![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/compressed.gif) | Sabotage_Cheat.zip | 2021-02-08 18:09 | 0 | |
![[ ]](/icons/compressed.gif) | Sabotage_With_Cheat.zip | 2021-02-08 18:02 | 0 | |
![[ ]](/icons/unknown.gif) | email comments to asimovlookerafterer@mail.com | 2016-07-27 13:43 | 0 | |
![[TXT]](/icons/text.gif) | ProDOS-NVRAM-Drive-4MB_v36.txt | 2022-10-23 02:56 | 47 | |
![[TXT]](/icons/text.gif) | ProDOS-NVRAM-Drive-512KB_v36.txt | 2022-10-23 02:56 | 47 | |
![[TXT]](/icons/text.gif) | Optimum Resource - Antoine Says ReadMePlease.txt | 2024-10-29 11:22 | 112 | |
![[TXT]](/icons/text.gif) | Anchorman (clean crack).txt | 2024-02-06 09:03 | 128 | |
![[TXT]](/icons/text.gif) | A2 SubLOGIC Scenery Collection.txt | 2022-03-17 11:51 | 143 | |
![[TXT]](/icons/text.gif) | Learn AC:QuickBasic Now for the ][GS.txt.0.3874 | 2021-06-09 22:21 | 371 | |
![[TXT]](/icons/text.gif) | Epoch and Hadron control notes for AppleWin.txt | 2021-04-19 02:30 | 500 | |
![[TXT]](/icons/text.gif) | Wild West ProDOS.txt | 2022-07-27 21:05 | 615 | |
![[TXT]](/icons/text.gif) | Where in the World is Carmen Sandiego v2.1 (clean crack + HD install).txt | 2024-04-21 09:35 | 682 | |
![[TXT]](/icons/text.gif) | smir3_1apple.txt | 2023-08-19 15:12 | 1.5K | |
![[ ]](/icons/unknown.gif) | ArabMapIIc.BIN | 2025-02-01 11:24 | 2.0K | |
![[ ]](/icons/compressed.gif) | Space Rogue Save Game Editing Guide.zip | 2021-08-31 03:46 | 2.1K | |
![[ ]](/icons/compressed.gif) | AppleIIgs_MegaII_character.zip | 2021-09-06 11:35 | 2.3K | |
![[TXT]](/icons/text.gif) | TALA.txt.1.14a62 | 2021-05-23 05:44 | 4.4K | |
![[TXT]](/icons/text.gif) | Zenith docs.txt | 2022-04-17 01:28 | 6.2K | |
![[ ]](/icons/binary.gif) | Laser 128 video ROM VT27-0706-0.bin | 2021-01-23 00:37 | 8.0K | |
![[ ]](/icons/compressed.gif) | Acey-Deucey (woz-a-day collection).zip | 2024-04-28 13:35 | 12K | |
![[ ]](/icons/compressed.gif) | Disk Optimizer System II v1.1 (4am crack).zip | 2022-07-02 10:37 | 14K | |
![[ ]](/icons/unknown.gif) | ArabROMIIc.BIN | 2025-02-01 11:24 | 16K | |
![[ ]](/icons/unknown.gif) | arabCharGenIIc.BIN | 2025-02-01 11:24 | 16K | |
![[ ]](/icons/compressed.gif) | Essential Data Duplicator 4 Plus v4.1 (woz-a-day collection).zip | 2024-03-16 22:40 | 18K | |
![[ ]](/icons/compressed.gif) | Sabotage With Cheat.zip | 2021-02-08 18:12 | 19K | |
![[ ]](/icons/compressed.gif) | Falcons (Softsmith) (4am and san inc crack).zip | 2024-02-03 21:18 | 19K | |
![[TXT]](/icons/text.gif) | AC Basic Archive Index.txt | 2021-09-24 23:46 | 20K | |
![[ ]](/icons/compressed.gif) | Star Traders (4am crack).zip | 2025-01-19 14:22 | 21K | |
![[ ]](/icons/compressed.gif) | Super Ear Challenger- A Music Game (4am crack).zip | 2022-06-09 10:55 | 22K | |
