdf | 2017-02-23 22:01 | 2.1M | |
![[ ]](/icons/layout.gif) | Creatures of the Night manual.pdf | 2017-02-23 22:01 | 4.0M | |
![[ ]](/icons/layout.gif) | Mud Pies disk.pdf | 2017-02-23 22:01 | 2.1M | |
![[ ]](/icons/layout.gif) | Creatures of the Night disk.pdf | 2017-02-23 22:01 | 2.9M | |
![[ ]](/icons/layout.gif) | Creatures of the Night box.pdf | 2017-02-23 22:01 | 3.2M | |
![[ ]](/icons/layout.gif) | Birds (1984)(Troll Associates) manual.pdf | 2017-02-23 22:01 | 3.5M | |
![[ ]](/icons/layout.gif) | cause and Effect user's guide.pdf | 2017-02-23 22:01 | 9.5M | |
![[ ]](/icons/layout.gif) | Creatures of the Night audio casette.pdf | 2017-02-23 22:01 | 422K | |
![[ ]](/icons/layout.gif) | Birds (1984)(Troll Associates) disk.pdf | 2017-02-23 22:00 | 2.2M | |
![[ ]](/icons/layout.gif) | Birds (1984)(Troll Associates) box.pdf | 2017-02-23 22:00 | 3.4M | |
![[ ]](/icons/layout.gif) | First Start Writing Program disk.pdf | 2017-02-23 22:00 | 2.5M | |
![[ ]](/icons/layout.gif) | FixIt manual.pdf | 2017-02-23 22:00 | 10M | |
![[ ]](/icons/layout.gif) | Cause and Effect disk.pdf | 2017-02-23 22:00 | 2.5M | |
![[ ]](/icons/layout.gif) | Punctuation II - Commas, Commas, Commas disk.pdf | 2017-02-23 22:00 | 2.8M | |
![[ ]](/icons/layout.gif) | FixIt box.pdf | 2017-02-23 22:00 | 5.2M | |
![[ ]](/icons/layout.gif) | Diagramming Grammatical Relationships manual.pdf | 2017-02-23 22:00 | 19M | |
![[ ]](/icons/layout.gif) | Ortho's Personalized Plant Selector manual.pdf | 2017-02-23 22:00 | 21M | |
![[ ]](/icons/layout.gif) | FixIt disk.pdf | 2017-02-23 21:59 | 1.6M | |
![[ ]](/icons/layout.gif) | Introduction to Counting disk.pdf | 2017-02-23 21:59 | 2.0M | |
![[ ]](/icons/layout.gif) | Clowning Around disk.pdf | 2017-02-23 21:59 | 3.0M | |
![[ ]](/icons/layout.gif) | Diagramming Grammatical Relationships disk 5.pdf | 2017-02-23 21:59 | 1.8M | |
![[ ]](/icons/layout.gif) | Diagramming Grammatical Relationships disk 4.pdf | 2017-02-23 21:59 | 1.9M | |
![[ ]](/icons/layout.gif) | Gene Machine manual.pdf | 2017-02-23 21:59 | 19M | |
![[ ]](/icons/layout.gif) | Diagramming Grammatical Relationships disk 3.pdf | 2017-02-23 21:59 | 1.7M | |
![[ ]](/icons/layout.gif) | Diagramming Grammatical Relationships disk 2.pdf | 2017-02-23 21:59 | 1.9M | |
![[ ]](/icons/layout.gif) | Outpost manual.pdf | 2017-02-23 21:59 | 21M | |
![[ ]](/icons/layout.gif) | Diagramming Grammatical Relationships disk 1.pdf | 2017-02-23 21:59 | 1.8M | |
![[ ]](/icons/layout.gif) | Speed Reader II manual.pdf | 2017-02-23 21:58 | 21M | |
![[ ]](/icons/layout.gif) | Diagramming Grammatical Relationships insert.pdf | 2017-02-23 21:58 | 1.6M | |
![[ ]](/icons/layout.gif) | Montana Reading Program manual.pdf | 2017-02-23 21:57 | 12M | |
![[ ]](/icons/layout.gif) | Montana Reading Program flashcards.pdf | 2017-02-23 21:56 | 3.4M | |
![[ ]](/icons/layout.gif) | Apple_SSAFE_Project.pdf | 2017-02-23 13:20 | 27M | |
![[ ]](/icons/layout.gif) | Terrapin Logo PLUS manual.pdf | 2017-02-23 09:39 | 313M | |
![[ ]](/icons/layout.gif) | Minus Mission manual.pdf | 2017-02-23 09:31 | 3.7M | |
![[ ]](/icons/layout.gif) | The Halley Project - A Mission in Our Solar System - Game Manual (Mindscape Inc 1985) CHINESE.pdf | 2017-02-12 00:07 | 28M | |
![[ ]](/icons/layout.gif) | The Dam Busters Box & floppy (Terminator Co Ltd Taipei, Taiwan).pdf | 2017-02-12 00:05 | 4.8M | |
![[ ]](/icons/compressed.gif) | VCR_Companion-Manuals.zip | 2017-02-11 08:02 | 68M | |
![[ ]](/icons/compressed.gif) | StarSagaOne-Manuals.zip | 2017-02-11 08:01 | 80M | |
![[ ]](/icons/compressed.gif) | Knights_of_Legend-Manuals.zip | 2017-02-11 08:00 | 167M | |
![[ ]](/icons/layout.gif) | Storybook_Weaver_World_of_Make_Believe-Manual.pdf | 2017-02-11 08:00 | 15M | |
![[ ]](/icons/layout.gif) | Storybook_Weaver-Manual.pdf | 2017-02-11 08:00 | 13M | |
![[ ]](/icons/layout.gif) | Speed_Reader_II-Manual.pdf | 2017-02-11 07:59 | 3.4M | |
![[ ]](/icons/layout.gif) | Sensible_Speller_ProDOS-Manual.pdf | 2017-02-11 07:59 | 7.6M | |
![[ ]](/icons/compressed.gif) | Mickey's_Crossword_Puzzle_Maker-Manual.zip | 2017-02-11 07:59 | 13M | |
![[ ]](/icons/layout.gif) | Math_Blaster_Plus-Manual.pdf | 2017-02-11 07:58 | 4.0M | |
![[ ]](/icons/layout.gif) | DiscoverCAD-Manual.pdf | 2017-02-11 07:57 | 47M | |
![[ ]](/icons/layout.gif) | KidWriter_Golden_Edition-Manual.pdf | 2017-02-11 07:57 | 759K | |
![[ ]](/icons/layout.gif) | Gradebook Deluxe-Manual.pdf | 2017-02-11 07:57 | 9.7M | |
![[ ]](/icons/layout.gif) | Bank_Street_Writer_III-Manual.pdf | 2017-02-11 07:56 | 23M | |
![[ ]](/icons/layout.gif) | Classmate-Manual.pdf | 2017-02-11 07:56 | 3.8M | |
![[ ]](/icons/layout.gif) | Assist_Woodcock_Reading_Mastery_Tests-Manual.pdf | 2017-02-11 07:56 | 20M | |
![[ ]](/icons/layout.gif) | Airheart-Manual.pdf | 2017-02-11 07:55 | 5.9M | |
![[ ]](/icons/layout.gif) | 40,000_Selected_Words-Manual.pdf | 2017-02-11 07:55 | 2.2M | |
![[ ]](/icons/layout.gif) | Expert_Software_Personal_Skills.pdf | 2017-01-29 14:50 | 3.6M | |
![[ ]](/icons/layout.gif) | Apple-Cillin II Manual.pdf | 2017-01-28 15:12 | 12M | |
![[ ]](/icons/layout.gif) | Odell Lake Teacher Guide.pdf | 2017-01-22 04:41 | 1.6M | |
![[ ]](/icons/layout.gif) | Personal Publisher - User's Manual (Expert Software, 1988 - IBM PC, XT, AT, Apple IIe, IIc, IIGS (128K ProDOS), Commodore 64, 128).pdf | 2017-01-08 06:07 | 23M | |
![[ ]](/icons/layout.gif) | Creativity, Unlimited manual.pdf | 2017-01-06 23:12 | 43M | |
![[ ]](/icons/layout.gif) | The Right Turn manual.pdf | 2017-01-06 23:12 | 28M | |
![[ ]](/icons/layout.gif) | Odd One Out manual.pdf | 2017-01-06 23:11 | 24M | |
![[ ]](/icons/layout.gif) | Getting Ready To Read And Add manual.pdf | 2017-01-06 23:11 | 21M | |
![[TXT]](/icons/text.gif) | Lawless Legends outlaw editor docs.txt | 2016-12-21 23:14 | 4.5K | |
![[ ]](/icons/layout.gif) | ProSel8CompleteDocs.pdf | 2016-12-08 12:13 | 125K | |
![[ ]](/icons/layout.gif) | microsoft-multiplan-for-apple-ii.pdf | 2016-11-24 17:07 | 162M | |
![[ ]](/icons/layout.gif) | ASCII_Express_Instruction_Manual.pdf | 2016-10-31 14:07 | 56M | |
![[ ]](/icons/layout.gif) | Word Ladders manual.pdf | 2016-10-28 18:51 | 22M | |
![[ ]](/icons/layout.gif) | From ABC to XYZ manual.pdf | 2016-10-26 22:48 | 37M | |
![[ ]](/icons/layout.gif) | Language Carnival manual.pdf | 2016-10-26 22:47 | 4.6M | |
![[ ]](/icons/layout.gif) | Survival Math manual.pdf | 2016-10-19 17:06 | 34M | |
![[ ]](/icons/layout.gif) | ReportWriter manual.pdf | 2016-10-19 17:05 | 83M | |
![[ ]](/icons/layout.gif) | Magic Slate manual.pdf | 2016-10-19 17:03 | 150M | |
![[TXT]](/icons/text.gif) | CATWARES.TXT | 2016-10-14 23:46 | 15K | |
![[ ]](/icons/layout.gif) | VisiTerm Users Guide.pdf | 2016-10-12 13:51 | 17M | |
![[ ]](/icons/layout.gif) | Hyper_Stuff_Collection_Clip_Art_Plus-Manual.pdf | 2016-10-05 23:26 | 9.0M | |
![[ ]](/icons/layout.gif) | Merlin - A Macro Assembler (SDS, 1983) OCR (HQ).pdf | 2016-10-05 00:47 | 584M | |
![[ ]](/icons/layout.gif) | Merlin - A Macro Assembler (SDS, 1983) OCR.pdf | 2016-10-05 00:46 | 12M | |
![[ ]](/icons/layout.gif) | VCR Companion Film Library manual.pdf | 2016-10-03 10:59 | 48M | |
![[ ]](/icons/layout.gif) | First Hand manual.pdf | 2016-10-03 10:57 | 14M | |
![[ ]](/icons/layout.gif) | Crossword Magic 4.0 manual.pdf | 2016-10-01 19:16 | 79M | |
![[ ]](/icons/layout.gif) | Easy Working The Writer manual.pdf | 2016-10-01 12:11 | 28M | |
![[ ]](/icons/layout.gif) | Writer Rabbit 1986 manual (alt).pdf | 2016-10-01 11:42 | 41M | |
![[ ]](/icons/layout.gif) | SAT Score Improvement System Quantitative Comparisons and Word Problems manual.pdf | 2016-10-01 11:41 | 14M | |
![[ ]](/icons/layout.gif) | KidWriter Spanish manual.pdf | 2016-10-01 11:05 | 48M | |
![[ ]](/icons/layout.gif) | Real Math manual.pdf | 2016-10-01 10:43 | 14M | |
![[ ]](/icons/layout.gif) | Math Marvels manual.pdf | 2016-10-01 09:06 | 15M | |
![[ ]](/icons/layout.gif) | Homework Writer manual.pdf | 2016-10-01 09:05 | 34M | |
![[ ]](/icons/layout.gif) | Create Lessons Advanced manual.pdf | 2016-10-01 09:04 | 50M | |
![[ ]](/icons/layout.gif) | Capitalization manual.pdf | 2016-10-01 09:03 | 14M | |
![[ ]](/icons/layout.gif) | Apple Barrel Software_CDS_Corp.pdf | 2016-09-30 23:41 | 3.0M | |
![[ ]](/icons/layout.gif) | Monkey Business manual.pdf | 2016-09-29 15:50 | 16M | |
![[ ]](/icons/layout.gif) | Math in a Nutshell manual.pdf | 2016-09-29 15:50 | 16M | |
![[ ]](/icons/layout.gif) | Bank Street StoryBook manual.pdf | 2016-09-28 14:53 | 49M | |
![[ ]](/icons/layout.gif) | The Game Show - Foreign Language Words manual.pdf | 2016-09-27 09:28 | 9.8M | |
![[ ]](/icons/layout.gif) | Create Your Own Lessons manual.pdf | 2016-09-27 09:28 | 15M | |
![[ ]](/icons/layout.gif) | The Observatory manual.pdf | 2016-09-25 10:07 | 27M | |
![[ ]](/icons/layout.gif) | RoboMath manual.pdf | 2016-09-25 10:06 | 21M | |
![[ ]](/icons/layout.gif) | Mind Castle I manual.pdf | 2016-09-25 10:05 | 50M | |
![[ ]](/icons/layout.gif) | Word Prep Advanced manual.pdf | 2016-09-25 09:31 | 3.6M | |
![[ ]](/icons/layout.gif) | The Astronomy Disk manual.pdf | 2016-09-25 09:31 | 58M | |
![[ ]](/icons/layout.gif) | Space Array manual.pdf | 2016-09-25 09:30 | 5.4M | |
![[ ]](/icons/layout.gif) | Reader's Digest software catalog 1984.pdf | 2016-09-25 09:30 | 28M | |
![[ ]](/icons/layout.gif) | NetMaster and Zoom manual.pdf | 2016-09-25 09:29 | 662K | |
![[ ]](/icons/layout.gif) | Latin Exercises box cover.pdf | 2016-09-25 09:29 | 1.1M | |
![[ ]](/icons/layout.gif) | KidWriter Golden Edition manual.pdf | 2016-09-25 09:29 | 3.7M | |
![[ ]](/icons/layout.gif) | Basic Phonics Consonant Blends and Digraphs manual.pdf | 2016-09-25 09:29 | 19M | |
![[ ]](/icons/layout.gif) | Sierra product catalog tenth anniversary 1989.pdf | 2016-09-25 08:54 | 309M | |
![[ ]](/icons/layout.gif) | Gold Rush manual.pdf | 2016-09-25 08:46 | 75M | |
![[ ]](/icons/layout.gif) | Clozemaster manual.pdf | 2016-09-25 08:45 | 15M | |
![[ ]](/icons/layout.gif) | Scholastic Reading Comprehension manual.pdf | 2016-09-24 12:06 | 100M | |
![[ ]](/icons/layout.gif) | Steps to Comprehension manual.pdf | 2016-09-24 12:06 | 93M | |
![[ ]](/icons/layout.gif) | Scholastic Reading Comprehension Level D manual.pdf | 2016-09-24 12:02 | 50M | |
![[ ]](/icons/layout.gif) | Hartley Courseware Language Arts manual.pdf | 2016-09-24 12:00 | 34M | |
![[ ]](/icons/layout.gif) | Essential Idioms in English manual.pdf | 2016-09-24 11:56 | 15M | |
![[ ]](/icons/layout.gif) | Tiny Troll advertisement.pdf | 2016-09-24 11:27 | 17M | |
![[ ]](/icons/layout.gif) | Rosie the Counting Rabbit.pdf | 2016-09-24 11:25 | 168M | |
![[ ]](/icons/layout.gif) | Morgan Stanley Electronics Letter - October 19, 1979.pdf | 2016-09-24 11:20 | 9.1M | |
![[ ]](/icons/layout.gif) | Micrograms 1993 product catalog.pdf | 2016-09-24 11:20 | 42M | |
![[ ]](/icons/layout.gif) | Executive Briefing System review.pdf | 2016-09-24 11:17 | 11M | |
![[ ]](/icons/layout.gif) | Executive Briefing System dealer letter.pdf | 2016-09-24 11:16 | 3.0M | |
![[ ]](/icons/layout.gif) | Easy Working Planner manual.pdf | 2016-09-24 11:16 | 494K | |
![[ ]](/icons/layout.gif) | ThreeMileIsland.pdf | 2016-09-10 00:30 | 67M | |
![[ ]](/icons/layout.gif) | ClassicalMusicDisk-ForMusicConstructionSetIigs-ArrangementsByDougFulton-Ea-1987.pdf | 2016-09-10 00:28 | 1.6M | |
![[ ]](/icons/layout.gif) | Physics_Curriculum (with model rocketry).pdf | 2016-09-09 16:12 | 1.1M | |
![[ ]](/icons/layout.gif) | Bank Street Writer Plus Manual [b].pdf | 2016-08-27 12:35 | 42M | |
![[ ]](/icons/layout.gif) | Bank Street Writer Plus manual [a].pdf | 2016-08-27 12:30 | 83M | |
![[ ]](/icons/compressed.gif) | dlm_numberfarm.zip | 2016-08-27 09:32 | 9.4M | |
![[ ]](/icons/layout.gif) | SchoolWorks Teacher manual.pdf | 2016-07-02 10:20 | 21M | |
![[ ]](/icons/layout.gif) | Reading and Me 1988-10-31 manual.pdf | 2016-07-02 10:19 | 19M | |
![[ ]](/icons/layout.gif) | Math Blaster Plus 1988 manual.pdf | 2016-07-02 10:19 | 33M | |
![[ ]](/icons/layout.gif) | Fraction Factory (1990 rerelease) manual.pdf | 2016-07-02 10:18 | 7.4M | |
![[ ]](/icons/layout.gif) | Early Games for Young Children (1990 rerelease) manual.pdf | 2016-07-02 10:18 | 12M | |
![[ ]](/icons/layout.gif) | the-iii-magazine-may-1986.pdf | 2016-07-01 15:56 | 52M | |
![[ ]](/icons/layout.gif) | Notes_n_Files-Manual.pdf | 2016-06-16 12:37 | 25M | |
![[ ]](/icons/layout.gif) | Postcards-Designers_Guide.pdf | 2016-06-16 12:36 | 7.6M | |
![[ ]](/icons/layout.gif) | Drive_CleanerGS-Manual.pdf | 2016-06-16 12:36 | 1.5M | |
![[ ]](/icons/layout.gif) | SoftSwitch for Apple IIGS.pdf | 2016-05-22 13:14 | 108M | |
![[ ]](/icons/layout.gif) | MacroMate for Apple IIGS.pdf | 2016-05-21 16:29 | 135M | |
![[ ]](/icons/compressed.gif) | programe_brainteaserboulevard_completepackage.zip | 2016-05-17 08:07 | 6.7M | |
![[ ]](/icons/layout.gif) | Humanities Software 1988-89 product catalog.pdf | 2016-05-14 14:19 | 53M | |
![[ ]](/icons/layout.gif) | Key Words manual.pdf | 2016-05-14 14:18 | 29M | |
![[ ]](/icons/layout.gif) | Trickster Coyote manual.pdf | 2016-05-14 14:17 | 15M | |
![[ ]](/icons/layout.gif) | Key Lingo manual.pdf | 2016-05-14 14:17 | 11M | |
![[ ]](/icons/layout.gif) | Writer Rabbit 1986 manual.pdf | 2016-05-14 14:16 | 21M | |
![[ ]](/icons/layout.gif) | Sideways manual.pdf | 2016-05-14 14:16 | 19M | |
![[ ]](/icons/layout.gif) | Slalom Appleworks Spreadsheet Printer manual.pdf | 2016-05-14 14:15 | 5.6M | |
![[ ]](/icons/layout.gif) | Gertrude's Secrets 1984 manual.pdf | 2016-05-14 14:15 | 10M | |
![[ ]](/icons/layout.gif) | microtek-most-popular-book.pdf | 2016-05-10 08:53 | 54M | |
![[ ]](/icons/layout.gif) | Graphics Magician - Manual.pdf | 2016-05-10 07:26 | 9.1M | |
![[ ]](/icons/layout.gif) | The Voice (Muse).pdf | 2016-05-10 06:53 | 1.9M | |
![[ ]](/icons/layout.gif) | Graphics Magician - Programming Tutorial.pdf | 2016-05-10 06:52 | 1.6M | |
![[ ]](/icons/layout.gif) | Spell It 1984 manual.pdf | 2016-05-05 11:01 | 32M | |
![[ ]](/icons/layout.gif) | Easy Working Writer - Filer - Planner manual.pdf | 2016-05-02 17:07 | 58M | |
![[ ]](/icons/layout.gif) | apple writer 2-word processing language.pdf | 2016-04-30 22:08 | 5.9M | |
![[ ]](/icons/layout.gif) | Certificate Maker manual.pdf | 2016-04-30 11:13 | 57M | |
![[ ]](/icons/layout.gif) | Writing Skills volume 5 manual.pdf | 2016-04-30 11:09 | 39M | |
![[ ]](/icons/layout.gif) | Writing Skills Volume 4 manual.pdf | 2016-04-30 11:08 | 39M | |
![[ ]](/icons/layout.gif) | Writing Skills Volume 3 manual.pdf | 2016-04-30 11:07 | 38M | |
![[ ]](/icons/layout.gif) | Writing Skills Volume 2 manual.pdf | 2016-04-30 11:06 | 39M | |
![[ ]](/icons/layout.gif) | Mixed-Up Mother Goose manual.pdf | 2016-04-28 21:20 | 36M | |
![[ ]](/icons/layout.gif) | Mathematics Problem Solving Software Level 2 manual.pdf | 2016-04-28 21:19 | 25M | |
![[ ]](/icons/layout.gif) | Certificate Library Volume 1 manual.pdf | 2016-04-28 21:18 | 18M | |
![[ ]](/icons/layout.gif) | Anova manual.pdf | 2016-04-28 21:17 | 5.3M | |
![[ ]](/icons/layout.gif) | Magic Spells manual.pdf | 2016-04-28 16:14 | 33M | |
![[ ]](/icons/layout.gif) | The Efficient Reading Builder 2 manual.pdf | 2016-04-27 15:06 | 20M | |
![[ ]](/icons/layout.gif) | The Efficient Reading Builder 1 manual.pdf | 2016-04-27 15:06 | 20M | |
![[ ]](/icons/layout.gif) | Matchmaker Vocabulary manual.pdf | 2016-04-27 15:05 | 17M | |
![[ ]](/icons/layout.gif) | EasyReader Learn About Words in Reading 2 manual.pdf | 2016-04-27 15:05 | 20M | |
![[ ]](/icons/layout.gif) | EasyReader Reading Comprehension Skills 3 manual.pdf | 2016-04-27 15:04 | 23M | |
![[ ]](/icons/layout.gif) | EasyReader Reading Comprehension Skills 1 manual.pdf | 2016-04-27 15:04 | 20M | |
![[ ]](/icons/layout.gif) | Classmate manual.pdf | 2016-04-27 15:03 | 40M | |
![[ ]](/icons/layout.gif) | Cause and Effect - Mountain Climbing - Blue Level manual.pdf | 2016-04-27 15:01 | 11M | |