![[ ]](/icons/compressed.gif) | VT-100 Emulator (4am and san inc crack).zip | 2022-06-10 16:59 | 22K | |
![[ ]](/icons/compressed.gif) | Fay- That Math Woman (4am crack).zip | 2022-06-11 18:44 | 23K | |
![[ ]](/icons/compressed.gif) | Checkers v2.1 (woz-a-day collection).zip | 2024-04-19 21:57 | 23K | |
![[ ]](/icons/compressed.gif) | S.A.M.CARD.SDK.zip | 2020-08-28 22:28 | 24K | |
![[ ]](/icons/compressed.gif) | Testing Basic Math Skills 2 (4am crack).zip | 2025-01-19 14:00 | 24K | |
![[ ]](/icons/compressed.gif) | smir3_1apple.zip | 2023-08-19 15:12 | 25K | |
![[ ]](/icons/compressed.gif) | Space Rescue (4am crack).zip | 2022-06-10 16:44 | 25K | |
![[ ]](/icons/compressed.gif) | Guardian (Softsmith) (woz-a-day collection).zip | 2025-04-08 00:56 | 25K | |
![[ ]](/icons/compressed.gif) | Pythagoras and The Dragon (4am crack).zip | 2022-06-10 16:37 | 25K | |
![[ ]](/icons/compressed.gif) | The Factory 1984 (4am crack).zip | 2022-06-30 17:01 | 25K | |
![[ ]](/icons/compressed.gif) | Real Estate Analysis Modules- Income Property Analysis (4am crack).zip | 2024-07-22 20:25 | 26K | |
![[ ]](/icons/compressed.gif) | Ultima Helper (4am crack).zip | 2024-12-07 14:52 | 26K | |
![[ ]](/icons/compressed.gif) | Gothmog's Lair (4am crack).zip | 2022-06-10 16:32 | 27K | |
![[ ]](/icons/compressed.gif) | Success with Math- Multiplication and Division (4am crack).zip | 2024-05-02 23:33 | 27K | |
![[ ]](/icons/compressed.gif) | Testing Basic Math Skills 1 (4am crack).zip | 2025-01-19 13:55 | 28K | |
![[ ]](/icons/compressed.gif) | Copy II Plus v1.0 (4am crack).zip | 2023-12-11 20:46 | 28K | |
![[ ]](/icons/compressed.gif) | Keyboard Controlled Sequencer (4am crack).zip | 2024-07-22 20:14 | 29K | |
![[ ]](/icons/compressed.gif) | Star Explorer (4am crack).zip | 2024-09-16 14:45 | 30K | |
![[ ]](/icons/compressed.gif) | Boulder Dash (Ozisoft) (woz-a-day collection).zip | 2025-01-25 21:03 | 30K | |
![[ ]](/icons/compressed.gif) | Capitalization- Building Better Language Skills (4am crack).zip | 2024-04-17 16:10 | 31K | |
![[ ]](/icons/compressed.gif) | CHASM Checking Account Systems Manager (4am crack).zip | 2022-07-02 10:46 | 31K | |
![[ ]](/icons/compressed.gif) | Black Belt rev. 3 (4am crack).zip | 2025-01-19 14:19 | 31K | |
![[ ]](/icons/compressed.gif) | Kinder Critters- Letters and Patterns (4am crack).zip | 2024-04-29 20:08 | 31K | |
![[ ]](/icons/compressed.gif) | Punctuation- Building Better Language Skills (4am crack).zip | 2024-04-17 17:15 | 32K | |
![[ ]](/icons/compressed.gif) | Story Writing (4am crack).zip | 2022-07-06 17:44 | 33K | |
![[ ]](/icons/compressed.gif) | Grammar- Building Better Language Skills- Nouns (4am crack).zip | 2024-04-17 16:34 | 33K | |