![[ ]](/icons/layout.gif) | The Sensible Speller for ProDOS manual.pdf | 2016-04-24 17:46 | 51M | |
![[ ]](/icons/layout.gif) | Hands-On Math Volume II manual.pdf | 2016-04-24 17:45 | 103M | |
![[ ]](/icons/layout.gif) | Graph-It manual.pdf | 2016-04-24 16:41 | 68M | |
![[ ]](/icons/layout.gif) | Alge-Blaster manual (alt).pdf | 2016-04-24 12:42 | 34M | |
![[ ]](/icons/layout.gif) | Snooper Troops 2 manual.pdf | 2016-04-24 12:40 | 49M | |
![[ ]](/icons/layout.gif) | High School Math Competency Series manual.pdf | 2016-04-24 12:39 | 12M | |
![[ ]](/icons/layout.gif) | Sensible Grammar 1985-12-09 manual.pdf | 2016-04-24 12:38 | 50M | |
![[ ]](/icons/layout.gif) | The Sensible Speller IV manual.pdf | 2016-04-24 12:37 | 63M | |
![[ ]](/icons/layout.gif) | Who What Where When Why manual (alt).pdf | 2016-04-24 12:36 | 16M | |
![[ ]](/icons/compressed.gif) | legacy_spectrum_manuals.zip | 2016-04-18 13:04 | 9.6M | |
![[ ]](/icons/layout.gif) | link_layer_manual.pdf | 2016-04-18 13:04 | 5.7M | |
![[ ]](/icons/layout.gif) | Piece of Cake Math manual.pdf | 2016-04-17 14:28 | 11M | |
![[ ]](/icons/layout.gif) | Mathematics Problem Solving Software Level 3 manual.pdf | 2016-04-17 14:27 | 25M | |
![[ ]](/icons/layout.gif) | Bank Street Writer Plus manual (alt).pdf | 2016-04-17 12:07 | 83M | |
![[ ]](/icons/layout.gif) | Algebra volume 5 and 6 manual.pdf | 2016-04-17 12:05 | 30M | |
![[ ]](/icons/layout.gif) | Read and Rhyme manual.pdf | 2016-04-16 13:03 | 21M | |
![[ ]](/icons/layout.gif) | Memory Castle manual.pdf | 2016-04-16 12:59 | 63M | |
![[ ]](/icons/layout.gif) | NoteCard Maker manual.pdf | 2016-04-16 12:56 | 41M | |
![[ ]](/icons/layout.gif) | German Vocabulary manual.pdf | 2016-04-16 12:50 | 13M | |
![[ ]](/icons/layout.gif) | FileWriter manual.pdf | 2016-04-16 12:49 | 39M | |
![[ ]](/icons/layout.gif) | DesignWare product catalog October 1984.pdf | 2016-04-16 12:11 | 52M | |
![[ ]](/icons/layout.gif) | Algebra volume 4 manual.pdf | 2016-04-16 12:10 | 30M | |
![[ ]](/icons/layout.gif) | Learning to Read - Letters, Words, and Sentences volume 3 manual.pdf | 2016-04-15 22:10 | 41M | |
![[ ]](/icons/layout.gif) | Learning to Read - Letters, Words, and Sentences volume 2 manual.pdf | 2016-04-15 22:09 | 41M | |
![[ ]](/icons/layout.gif) | Return to Reading - The Hobbit manual.pdf | 2016-04-13 22:10 | 12M | |
![[ ]](/icons/layout.gif) | Return to Reading - The Lion, The Witch, and the Wardrobe manual.pdf | 2016-04-13 22:09 | 12M | |
![[ ]](/icons/layout.gif) | Return to Reading - Tom Sawyer manual.pdf | 2016-04-13 22:09 | 12M | |
![[ ]](/icons/layout.gif) | Return to Reading - Charlotte's Web manual.pdf | 2016-04-13 22:08 | 12M | |
![[ ]](/icons/layout.gif) | Graphics Converter manual.pdf | 2016-04-13 22:08 | 26M | |
![[ ]](/icons/layout.gif) | willy-byte-manual-photocopy-source(a).pdf | 2016-04-12 20:10 | 34M | |
![[ ]](/icons/layout.gif) | baudville-prince-photocopy-source(a).pdf | 2016-04-12 19:52 | 36M | |
![[ ]](/icons/layout.gif) | willy-byte-manual-photocopy-source.pdf | 2016-04-12 19:41 | 34M | |
![[ ]](/icons/layout.gif) | the-brain-game-photocopy-source.pdf | 2016-04-12 19:39 | 11M | |
![[ ]](/icons/layout.gif) | montezumas-revenge-manual-photocopy-source.pdf | 2016-04-12 19:33 | 7.8M | |
![[ ]](/icons/layout.gif) | micro-cookbook-user-guide-iie-iic-128k-prodos-photocopy-source.pdf | 2016-04-12 19:32 | 30M | |
![[ ]](/icons/layout.gif) | spy-vs-spy-users-guide-photocopy-source.pdf | 2016-04-12 19:29 | 11M | |
![[ ]](/icons/layout.gif) | willy-byte-command-summary-card.pdf | 2016-04-12 19:29 | 919K | |
![[ ]](/icons/layout.gif) | hand-holding-basic-photocopy-source.pdf | 2016-04-12 19:28 | 41M | |
![[ ]](/icons/layout.gif) | micro-cookbook-user-guide-iie-64k-dos-3.3-photocopy-source.pdf | 2016-04-12 19:23 | 19M | |
![[ ]](/icons/layout.gif) | am3-12um-part-2-guide-to-apple-iii.pdf | 2016-04-12 19:17 | 44M | |
![[ ]](/icons/layout.gif) | micro-cookbook-reference-card-photocopy-source.pdf | 2016-04-12 19:15 | 1.9M | |
![[ ]](/icons/layout.gif) | baudville-prince-photocopy-source.pdf | 2016-04-12 19:14 | 36M | |
![[ ]](/icons/layout.gif) | crisis-mountain-photocopy-source.pdf | 2016-04-12 19:08 | 3.8M | |
![[ ]](/icons/layout.gif) | create-with-garfield-photocopy-source.pdf | 2016-04-12 19:06 | 7.9M | |
![[ ]](/icons/layout.gif) | accent-soft-step-debugger-photocopy-source.pdf | 2016-04-12 19:01 | 13M | |
![[ ]](/icons/layout.gif) | Peachtree product catalog.pdf | 2016-04-11 18:52 | 33M | |
![[ ]](/icons/layout.gif) | Shopping with the Yellow Pages manual.pdf | 2016-04-10 21:42 | 4.0M | |
![[ ]](/icons/layout.gif) | Reading the Yellow Pages activity workbook.pdf | 2016-04-10 21:42 | 27M | |
![[ ]](/icons/layout.gif) | Algebra Plotter Plus instructions.pdf | 2016-04-07 21:49 | 1.3M | |
![[ ]](/icons/layout.gif) | Tomahawk manual.pdf | 2016-04-07 21:49 | 21M | |
![[ ]](/icons/layout.gif) | The Dark Heart of Uukrul manual.pdf | 2016-04-07 14:58 | 61M | |
![[ ]](/icons/layout.gif) | Bank Street Writer III manual.pdf | 2016-04-07 14:56 | 191M | |
![[ ]](/icons/layout.gif) | Operation Frog manual.pdf | 2016-04-06 11:41 | 39M | |
![[ ]](/icons/layout.gif) | Bubble Bobble manual.pdf | 2016-04-06 11:40 | 18M | |
![[ ]](/icons/layout.gif) | Algebra Plotter Plus manual.pdf | 2016-04-05 19:42 | 85M | |
![[ ]](/icons/layout.gif) | Sub Battle Simulator manual.pdf | 2016-04-05 17:10 | 31M | |
![[ ]](/icons/layout.gif) | DOS BOSS manual.pdf | 2016-04-05 17:09 | 28M | |
![[ ]](/icons/layout.gif) | Alter Ego manual.pdf | 2016-04-05 17:09 | 15M | |
![[ ]](/icons/layout.gif) | Garry Kitchen's GameMaker quick reference booklet.pdf | 2016-04-05 17:08 | 5.0M | |
![[ ]](/icons/layout.gif) | Garry Kitchen's GameMaker manual.pdf | 2016-04-05 17:08 | 44M | |
![[ ]](/icons/layout.gif) | Russki Duck manual.pdf | 2016-04-05 17:07 | 6.3M | |
![[ ]](/icons/layout.gif) | Math Class Level 5 manual.pdf | 2016-04-05 17:07 | 13M | |
![[ ]](/icons/layout.gif) | The Dark Heart of Uukrul decoder ring.pdf | 2016-04-05 17:06 | 14M | |
![[ ]](/icons/layout.gif) | Teddy Bearrels of Fun manual.pdf | 2016-04-04 15:46 | 53M | |
![[ ]](/icons/layout.gif) | Financial Planning for Multiplan manual.pdf | 2016-04-03 20:54 | 53M | |
![[ ]](/icons/layout.gif) | Spanish Grammar Review - Future and Conditional Tenses of Regular and Irregular Verbs manual.pdf | 2016-04-03 20:52 | 16M | |
![[ ]](/icons/layout.gif) | Spanish Grammar Review - Familiar and Formal Commands in the Affirmative and Negative manual.pdf | 2016-04-03 20:51 | 14M | |
![[ ]](/icons/layout.gif) | Jack and the Beanstalk manual.pdf | 2016-04-03 20:50 | 27M | |
![[ ]](/icons/layout.gif) | The Brain Game manual.pdf | 2016-04-03 20:50 | 75M | |
![[ ]](/icons/layout.gif) | Sliding Block manual.pdf | 2016-04-03 20:48 | 11M | |
![[ ]](/icons/layout.gif) | Mathematics Problem Solving Software Level 1 manual.pdf | 2016-04-03 20:48 | 27M | |
![[ ]](/icons/layout.gif) | The Spelling Machine manual.pdf | 2016-04-03 20:47 | 16M | |
![[ ]](/icons/layout.gif) | HRM Software warranty card.pdf | 2016-04-03 20:47 | 17M | |
![[ ]](/icons/layout.gif) | Millennium Group product catalog.pdf | 2016-04-03 20:46 | 40M | |
![[ ]](/icons/layout.gif) | Who What Where When Why manual.pdf | 2016-04-03 17:17 | 16M | |
![[ ]](/icons/layout.gif) | Transportation Transformation manual.pdf | 2016-04-03 17:17 | 22M | |
![[ ]](/icons/layout.gif) | Fact or Opinion manual.pdf | 2016-04-03 17:16 | 14M | |
![[ ]](/icons/layout.gif) | The Otters' Adventure manual.pdf | 2016-04-03 17:16 | 39M | |
![[ ]](/icons/layout.gif) | Read and Rhyme box.pdf | 2016-04-03 16:44 | 12M | |
![[ ]](/icons/layout.gif) | Read and Rhyme order form.pdf | 2016-04-03 16:43 | 9.1M | |
![[ ]](/icons/layout.gif) | The Learning Company product catalog 1988-09-09.pdf | 2016-04-03 16:43 | 31M | |
![[ ]](/icons/layout.gif) | Unicorn Software product catalog.pdf | 2016-04-03 16:41 | 60M | |
![[ ]](/icons/layout.gif) | lexicheck-for-apple-iii.pdf | 2016-04-03 14:09 | 18M | |
![[ ]](/icons/layout.gif) | quark-word-juggler-users-manual-apple-iii.pdf | 2016-04-03 11:44 | 149M | |
![[ ]](/icons/layout.gif) | Police Quest manual.pdf | 2016-04-03 11:08 | 48M | |
![[ ]](/icons/layout.gif) | Talking Reader Rabbit manual.pdf | 2016-04-03 10:52 | 43M | |
![[ ]](/icons/layout.gif) | MasterType's Writing Wizard manual.pdf | 2016-04-03 10:51 | 62M | |
![[ ]](/icons/layout.gif) | Tetris manual.pdf | 2016-04-03 10:49 | 32M | |
![[ ]](/icons/layout.gif) | Drug Alert manual.pdf | 2016-04-03 10:49 | 45M | |
![[ ]](/icons/layout.gif) | Banner Builder manual.pdf | 2016-04-03 10:47 | 2.2M | |
![[ ]](/icons/layout.gif) | Mr. Pixel reference card.pdf | 2016-04-03 10:46 | 1.1M | |
![[ ]](/icons/layout.gif) | Read N Roll manual.pdf | 2016-04-03 10:46 | 16M | |
![[ ]](/icons/layout.gif) | Welltris advertisement.pdf | 2016-04-03 10:45 | 7.2M | |
![[ ]](/icons/layout.gif) | apple-writer-tutor.pdf | 2016-04-02 18:44 | 176M | |
![[ ]](/icons/layout.gif) | sargon-ii-manual-photocopy-source.pdf | 2016-03-30 15:14 | 9.8M | |
![[ ]](/icons/layout.gif) | apple-modem-300-1200-users-manual-part-2-guide-to-apple-iii.pdf | 2016-03-29 12:52 | 44M | |
![[ ]](/icons/layout.gif) | Tharolian Tunnels - Game Manual.pdf | 2016-03-28 15:23 | 16M | |
![[ ]](/icons/layout.gif) | Canyon Climber manual.pdf | 2016-03-27 11:57 | 1.3M | |
![[ ]](/icons/layout.gif) | Canyon Climber registration card.pdf | 2016-03-27 11:57 | 5.8M | |
![[ ]](/icons/layout.gif) | Design Your Own Home - Architectural Design 1984 manual.pdf | 2016-03-27 11:57 | 37M | |
![[ ]](/icons/layout.gif) | Design Your Own Home - Architectural Design 1984 command card.pdf | 2016-03-27 11:56 | 13M | |
![[ ]](/icons/layout.gif) | Design Your Own Home - Architectural Design 1984 workbook.pdf | 2016-03-27 11:55 | 5.0M | |
![[ ]](/icons/layout.gif) | ArithMAGIC Subtraction manual.pdf | 2016-03-27 11:55 | 17M | |
![[ ]](/icons/layout.gif) | Ski Crazed manual.pdf | 2016-03-27 11:55 | 31M | |
![[ ]](/icons/layout.gif) | Bubble Bobble box.pdf | 2016-03-27 11:54 | 15M | |
![[ ]](/icons/layout.gif) | Turtle Tracks manual.pdf | 2016-03-27 11:54 | 55M | |
![[ ]](/icons/layout.gif) | baudville-catalog.pdf | 2016-03-25 14:51 | 7.8M | |
![[ ]](/icons/layout.gif) | Educators' Guide to Software Copyright Policies and Ethics (1990-Scholastic).pdf | 2016-03-23 21:32 | 4.6M | |
![[ ]](/icons/layout.gif) | Orbitron manual.pdf | 2016-03-23 21:32 | 8.6M | |
![[ ]](/icons/layout.gif) | UpTime Classics product catalog.pdf | 2016-03-23 21:32 | 63M | |
![[ ]](/icons/layout.gif) | the-warp-factor-photocopy-source.pdf | 2016-03-22 16:17 | 52M | |
![[ ]](/icons/layout.gif) | MurderOnTheZinderneuf-photocopy-source.pdf | 2016-03-22 14:39 | 24M | |
![[ ]](/icons/layout.gif) | RoboCAD2Libraries.pdf | 2016-03-22 11:26 | 1.3M | |
![[ ]](/icons/layout.gif) | RoboCAD2Plots.pdf | 2016-03-22 11:25 | 518K | |
![[ ]](/icons/layout.gif) | RoboCAD27Addendum.pdf | 2016-03-22 11:25 | 403K | |
![[ ]](/icons/layout.gif) | Gertrude's Secrets manual.pdf | 2016-03-19 10:59 | 42M | |
![[ ]](/icons/layout.gif) | Gertrude's Puzzles manual (alt).pdf | 2016-03-19 10:58 | 44M | |
![[ ]](/icons/layout.gif) | Go To The Head Of The Class manual.pdf | 2016-03-19 10:57 | 8.1M | |
![[ ]](/icons/layout.gif) | Reader Rabbit manual (alt).pdf | 2016-03-19 10:57 | 15M | |
![[ ]](/icons/layout.gif) | Rocky's Boots manual (alt).pdf | 2016-03-19 10:56 | 13M | |
![[ ]](/icons/layout.gif) | Computer-Advanced Ideas product catalog undated.pdf | 2016-03-19 10:56 | 7.8M | |
![[ ]](/icons/layout.gif) | Extra Extra manual.pdf | 2016-03-19 10:56 | 8.8M | |
![[ ]](/icons/layout.gif) | Master Match Science and Math manual.pdf | 2016-03-19 10:56 | 19M | |
![[ ]](/icons/layout.gif) | Adventure Creator box.pdf | 2016-03-19 10:54 | 23M | |
![[ ]](/icons/layout.gif) | The Secrets of Science Island box front.pdf | 2016-03-18 21:28 | 6.5M | |
![[ ]](/icons/layout.gif) | The Secrets of Science Island box back.pdf | 2016-03-18 21:28 | 5.1M | |
![[ ]](/icons/layout.gif) | Scholastic Software backup policy card.pdf | 2016-03-18 21:28 | 190K | |
![[ ]](/icons/layout.gif) | The World of Counting brochure.pdf | 2016-03-18 21:28 | 15M | |
![[ ]](/icons/layout.gif) | Algebra 1 (Edu-Ware) manual.pdf | 2016-03-18 21:27 | 9.4M | |
![[ ]](/icons/layout.gif) | The Last Ninja command card.pdf | 2016-03-18 21:27 | 3.3M | |
![[ ]](/icons/layout.gif) | The Last Ninja revenger's pathbook.pdf | 2016-03-18 21:27 | 5.4M | |
![[ ]](/icons/layout.gif) | That's My Story read me first document.pdf | 2016-03-18 21:27 | 1.0M | |
![[ ]](/icons/layout.gif) | Think Quick player guide.pdf | 2016-03-18 21:27 | 23M | |
![[ ]](/icons/layout.gif) | Think Quick teacher guide.pdf | 2016-03-18 21:26 | 14M | |
![[ ]](/icons/layout.gif) | Think Quick quick start guide.pdf | 2016-03-18 21:26 | 3.2M | |
![[ ]](/icons/layout.gif) | Winter Games IIgs command card.pdf | 2016-03-18 21:26 | 643K | |
![[ ]](/icons/layout.gif) | Monte Carlo IIgs manual.pdf | 2016-03-18 21:26 | 29M | |
![[ ]](/icons/layout.gif) | Winter Games manual.pdf | 2016-03-18 21:25 | 16M | |
![[ ]](/icons/layout.gif) | That's My Story manual.pdf | 2016-03-18 21:24 | 15M | |
![[ ]](/icons/layout.gif) | The World of Counting manual.pdf | 2016-03-18 21:24 | 11M | |
![[ ]](/icons/layout.gif) | The Secrets of Science Island resource book.pdf | 2016-03-18 21:22 | 18M | |
![[ ]](/icons/layout.gif) | Reading Comprehension - What's Different manual.pdf | 2016-03-18 21:19 | 14M | |
![[ ]](/icons/layout.gif) | States and Traits manual.pdf | 2016-03-18 21:18 | 26M | |
![[ ]](/icons/layout.gif) | Case of the Missing Chick (alt).pdf | 2016-03-18 12:12 | 261M | |
![[ ]](/icons/layout.gif) | Easy Working manual printing instructions.pdf | 2016-03-18 12:06 | 574K | |
![[ ]](/icons/layout.gif) | Shanghai IIgs manual.pdf | 2016-03-18 12:06 | 6.5M | |
![[ ]](/icons/layout.gif) | Let's Make Greeting Cards manual.pdf | 2016-03-18 12:06 | 4.7M | |
![[ ]](/icons/layout.gif) | Thunder Mountain registration card.pdf | 2016-03-18 12:05 | 1.0M | |
![[ ]](/icons/layout.gif) | Looney Tunes Print Kit manual.pdf | 2016-03-18 12:05 | 12M | |
![[ ]](/icons/layout.gif) | Looney Tunes Print Kit reference card.pdf | 2016-03-18 12:05 | 959K | |
![[ ]](/icons/layout.gif) | Looney Tunes Print Kit designs.pdf | 2016-03-18 12:05 | 1.9M | |
![[ ]](/icons/layout.gif) | Hi Tech Expressions product catalog 1989-1990.pdf | 2016-03-18 12:05 | 50M | |
![[ ]](/icons/layout.gif) | A B sCenes I manual.pdf | 2016-03-18 12:03 | 18M | |
![[ ]](/icons/layout.gif) | The Executive Speller manual.pdf | 2016-03-18 12:03 | 8.9M | |
![[ ]](/icons/layout.gif) | Jeopardy manual.pdf | 2016-03-18 12:03 | 9.8M | |
![[ ]](/icons/layout.gif) | Maxi Golf manual part 1.pdf | 2016-03-18 12:02 | 14M | |
![[ ]](/icons/layout.gif) | Monsters and Make-Believe manual.pdf | 2016-03-18 12:02 | 31M | |
![[ ]](/icons/layout.gif) | A B sCenes II manual.pdf | 2016-03-18 12:01 | 19M | |
![[ ]](/icons/layout.gif) | Case of the Missing Chick manual.pdf | 2016-03-18 12:01 | 20M | |
![[ ]](/icons/layout.gif) | Parts of Speech - Fun with Nouns and Pronouns manual.pdf | 2016-03-18 12:00 | 8.3M | |
![[ ]](/icons/layout.gif) | Videochem manual.pdf | 2016-03-18 12:00 | 14M | |
![[ ]](/icons/layout.gif) | Ernie's Quiz manual.pdf | 2016-03-18 12:00 | 20M | |
![[ ]](/icons/layout.gif) | Konan_David_Junior_II_Reference_Aug83.pdf | 2016-03-17 21:14 | 876K | |
![[ ]](/icons/layout.gif) | hebdogiciel_appleii_volume2.pdf | 2016-03-17 19:02 | 29M | |
![[ ]](/icons/layout.gif) | hebdogiciel_appleii_volume1.pdf | 2016-03-17 19:02 | 25M | |
![[ ]](/icons/layout.gif) | hebdogiciel_appleii_volume3.pdf | 2016-03-17 19:02 | 18M | |
![[ ]](/icons/compressed.gif) | Vista Music Machine 9.zip | 2016-03-17 19:02 | 9.3M | |
![[ ]](/icons/layout.gif) | Apple IIe 80 Column Card Manual Errata.pdf | 2016-03-17 19:01 | 523K | |
![[ ]](/icons/layout.gif) | Rocky's Boots manual.pdf | 2016-03-17 09:25 | 22M | |
![[ ]](/icons/layout.gif) | The Other Side student guide.pdf | 2016-03-17 09:24 | 32M | |
![[ ]](/icons/layout.gif) | The Other Side teacher guide.pdf | 2016-03-17 09:24 | 80M | |
![[ ]](/icons/layout.gif) | Math Blaster Plus box back.pdf | 2016-03-16 16:25 | 4.4M | |
![[ ]](/icons/layout.gif) | conflictinvietnam.pdf | 2016-03-15 23:29 | 12M | |
![[ ]](/icons/layout.gif) | InsidetheIIe.pdf | 2016-03-15 22:56 | 33M | |
![[ ]](/icons/layout.gif) | InsidetheIIc.pdf | 2016-03-15 22:55 | 29M | |
![[ ]](/icons/layout.gif) | little-computer-people-docs-photocopy-source.pdf | 2016-03-15 21:48 | 23M | |
![[ ]](/icons/layout.gif) | design-your-own-home-architectural-design-photocopy-source.pdf | 2016-03-15 21:48 | 23M | |
![[ ]](/icons/layout.gif) | whomper-stomper-manual-photocopy-source.pdf | 2016-03-15 21:42 | 3.3M | |
![[ ]](/icons/layout.gif) | French QuizMaster manual.pdf | 2016-03-15 21:13 | 46M | |
![[ ]](/icons/layout.gif) | Milliken Research Paper Activities for The Writing Workshop.pdf | 2016-03-15 21:11 | 6.7M | |
![[ ]](/icons/layout.gif) | Solving Quadratic Equations manual.pdf | 2016-03-15 21:11 | 8.9M | |
![[ ]](/icons/layout.gif) | Simultaneous Linear Equations manual.pdf | 2016-03-15 21:10 | 9.0M | |
![[ ]](/icons/layout.gif) | Moptown Parade manual.pdf | 2016-03-15 17:18 | 19M | |
![[ ]](/icons/layout.gif) | What Did You Eat Yesterday supplement.pdf | 2016-03-15 17:10 | 25M | |
![[ ]](/icons/layout.gif) | Mrs. Wigglesworth's Secret box back.pdf | 2016-03-15 16:48 | 9.3M | |
![[ ]](/icons/layout.gif) | Mrs. Wigglesworth's Secret box front.pdf | 2016-03-15 16:44 | 4.3M | |
![[ ]](/icons/layout.gif) | SpaceLace manual.pdf | 2016-03-14 21:37 | 22M | |
![[ ]](/icons/layout.gif) | Babysitting Basics manual.pdf | 2016-03-14 21:36 | 9.9M | |
![[ ]](/icons/layout.gif) | brac-ps-lovers-utility-set-vol-1-photocopy-source.pdf | 2016-03-14 16:22 | 13M | |
![[ ]](/icons/layout.gif) | Psychology manual.pdf | 2016-03-14 16:21 | 2.6M | |
![[ ]](/icons/layout.gif) | Jigsaw reference card.pdf | 2016-03-14 16:21 | 2.6M | |
![[ ]](/icons/layout.gif) | atarisoft-jungle-hunt-manual-photocopy-source.pdf | 2016-03-10 22:35 | 2.7M | |
![[ ]](/icons/layout.gif) | the-newsroom-manual-photocopy-source.pdf | 2016-03-08 00:25 | 55M | |
![[ ]](/icons/layout.gif) | utilityworks_password.pdf | 2016-03-04 00:43 | 17K | |
![[ ]](/icons/layout.gif) | amazing_windows_manual.pdf | 2016-03-04 00:43 | 155K | |
![[ ]](/icons/layout.gif) | utilitylaunch_password.pdf | 2016-03-04 00:43 | 16K | |
![[ ]](/icons/layout.gif) | amazing_window_info.pdf | 2016-03-04 00:43 | 44K | |
![[ ]](/icons/layout.gif) | quality-computers-ramup-introductory-guide-photocopy-source.pdf | 2016-02-29 22:14 | 15M | |
![[ ]](/icons/layout.gif) | word-challenge-manual-photocopy-source.pdf | 2016-02-29 13:58 | 16M | |
![[ ]](/icons/layout.gif) | synetix-supersprite-owners-manual-cs.pdf | 2016-02-14 02:13 | 4.9M | |
![[ ]](/icons/layout.gif) | apple-panic-folder.pdf | 2016-02-11 09:47 | 2.5M | |
![[ ]](/icons/layout.gif) | davids-midnight-magic-folder.pdf | 2016-02-11 09:47 | 2.2M | |
![[ ]](/icons/layout.gif) | seafox-instructions.pdf | 2016-02-11 09:47 | 1.1M | |
![[ ]](/icons/layout.gif) | Grand Prix reference card.pdf | 2016-01-23 18:15 | 14M | |
![[ ]](/icons/layout.gif) | Fundamental Spelling in Context level 4 reference card.pdf | 2016-01-23 18:14 | 6.1M | |
![[ ]](/icons/layout.gif) | Fundamental Spelling in Context level 2 reference card.pdf | 2016-01-23 18:14 | 6.2M | |
![[ ]](/icons/layout.gif) | Basic Math Flash Facts reference card.pdf | 2016-01-23 18:14 | 6.6M | |
![[ ]](/icons/layout.gif) | Basic Math Facts and Games reference card.pdf | 2016-01-23 18:14 | 7.1M | |
![[ ]](/icons/layout.gif) | Teleworks_Plus-Manual.pdf | 2016-01-22 22:26 | 49M | |
![[ ]](/icons/compressed.gif) | 816Paint-Manuals.zip | 2016-01-22 22:26 | 41M | |
![[ ]](/icons/layout.gif) | Talking_Greek_Mythology-Manual.pdf | 2016-01-22 22:25 | 13M | |
![[ ]](/icons/layout.gif) | Talking_Classroom-Manual.pdf | 2016-01-22 22:25 | 13M | |
![[ ]](/icons/layout.gif) | Talking_Addition_and_Subtraction-Manual.pdf | 2016-01-22 22:25 | 11M | |
![[ ]](/icons/layout.gif) | Talking_Speller-Manual.pdf | 2016-01-22 22:25 | 10M | |
![[ ]](/icons/compressed.gif) | The_Music_Studio-Manuals.zip | 2016-01-22 22:24 | 8.0M | |
![[ ]](/icons/compressed.gif) | The_Whole_Neighborhood-Manual.zip | 2016-01-22 22:24 | 3.8M | |
![[ ]](/icons/layout.gif) | Spell_It-Manual.pdf | 2016-01-22 22:24 | 3.5M | |
![[ ]](/icons/layout.gif) | Math_Blaster-Manual.pdf | 2016-01-22 22:24 | 3.3M | |
![[ ]](/icons/compressed.gif) | Think_Quick-Manuals.zip | 2016-01-22 22:24 | 2.9M | |
![[ ]](/icons/layout.gif) | Storystarters_Science-Manual.pdf | 2016-01-22 22:24 | 2.1M | |
![[ ]](/icons/layout.gif) | Renegade(8-bit)-Manual.pdf | 2016-01-22 22:24 | 91K | |
![[ ]](/icons/layout.gif) | SunTracker reference card.pdf | 2016-01-21 15:42 | 13M | |
![[ ]](/icons/layout.gif) | EclipseTracker manual.pdf | 2016-01-21 15:41 | 11M | |
![[ ]](/icons/layout.gif) | EclipseTracker reference card.pdf | 2016-01-21 15:41 | 13M | |
![[ ]](/icons/layout.gif) | SunTracker manual.pdf | 2016-01-21 15:41 | 6.5M | |
![[ ]](/icons/layout.gif) | working-with-wordperfect-on-the-apple-iigs.pdf | 2016-01-11 11:58 | 283M | |
![[ ]](/icons/layout.gif) | FileWriter box front.pdf | 2016-01-02 22:21 | 6.2M | |
![[ ]](/icons/layout.gif) | FileWriter box back.pdf | 2016-01-02 22:21 | 5.2M | |
![[ ]](/icons/compressed.gif) | MultiscribeGS-Manuals.zip | 2016-01-02 00:23 | 26M | |
![[ ]](/icons/layout.gif) | HabaMerge Manual.pdf | 2015-12-22 17:00 | 21M | |
![[ ]](/icons/layout.gif) | Nibbles Away II rev. C1 instruction manual.pdf | 2015-12-18 22:00 | 27M | |
![[ ]](/icons/layout.gif) | Europe Ablaze (SSG 1985) Player and Design Manual.pdf | 2015-12-18 07:57 | 9.2M | |
![[ ]](/icons/layout.gif) | IDSI Shuffleboard manual.pdf | 2015-12-12 15:08 | 44M | |
![[ ]](/icons/layout.gif) | Crossword Magic manual.pdf | 2015-12-12 15:07 | 50M | |
![[ ]](/icons/layout.gif) | ARBPlot manual.pdf | 2015-12-12 15:07 | 59M | |
![[ ]](/icons/layout.gif) | German Vocabulary box back.pdf | 2015-12-12 15:03 | 6.0M | |
![[ ]](/icons/layout.gif) | MatchMaker user's guide.pdf | 2015-12-12 15:02 | 5.0M | |
![[ ]](/icons/layout.gif) | German Vocabulary box front.pdf | 2015-12-12 15:02 | 4.9M | |
![[ ]](/icons/layout.gif) | German Vocabulary terms and conditions.pdf | 2015-12-12 15:02 | 758K | |
![[ ]](/icons/layout.gif) | German Vocabulary registration card.pdf | 2015-12-12 15:02 | 292K | |
![[ ]](/icons/layout.gif) | Cheatsheet Products Keyboard Overlays.pdf | 2015-12-10 14:40 | 11M | |
![[ ]](/icons/layout.gif) | charlie_browns-abcs.pdf | 2015-12-08 00:16 | 20M | |
![[ ]](/icons/layout.gif) | puzzle-mania.pdf | 2015-12-08 00:16 | 6.3M | |
![[ ]](/icons/layout.gif) | snoopys-skywriter-scrambler.pdf | 2015-12-08 00:16 | 10M | |
![[ ]](/icons/layout.gif) | speedy-spides.pdf | 2015-12-08 00:15 | 5.8M | |
![[ ]](/icons/layout.gif) | Clip_Art_Gallery_Guide_and_Catalog.pdf | 2015-11-26 10:26 | 24M | |
![[ ]](/icons/layout.gif) | Timeworks Graph It.pdf | 2015-10-16 11:28 | 73M | |
![[ ]](/icons/layout.gif) | KidWriter.pdf | 2015-10-16 10:52 | 17M | |
![[ ]](/icons/layout.gif) | Delta DrawingFast Start Cards.pdf | 2015-10-16 10:39 | 23M | |
![[ ]](/icons/layout.gif) | Delta Drawing.pdf | 2015-10-16 10:33 | 98M | |
![[ ]](/icons/layout.gif) | ScreenWriter II.pdf | 2015-10-15 21:47 | 68M | |
![[ ]](/icons/layout.gif) | ScreenWriter II Reference Cards.pdf | 2015-10-15 21:27 | 3.0M | |
![[ ]](/icons/layout.gif) | Bug Byter.pdf | 2015-10-15 13:09 | 33M | |
![[ ]](/icons/layout.gif) | ECHO II Synthesizer.pdf | 2015-10-15 12:55 | 43M | |
![[ ]](/icons/layout.gif) | MultiScribe GS.pdf | 2015-10-15 12:13 | 99M | |
![[ ]](/icons/layout.gif) | Apple Circuit Analysis.pdf | 2015-10-15 11:47 | 22M | |
![[ ]](/icons/layout.gif) | ComputerEyes GS.pdf | 2015-10-15 11:36 | 59M | |
![[ ]](/icons/layout.gif) | Merlin Pro.pdf | 2015-10-15 05:18 | 145M | |
![[ ]](/icons/layout.gif) | Apple II Utilities Guide.pdf | 2015-10-15 04:47 | 106M | |
![[ ]](/icons/layout.gif) | Apple Writer for IIe.pdf | 2015-10-15 04:24 | 101M | |
![[ ]](/icons/layout.gif) | Franklin AceWriter II Reference.pdf | 2015-10-15 03:50 | 48M | |
![[ ]](/icons/layout.gif) | Softswitch.pdf | 2015-10-15 03:40 | 46M | |
![[ ]](/icons/layout.gif) | Apple Plot.pdf | 2015-10-15 03:22 | 26M | |
![[ ]](/icons/layout.gif) | Copy Master II.pdf | 2015-10-15 03:16 | 25M | |
![[ ]](/icons/layout.gif) | Apple Writer Text Editing System.pdf | 2015-10-15 02:51 | 25M | |
![[ ]](/icons/layout.gif) | Apple Writer ][ Operations.pdf | 2015-10-15 02:44 | 42M | |
![[ ]](/icons/layout.gif) | Apple Writer Text Editing System Reference Card.pdf | 2015-10-15 02:32 | 404K | |
![[ ]](/icons/layout.gif) | Apple Writer ][ Reference Card.pdf | 2015-10-15 02:32 | 795K | |
![[ ]](/icons/layout.gif) | Franklin AceWriter II Command Card.pdf | 2015-10-15 02:32 | 1.2M | |
![[ ]](/icons/layout.gif) | VisiCalc Quick Reference Card.pdf | 2015-10-15 02:15 | 4.0M | |
![[ ]](/icons/layout.gif) | Visicalc Formatting Aids.pdf | 2015-10-15 02:15 | 32M | |
![[ ]](/icons/layout.gif) | Springboard Certificate Maker.pdf | 2015-10-15 02:08 | 29M | |
![[ ]](/icons/layout.gif) | Quick File II.pdf | 2015-10-15 01:59 | 190M | |
![[ ]](/icons/layout.gif) | Dazzle Draw.pdf | 2015-10-14 22:19 | 37M | |
![[ ]](/icons/layout.gif) | Graphic Writer III.pdf | 2015-10-14 21:38 | 87M | |
![[ ]](/icons/layout.gif) | Bank Street Writer Plus.pdf | 2015-10-14 21:17 | 42M | |
![[ ]](/icons/layout.gif) | Bank Street Writer Plus Card.pdf | 2015-10-14 20:45 | 1.7M | |
![[ ]](/icons/layout.gif) | Bank Street Writer Plus Box.pdf | 2015-10-14 20:44 | 1.3M | |
![[ ]](/icons/layout.gif) | Graphic Writer III 2.0 Addendum.pdf | 2015-10-14 20:44 | 3.5M | |
![[ ]](/icons/layout.gif) | EasyWriter.pdf | 2015-10-14 20:43 | 24M | |
![[ ]](/icons/layout.gif) | Quark_Catalyst_3.0.pdf | 2015-06-04 11:47 | 25M | |
![[ ]](/icons/layout.gif) | apda_midisynth_synthlab_ocr.pdf | 2015-04-16 04:22 | 8.7M | |
![[ ]](/icons/layout.gif) | Bag of Tricks 2.pdf | 2015-03-29 12:17 | 78M | |
![[ ]](/icons/layout.gif) | GBBS II Manual.pdf | 2015-03-03 06:04 | 14M | |
![[ ]](/icons/layout.gif) | 816Paint-Teachers_Guide.pdf | 2015-02-12 04:54 | 43M | |
![[ ]](/icons/layout.gif) | Punctuation_Rules-Manual.pdf | 2015-02-12 04:53 | 1.3M | |
![[ ]](/icons/layout.gif) | Pick_n_Pile-Manual.pdf | 2015-02-12 04:53 | 1.0M | |
![[ ]](/icons/layout.gif) | Perfect_Image-Manual.pdf | 2015-02-12 04:52 | 499K | |
![[ ]](/icons/layout.gif) | Millken_Story_Teller-Manual_n_Extras.pdf | 2015-02-07 05:22 | 3.8M | |
![[ ]](/icons/layout.gif) | Hyperstuff_Clip_Tunes-Manual.pdf | 2015-02-07 05:22 | 2.4M | |
![[ ]](/icons/layout.gif) | KidTalk-Manual.pdf | 2015-02-07 05:22 | 1.9M | |
![[ ]](/icons/layout.gif) | Mathtalk_Fractions-Manual.pdf | 2015-02-07 05:22 | 1.1M | |
![[ ]](/icons/layout.gif) | Platinum_Paint_v2-Manual.pdf | 2015-02-07 03:45 | 25M | |
![[ ]](/icons/layout.gif) | Platinum_Paint_v1-Manual.pdf | 2015-02-07 03:45 | 24M | |
![[ ]](/icons/compressed.gif) | USA_Geograph-Manuals.zip | 2014-12-31 11:54 | 15M | |
![[ ]](/icons/layout.gif) | Locksmith User Manual.pdf | 2014-12-03 05:52 | 9.8M | |
![[ ]](/icons/layout.gif) | Locksmith Reference Card.pdf | 2014-12-03 05:52 | 2.5M | |
![[ ]](/icons/layout.gif) | The Star Gazer's Guide (manual).pdf | 2014-12-02 19:49 | 41M | |
![[ ]](/icons/layout.gif) | The Planetary Guide (manual).pdf | 2014-12-02 19:44 | 20M | |
![[ ]](/icons/compressed.gif) | GraphicWriter-Manuals.zip | 2014-11-16 12:24 | 27M | |
![[ ]](/icons/layout.gif) | visicorp_visicalc_manual_ocr.pdf | 2014-11-16 12:23 | 19M | |
![[ ]](/icons/layout.gif) | dbmaster_ocr.pdf | 2014-11-16 12:23 | 15M | |
![[ ]](/icons/layout.gif) | personalsoftware_visicalc_v1.0_manual_ocr.pdf | 2014-11-16 12:22 | 9.5M | |
![[ ]](/icons/layout.gif) | ImageMaster_Basic_Paint-Manual.pdf | 2014-11-16 12:21 | 7.8M | |
![[ ]](/icons/compressed.gif) | Auto_Ark-Manuals.zip | 2014-11-16 12:21 | 6.9M | |
![[ ]](/icons/layout.gif) | Nexus-Manual.pdf | 2014-11-16 12:20 | 4.1M | |
![[ ]](/icons/layout.gif) | sss_typingtutoriv_manual_ocr.pdf | 2014-11-16 12:20 | 3.3M | |
![[ ]](/icons/layout.gif) | Super_Menu_Pack-Manual.pdf | 2014-11-16 12:17 | 713K | |
![[ ]](/icons/layout.gif) | MathTalk-Manual.pdf | 2014-06-04 22:50 | 4.0M | |
![[ ]](/icons/compressed.gif) | Pointless.zip | 2014-06-04 22:49 | 2.0M | |
![[ ]](/icons/layout.gif) | The Compleat Guide to Locksmith Parameters.pdf | 2014-06-03 20:14 | 441K | |
![[TXT]](/icons/text.gif) | ProTerm.txt | 2014-02-06 12:18 | 126K | |
![[ ]](/icons/layout.gif) | Transitions.pdf | 2014-01-15 15:15 | 9.5M | |
![[ ]](/icons/layout.gif) | Special Effects.pdf | 2014-01-15 15:13 | 11M | |
![[ ]](/icons/layout.gif) | Short Cuts.pdf | 2014-01-15 15:10 | 12M | |
![[ ]](/icons/layout.gif) | Paper Graphics.pdf | 2014-01-15 15:00 | 15M | |
![[ ]](/icons/layout.gif) | Paper Graphics Box.pdf | 2014-01-15 14:56 | 6.8M | |
![[ ]](/icons/layout.gif) | Map Pack Box.pdf | 2014-01-15 14:54 | 3.3M | |
![[ ]](/icons/layout.gif) | Home Data Manager.pdf | 2014-01-15 14:53 | 12M | |
![[ ]](/icons/layout.gif) | Home Connection.pdf | 2014-01-15 14:50 | 63M | |
![[ ]](/icons/layout.gif) | Home Connection Box.pdf | 2014-01-15 14:35 | 7.9M | |
![[ ]](/icons/layout.gif) | Graphics Magician Picture Painter.pdf | 2014-01-15 14:33 | 17M | |
![[ ]](/icons/layout.gif) | Disk arRanger.pdf | 2014-01-15 14:29 | 8.8M | |
![[ ]](/icons/layout.gif) | Cat Graphics.pdf | 2014-01-15 13:39 | 16M | |
![[ ]](/icons/layout.gif) | Disk Access Manual_alt.pdf | 2013-08-14 10:07 | 21M | |
![[ ]](/icons/layout.gif) | Super Menu Pack Manual.pdf | 2013-08-14 10:03 | 6.8M | |
![[ ]](/icons/layout.gif) | Zoom Grafix Manual.pdf | 2013-08-14 10:03 | 6.1M | |
![[ ]](/icons/layout.gif) | Disk Access Quick Reference.pdf | 2013-08-14 10:02 | 1.7M | |
![[ ]](/icons/layout.gif) | Bank_Street_Writer_Manual_alt.pdf | 2013-07-02 00:17 | 23M | |
![[ ]](/icons/layout.gif) | Bill Budges 3-D Graphics System and Game Tool.pdf | 2013-06-03 14:26 | 5.4M | |
![[TXT]](/icons/text.gif) | Bag of Tricks Documentation.txt | 2012-04-30 09:02 | 20K | |
![[ ]](/icons/layout.gif) | HyperCard GS Technical Notes_alt.pdf | 2012-04-14 18:03 | 465K | |
![[ ]](/icons/layout.gif) | My_Paint-Reference_Card.pdf | 2012-04-14 16:24 | 3.4M | |
![[ ]](/icons/layout.gif) | Balloon_v2-Manual.pdf | 2012-04-14 16:18 | 7.4M | |
![[ ]](/icons/layout.gif) | Using Apple Writer II on the Apple II UniDisk 3.5.pdf | 2012-03-13 03:40 | 389K | |
![[ ]](/icons/layout.gif) | Show_Off-Manual.pdf | 2012-01-09 05:25 | 9.4M | |
![[ ]](/icons/layout.gif) | ShadowDial-Manual.pdf | 2012-01-09 05:23 | 3.1M | |
![[ ]](/icons/layout.gif) | McGee-Reference_Card.pdf | 2012-01-09 05:23 | 1.5M | |
![[ ]](/icons/layout.gif) | ThinkTank User's Manual.pdf | 2011-12-26 16:45 | 867K | |
![[ ]](/icons/layout.gif) | ThinkTank refrence card.pdf | 2011-12-26 16:45 | 8.5K | |
![[ ]](/icons/layout.gif) | DrawPlus.pdf | 2011-12-25 12:00 | 8.3M | |
![[ ]](/icons/layout.gif) | ProTERM Owner's Manual.pdf | 2011-12-09 00:03 | 76M | |
![[ ]](/icons/layout.gif) | Apple Software Bank Vol 1-2.pdf | 2011-11-30 19:45 | 12M | |
![[ ]](/icons/layout.gif) | EasyWriter Manual.pdf | 2011-11-29 15:39 | 24M | |
![[ ]](/icons/layout.gif) | DrawTools31_alt.pdf | 2011-11-14 22:06 | 20M | |
![[ ]](/icons/compressed.gif) | artsci_magicalc_manuals.zip | 2011-11-14 22:04 | 947K | |
![[ ]](/icons/compressed.gif) | AppleLink_Manuals.zip | 2011-11-14 22:03 | 22M | |
![[ ]](/icons/compressed.gif) | siriussoftware_ezdraw33_manuals.zip | 2011-11-11 20:36 | 3.3M | |
![[ ]](/icons/layout.gif) | Animation Construction Set-Movie Maker.pdf | 2011-10-31 06:36 | 15M | |
![[ ]](/icons/layout.gif) | Hyper_Card_Power.pdf | 2011-10-30 15:02 | 298M | |
![[ ]](/icons/compressed.gif) | Franklin ACECalc Manuals.zip | 2011-10-26 07:24 | 152M | |
![[ ]](/icons/layout.gif) | Franklin AceWriter II Reference Manual.pdf | 2011-10-21 07:33 | 48M | |
![[ ]](/icons/layout.gif) | Visidex User's Guide.pdf | 2011-10-14 18:06 | 94M | |
![[ ]](/icons/layout.gif) | Magic Window Manual.pdf | 2011-10-14 05:21 | 49M | |
![[ ]](/icons/layout.gif) | Bag of Tricks Manual.pdf | 2011-10-05 08:28 | 74M | |
![[ ]](/icons/layout.gif) | Sideways User Manual.pdf | 2011-09-28 21:25 | 9.8M | |
![[ ]](/icons/layout.gif) | Universe_Master-Manual.pdf | 2011-09-26 18:30 | 5.6M | |
![[ ]](/icons/compressed.gif) | So_What_Software_Utilities-Manuals.zip | 2011-09-26 18:29 | 1.2M | |
![[ ]](/icons/layout.gif) | SixPack-Manual.pdf | 2011-09-26 18:29 | 2.1M | |
![[ ]](/icons/compressed.gif) | MasterTracksPro-Manuals.zip | 2011-09-26 18:29 | 4.2M | |
![[ ]](/icons/layout.gif) | Instant_Synthesizer-Manual.pdf | 2011-09-26 18:27 | 4.3M | |
![[ ]](/icons/layout.gif) | FontFactoryGS-Manual.pdf | 2011-09-26 18:26 | 17M | |
![[ ]](/icons/layout.gif) | Apple Software Bank Vol 3-5.pdf | 2011-09-25 10:02 | 37M | |
![[ ]](/icons/layout.gif) | MultiScribe GS User's Guide.pdf | 2011-09-19 20:49 | 99M | |
![[ ]](/icons/layout.gif) | MultiScribe GS Reference Card.pdf | 2011-09-19 20:35 | 1.4M | |
![[ ]](/icons/layout.gif) | Prism-Manual.pdf | 2011-09-08 06:37 | 4.1M | |
![[ ]](/icons/layout.gif) | Graphic Writer III Manual.pdf | 2011-09-05 04:14 | 88M | |
![[ ]](/icons/layout.gif) | PostScript Startup Secrets.pdf | 2011-09-04 14:08 | 210K | |
![[ ]](/icons/layout.gif) | PostScript Secrets.pdf | 2011-09-04 14:08 | 1.1M | |
![[ ]](/icons/layout.gif) | PostScript Insider Secrets.pdf | 2011-09-04 14:08 | 317K | |
![[ ]](/icons/layout.gif) | Apple Plot Manual.pdf | 2011-09-03 04:57 | 26M | |
![[ ]](/icons/layout.gif) | UltraPlan User Reference Manual.pdf | 2011-09-02 18:40 | 84M | |
![[ ]](/icons/layout.gif) | SmoothTalker Handbook_HQ.pdf | 2011-09-02 17:59 | 7.1M | |
![[ ]](/icons/layout.gif) | ScreenWriter II Manual.pdf | 2011-09-02 17:57 | 68M | |
![[ ]](/icons/layout.gif) | PractiCalc II User's Manual.pdf | 2011-09-02 17:06 | 37M | |
![[ ]](/icons/layout.gif) | PractiCalc II Addendum.pdf | 2011-09-02 16:57 | 9.7M | |
![[ ]](/icons/layout.gif) | Pinpoint Desktop Accessories User Guide.pdf | 2011-09-02 16:44 | 72M | |
![[ ]](/icons/layout.gif) | Micro Cookbook Manual.pdf | 2011-09-02 16:26 | 24M | |
![[ ]](/icons/layout.gif) | MagiCalc Tutorial.pdf | 2011-09-02 16:20 | 32M | |
![[ ]](/icons/layout.gif) | MagiCalc Reference Guide.pdf | 2011-09-02 16:13 | 50M | |
![[ ]](/icons/layout.gif) | MagiCalc Quick Reference Guide.pdf | 2011-09-02 16:03 | 4.0M | |
![[ ]](/icons/layout.gif) | dos-master-documentation.pdf | 2011-09-02 15:53 | 57K | |
![[ ]](/icons/layout.gif) | Bank Street Writer Plus manual.pdf | 2011-09-02 04:38 | 42M | |
![[ ]](/icons/layout.gif) | Apple Writer Text Editing System Manual.pdf | 2011-09-02 04:27 | 25M | |
![[ ]](/icons/layout.gif) | Apple Writer for IIe Manual.pdf | 2011-09-02 04:19 | 101M | |
![[ ]](/icons/layout.gif) | Apple Writer ][ Operations Manual.pdf | 2011-09-02 03:44 | 42M | |
![[ ]](/icons/layout.gif) | Accudraw_Manual.pdf | 2011-09-02 03:29 | 676K | |
![[ ]](/icons/layout.gif) | AccuDraw_info.pdf | 2011-09-02 03:29 | 55K | |
![[ ]](/icons/layout.gif) | MAB-Munch A Bug (a machine language debugger) Manual.pdf | 2011-09-01 08:25 | 23M | |
![[ ]](/icons/layout.gif) | Copy Master II_Reference Manual.pdf | 2011-09-01 07:50 | 26M | |
![[ ]](/icons/layout.gif) | Copy Master II_Documents from the Box.pdf | 2011-09-01 07:47 | 11M | |
![[ ]](/icons/layout.gif) | ProLine-3.0.pdf | 2011-07-23 19:40 | 1.0M | |
![[ ]](/icons/compressed.gif) | ReadnRoll-Manuals.zip | 2011-07-22 16:37 | 1.4M | |
![[ ]](/icons/layout.gif) | dannmccreary_diskotape_manual.pdf | 2011-07-20 08:47 | 1.0M | |
![[ ]](/icons/layout.gif) | dannmccreary_diskotape_letter.pdf | 2011-07-20 08:47 | 72K | |
![[ ]](/icons/layout.gif) | dannmccreary_diskotape_cover.pdf | 2011-07-20 08:47 | 401K | |
![[ ]](/icons/layout.gif) | FAXination-Manual.pdf | 2011-07-12 18:41 | 3.4M | |
![[ ]](/icons/layout.gif) | Locksmith6.0_hires.pdf | 2011-06-14 07:41 | 44M | |
![[ ]](/icons/compressed.gif) | Word_Perfect-Manuals.zip | 2011-04-23 23:47 | 12M | |
![[ ]](/icons/compressed.gif) | Salvation_Sumpreme-Manuals.zip | 2011-04-23 23:45 | 3.3M | |
![[ ]](/icons/layout.gif) | Deskpak-Manual.pdf | 2011-04-23 23:45 | 2.7M | |
![[ ]](/icons/layout.gif) | wordperfect_manual.pdf | 2011-04-23 22:56 | 12M | |
![[ ]](/icons/layout.gif) | pointless_updatebooklet_manual.pdf | 2011-04-23 22:55 | 576K | |
![[ ]](/icons/layout.gif) | pointless_manual.pdf | 2011-04-23 22:55 | 2.8M | |
![[ ]](/icons/layout.gif) | pointless_bonuspack.pdf | 2011-04-23 22:54 | 156K | |
![[ ]](/icons/layout.gif) | broderbund_jamsession_manual.pdf | 2011-04-23 22:54 | 1.1M | |
![[ ]](/icons/compressed.gif) | The_Manager.zip | 2011-02-28 22:18 | 360K | |
![[ ]](/icons/compressed.gif) | Pegasoft_Draw_Tools_v3_1.zip | 2011-02-28 21:33 | 464K | |
![[ ]](/icons/compressed.gif) | Visualizer-Manuals.zip | 2011-02-28 18:25 | 1.2M | |
![[ ]](/icons/compressed.gif) | TopDraw-Manuals.zip | 2011-02-28 18:23 | 9.7M | |
![[ ]](/icons/compressed.gif) | The_Print_Shop_Companion-Manuals.zip | 2011-02-28 18:15 | 6.5M | |
![[ ]](/icons/compressed.gif) | The_Print_Shop-Manuals.zip | 2011-02-28 18:14 | 5.4M | |
![[ ]](/icons/compressed.gif) | The_Manager-Manuals.zip | 2011-02-28 18:13 | 2.8M | |
![[ ]](/icons/compressed.gif) | SoftSwitch-Manuals.zip | 2011-02-28 18:06 | 8.2M | |
![[ ]](/icons/compressed.gif) | SignatureGS-Manuals.zip | 2011-02-28 18:04 | 581K | |
![[ ]](/icons/compressed.gif) | Second_Chance-Manuals.zip | 2011-02-28 18:02 | 8.6M | |
![[ ]](/icons/compressed.gif) | MusicWriter-Manuals.zip | 2011-02-28 17:44 | 7.5M | |
![[ ]](/icons/compressed.gif) | List_Plus-Manuals.zip | 2011-02-28 17:38 | 15M | |
![[ ]](/icons/compressed.gif) | Kangaroo-Manuals(French).zip | 2011-02-28 17:34 | 1.8M | |
![[ ]](/icons/compressed.gif) | GSFile-Manuals.zip | 2011-02-28 17:21 | 3.5M | |
![[ ]](/icons/compressed.gif) | Fractal_Explorer-Manuals.zip | 2011-02-28 17:08 | 756K | |
![[ ]](/icons/compressed.gif) | Fantavision-Manuals.zip | 2011-02-28 17:08 | 5.9M | |
![[ ]](/icons/compressed.gif) | Discquest-Manuals.zip | 2011-02-28 17:06 | 1.4M | |
![[ ]](/icons/compressed.gif) | DeluxePaintII-Manuals.zip | 2011-02-28 17:06 | 32M | |
![[ ]](/icons/layout.gif) | Design_Your_Own_Home_Interiors-Manual.pdf | 2011-02-27 22:30 | 4.0M | |
![[ ]](/icons/layout.gif) | Design_Your_Own_Home-Quick_Reference.pdf | 2011-02-27 22:30 | 313K | |
![[ ]](/icons/layout.gif) | Disk_Access-Manual.pdf | 2011-02-27 12:15 | 2.8M | |
![[ ]](/icons/layout.gif) | Cartooners-Manual.pdf | 2011-02-27 12:14 | 8.1M | |
![[ ]](/icons/layout.gif) | AutoArk-Manual.pdf | 2011-02-27 12:12 | 3.2M | |
![[ ]](/icons/layout.gif) | memsoft_pub_sicob_1981_FR.pdf | 2011-02-14 00:28 | 1.6M | |
![[ ]](/icons/layout.gif) | memsoft_memsoft_pub_FR.pdf | 2011-02-14 00:28 | 1.3M | |
![[ ]](/icons/layout.gif) | memsoft_memplot_pub_FR.pdf | 2011-02-14 00:27 | 397K | |
![[ ]](/icons/layout.gif) | memsoft_memplot_manuel2_FR.pdf | 2011-02-14 00:27 | 3.6M | |
![[ ]](/icons/layout.gif) | memsoft_memplot_manuel_FR.pdf | 2011-02-14 00:27 | 2.9M | |
![[ ]](/icons/layout.gif) | memsoft_memplot_article_FR.pdf | 2011-02-14 00:26 | 872K | |
![[ ]](/icons/layout.gif) | memsoft_mdos_pub_FR.pdf | 2011-02-14 00:26 | 206K | |
![[ ]](/icons/layout.gif) | memsoft_mdos_oi37_FR.pdf | 2011-02-14 00:26 | 676K | |
![[ ]](/icons/layout.gif) | memsoft_mdos_note4_FR.pdf | 2011-02-14 00:26 | 40K | |
![[ ]](/icons/layout.gif) | memsoft_mdos_note3_FR.pdf | 2011-02-14 00:26 | 57K | |
![[ ]](/icons/layout.gif) | memsoft_mdos_note2_FR.pdf | 2011-02-14 00:26 | 40K | |
![[ ]](/icons/layout.gif) | memsoft_mdos_manuel2_FR.pdf | 2011-02-14 00:26 | 2.6M | |
![[ ]](/icons/layout.gif) | memsoft_mdos_manuel_FR.pdf | 2011-02-14 00:25 | 5.4M | |
![[ ]](/icons/layout.gif) | memsoft_mdos_commandes_FR.pdf | 2011-02-14 00:25 | 128K | |
![[ ]](/icons/layout.gif) | memsoft_logicielpaie_manuel_FR.pdf | 2011-02-14 00:24 | 1.5M | |
![[ ]](/icons/layout.gif) | Compleat Guide to Locksmith Parameters.pdf | 2010-09-26 15:26 | 441K | |
![[ ]](/icons/layout.gif) | FASTDATA.pdf | 2010-07-02 03:38 | 1.6M | |
![[ ]](/icons/layout.gif) | Edd_IV_Doc.pdf | 2010-07-02 03:37 | 1.5M | |
![[ ]](/icons/layout.gif) | PROTerm_A2_v3.1.pdf | 2010-06-25 03:32 | 4.1M | |
![[ ]](/icons/layout.gif) | SynthLab_User's_Manual.pdf | 2010-06-24 09:32 | 2.9M | |
![[ ]](/icons/compressed.gif) | VisiCalc Reference Card.zip | 2010-06-02 12:11 | 369K | |
![[ ]](/icons/layout.gif) | Visualizer-Manual.pdf | 2010-05-14 16:27 | 894K | |
![[ ]](/icons/layout.gif) | Visualizer-Demonstration.pdf | 2010-05-14 16:26 | 404K | |
![[ ]](/icons/unknown.gif) | twilight_ii.PDF | 2010-05-14 16:23 | 2.2M | |
![[ ]](/icons/layout.gif) | TransprogIII-Manual(French).pdf | 2010-05-14 16:18 | 1.1M | |
![[ ]](/icons/layout.gif) | TopDraw-Reference_Card.pdf | 2010-05-14 16:18 | 168K | |
![[ ]](/icons/layout.gif) | TopDraw-Manual.pdf | 2010-05-14 16:18 | 9.5M | |
![[ ]](/icons/layout.gif) | TopDraw-Errata.pdf | 2010-05-14 16:12 | 297K | |
![[ ]](/icons/layout.gif) | TheGraphicsSupermarket-Manual.pdf | 2010-05-14 15:51 | 3.3M | |
![[ ]](/icons/layout.gif) | TheGraphicExchange-Manual.pdf | 2010-05-14 15:49 | 3.0M | |
![[ ]](/icons/layout.gif) | The_Print_Shop_Companion-Reference.pdf | 2010-05-14 15:35 | 2.1M | |
![[ ]](/icons/layout.gif) | The_Print_Shop_Companion-Manual.pdf | 2010-05-14 15:33 | 5.0M | |
![[ ]](/icons/layout.gif) | The_Print_Shop-Reference.pdf | 2010-05-14 15:30 | 2.2M | |
![[ ]](/icons/layout.gif) | The_Print_Shop-Manual.pdf | 2010-05-14 15:29 | 4.1M | |
![[ ]](/icons/layout.gif) | The_Music_Studio_v2-Manual.pdf | 2010-05-14 15:27 | 3.3M | |
![[ ]](/icons/layout.gif) | The_Manager-Manual.pdf | 2010-05-14 15:25 | 1.6M | |
![[ ]](/icons/layout.gif) | The_Manager-Manual(French).pdf | 2010-05-14 15:24 | 1.3M | |
![[ ]](/icons/layout.gif) | The_Desktop_Manager-Manual.pdf | 2010-05-14 15:23 | 8.3M | |
![[ ]](/icons/layout.gif) | SignatureGS-Manual.pdf | 2010-05-14 14:54 | 563K | |
![[ ]](/icons/layout.gif) | SignatureGS-Addendum.pdf | 2010-05-14 14:54 | 102K | |
![[ ]](/icons/layout.gif) | Shoebox-Manual.pdf | 2010-05-14 14:54 | 3.6M | |
![[ ]](/icons/layout.gif) | Paintworks_Gold-Manual.pdf | 2010-05-14 13:51 | 7.5M | |
![[ ]](/icons/layout.gif) | MusicWriter-Troubleshooting.pdf | 2010-05-14 13:26 | 456K | |
![[ ]](/icons/layout.gif) | MusicWriter-Quick_Reference.pdf | 2010-05-14 13:26 | 124K | |
![[ ]](/icons/layout.gif) | MusicWriter-MIDI_Troubleshooting.pdf | 2010-05-14 13:25 | 360K | |
![[ ]](/icons/layout.gif) | MusicWriter-Manual.pdf | 2010-05-14 13:25 | 8.2M | |
![[ ]](/icons/layout.gif) | List_Plus-Manual.pdf | 2010-05-14 12:55 | 19M | |
![[ ]](/icons/layout.gif) | List_Plus-Addendum.pdf | 2010-05-14 12:44 | 67K | |
![[ ]](/icons/layout.gif) | Instrument_Designer-Manual.pdf | 2010-05-14 12:37 | 1.3M | |
![[ ]](/icons/layout.gif) | Instrument_Designer-Datafiles.pdf | 2010-05-14 12:36 | 32K | |
![[ ]](/icons/layout.gif) | Instant_Music-Manual.pdf | 2010-05-14 12:36 | 2.3M | |
![[ ]](/icons/layout.gif) | GSymbolix-Manual.pdf | 2010-05-14 12:20 | 6.7M | |
![[ ]](/icons/layout.gif) | GSFile-Manual.pdf | 2010-05-14 12:16 | 3.0M | |
![[ ]](/icons/layout.gif) | GS_Paint-Manual.pdf | 2010-05-14 12:15 | 6.7M | |
![[ ]](/icons/layout.gif) | Graphics_Studio-Manual.pdf | 2010-05-14 12:11 | 3.4M | |
![[ ]](/icons/layout.gif) | Graphic_Writer_II-Note.pdf | 2010-05-14 12:09 | 246K | |
![[ ]](/icons/layout.gif) | Graphic_Writer_II-Manual.pdf | 2010-05-14 12:09 | 4.2M | |
![[ ]](/icons/layout.gif) | Fantavision-Quick_Start.pdf | 2010-05-14 11:50 | 504K | |
![[ ]](/icons/layout.gif) | Fantavision-Manual.pdf | 2010-05-14 11:50 | 5.4M | |
![[ ]](/icons/layout.gif) | Express-Manual(French).pdf | 2010-05-14 11:46 | 1.0M | |
![[ ]](/icons/layout.gif) | DreamGrafix-Manual.pdf | 2010-05-14 11:43 | 7.5M | |
![[ ]](/icons/layout.gif) | Draw_Toolsv31-Manual.pdf | 2010-05-14 11:39 | 2.2M | |
![[ ]](/icons/layout.gif) | DeskWorks-Manual.pdf | 2010-05-14 11:32 | 5.7M | |
![[ ]](/icons/layout.gif) | Designasaurus-Manual.pdf | 2010-05-14 11:29 | 3.6M | |
![[ ]](/icons/layout.gif) | DeluxePaint II - Getting Started.pdf | 2010-05-14 11:27 | 2.3M | |
![[ ]](/icons/layout.gif) | DejaVuII-Manual.pdf | 2010-05-14 11:25 | 2.5M | |
![[ ]](/icons/layout.gif) | DejaVu-Manual.pdf | 2010-05-14 11:24 | 3.1M | |
![[ ]](/icons/layout.gif) | Deja Vu Solution.pdf | 2010-05-14 11:22 | 7.2K | |
![[ ]](/icons/layout.gif) | Deja Vu II Solution.pdf | 2010-05-14 11:22 | 8.6K | |
![[ ]](/icons/layout.gif) | Art&FilmDirector-Manual.pdf | 2010-05-14 10:53 | 38M | |
![[ ]](/icons/layout.gif) | typeset_user_manual_part_4_.pdf | 2010-05-05 18:07 | 4.6M | |
![[ ]](/icons/layout.gif) | typeset_user_manual_part_3_.pdf | 2010-05-05 18:04 | 4.9M | |
![[ ]](/icons/layout.gif) | typeset_user_manual_part_2_.pdf | 2010-05-05 18:00 | 4.0M | |
![[ ]](/icons/layout.gif) | typeset_user_manual_part_1_.pdf | 2010-05-05 17:57 | 7.2M | |
![[ ]](/icons/layout.gif) | springboard_certificate_maker_manual_part_8_.pdf | 2010-05-05 16:45 | 2.1M | |
![[ ]](/icons/layout.gif) | springboard_certificate_maker_manual_part_7_.pdf | 2010-05-05 16:43 | 3.4M | |
![[ ]](/icons/layout.gif) | springboard_certificate_maker_manual_part_6_.pdf | 2010-05-05 16:41 | 4.3M | |
![[ ]](/icons/layout.gif) | springboard_certificate_maker_manual_part_5_.pdf | 2010-05-05 16:38 | 3.2M | |
![[ ]](/icons/layout.gif) | springboard_certificate_maker_manual_part_4_.pdf | 2010-05-05 16:36 | 3.6M | |
![[ ]](/icons/layout.gif) | springboard_certificate_maker_manual_part_3_.pdf | 2010-05-05 16:33 | 4.4M | |
![[ ]](/icons/layout.gif) | springboard_certificate_maker_manual_part_2_.pdf | 2010-05-05 16:30 | 4.0M | |
![[ ]](/icons/layout.gif) | springboard_certificate_maker_manual_part_1_.pdf | 2010-05-05 16:27 | 4.4M | |
![[ ]](/icons/layout.gif) | EDDPlus_Manual.pdf | 2010-03-09 11:03 | 1.2M | |
![[ ]](/icons/layout.gif) | EDD4 softkey.pdf | 2010-03-09 11:02 | 471K | |
![[ ]](/icons/layout.gif) | UtilityWorksGS_Restore.pdf | 2010-02-09 18:27 | 2.4K | |
![[ ]](/icons/layout.gif) | UtilityWorksGS_Ref.pdf | 2010-02-09 18:27 | 180K | |
![[ ]](/icons/layout.gif) | UtilityWorksGS_Notes.pdf | 2010-02-09 18:27 | 98K | |
![[ ]](/icons/layout.gif) | UtilityWorksGS_Hints.pdf | 2010-02-09 18:27 | 2.7K | |
![[ ]](/icons/layout.gif) | UtilityWorksGS_Doc.pdf | 2010-02-09 18:27 | 75K | |
![[ ]](/icons/layout.gif) | UtilityLaunch_Tutorial.pdf | 2010-02-09 18:27 | 8.1K | |
![[ ]](/icons/layout.gif) | UtilityLaunch_Ref.pdf | 2010-02-09 18:27 | 82K | |
![[ ]](/icons/layout.gif) | UtilityLaunch_Notes.pdf | 2010-02-09 18:27 | 49K | |
![[ ]](/icons/layout.gif) | UtilityLaunch_Features.pdf | 2010-02-09 18:27 | 6.4K | |
![[ ]](/icons/layout.gif) | UtilityLaunch_Doc.pdf | 2010-02-09 18:27 | 77K | |
![[ ]](/icons/layout.gif) | hyper_card_ref_card_iigs.pdf | 2010-02-02 21:35 | 341K | |
![[ ]](/icons/layout.gif) | deluxe_paint_ii.pdf | 2010-02-02 20:41 | 14M | |
![[ ]](/icons/layout.gif) | Take-1 Users Guide.pdf | 2010-01-22 17:09 | 40M | |
![[ ]](/icons/layout.gif) | The Graphics Magician.pdf | 2009-05-03 14:31 | 6.1M | |
![[ ]](/icons/layout.gif) | DDT Manual.pdf | 2009-01-29 00:58 | 98K | |
![[ ]](/icons/layout.gif) | Locksmith6.0.pdf | 2009-01-27 05:55 | 15M | |
![[TXT]](/icons/text.gif) | Locksmith.6.0.Docs.txt | 2000-06-29 13:32 | 42K | |
![[TXT]](/icons/text.gif) | printrix.docs.pt.3.txt | 2000-03-13 19:46 | 51K | |
![[TXT]](/icons/text.gif) | printrix.docs.pt.2.txt | 2000-03-13 19:46 | 37K | |
![[TXT]](/icons/text.gif) | printrix.docs.pt.1.txt | 2000-03-13 19:45 | 31K | |
![[TXT]](/icons/text.gif) | printrix.quick.ref.txt | 2000-03-13 19:45 | 2.5K | |
![[TXT]](/icons/text.gif) | zardax.txt | 1999-09-25 02:36 | 386 | |
![[TXT]](/icons/text.gif) | zardax52.txt | 1999-09-12 07:32 | 567 | |
|