![[ ]](/icons/compressed.gif) | Spelling Rules rev. 0 (4am crack).zip | 2025-01-19 14:11 | 33K | |
![[ ]](/icons/compressed.gif) | Grammar- Building Better Language Skills- Adjectives and Adverbs (4am crack).zip | 2024-04-17 16:27 | 33K | |
![[ ]](/icons/compressed.gif) | Hi-Res Football (woz-a-day collection).zip | 2024-04-19 22:38 | 33K | |
![[ ]](/icons/compressed.gif) | Patterns in Rhythm- Level Three (4am crack).zip | 2022-03-12 21:29 | 33K | |
![[ ]](/icons/compressed.gif) | Mathosaurus- Kindergarten (4am crack).zip | 2024-04-17 17:25 | 34K | |
![[ ]](/icons/compressed.gif) | Stickybear Town Builder rev. 2 (4am and san inc crack).zip | 2023-10-30 13:48 | 34K | |
![[ ]](/icons/compressed.gif) | Math Sequences- Percents 1984 (4am crack).zip | 2024-12-05 16:29 | 34K | |
![[ ]](/icons/unknown.gif) | HCGSLOGO2.2.SHK | 2021-07-24 01:44 | 34K | |
![[ ]](/icons/compressed.gif) | Back It Up III v3.4 (woz-a-day collection).zip | 2024-03-16 22:12 | 35K | |
![[ ]](/icons/compressed.gif) | Story Tree v1.3 (4am and san inc crack).zip | 2022-06-12 20:26 | 36K | |
![[ ]](/icons/compressed.gif) | Galaxy Math- Integers (4am crack).zip | 2025-03-26 13:51 | 37K | |
![[ ]](/icons/compressed.gif) | Portrait Robot (4am crack).zip | 2022-07-03 15:38 | 37K | |
![[ ]](/icons/compressed.gif) | Grammar- Building Better Language Skills- Verbs (4am crack).zip | 2024-04-17 16:39 | 38K | |
![[ ]](/icons/compressed.gif) | The Teacher's Tool Kit- Word Scramble v2.0 (4am crack).zip | 2024-05-02 23:39 | 38K | |
![[ ]](/icons/compressed.gif) | Apple IIc Diagnostics 2.0 3.zip | 2021-11-02 05:51 | 38K | |
![[ ]](/icons/compressed.gif) | War (Adventure International) (4am crack).zip | 2024-04-28 11:04 | 38K | |
![[ ]](/icons/compressed.gif) | Integers-Equations I v04.27.85 (4am crack).zip | 2025-01-19 01:06 | 39K | |
![[ ]](/icons/compressed.gif) | Magneto Bugs (4am crack).zip | 2025-03-21 13:35 | 39K | |
![[ ]](/icons/compressed.gif) | Algebra Arcade (4am crack).zip | 2025-03-23 17:07 | 39K | |
![[ ]](/icons/compressed.gif) | Boulder Dash (woz-a-day collection).zip | 2025-01-21 17:27 | 40K | |
![[ ]](/icons/compressed.gif) | French- Classroom Words (4am crack).zip | 2022-07-06 20:56 | 40K | |
![[ ]](/icons/compressed.gif) | Scramble (4am crack).zip | 2024-04-17 16:59 | 40K | |
![[ ]](/icons/compressed.gif) | Roulette (woz-a-day collection).zip | 2025-04-20 14:09 | 40K | |
![[ ]](/icons/compressed.gif) | Rhythm Write (4am crack).zip | 2023-12-11 12:37 | 40K | |
![[ ]](/icons/compressed.gif) | Integers-Equations II v04.27.85 (4am crack).zip | 2025-01-19 13:51 | 40K | |
![[ ]](/icons/compressed.gif) | Success with Algebra- Advanced Linear Equations (4am crack).zip | 2024-04-29 20:21 | 40K | |
![[ ]](/icons/compressed.gif) | PFS Report 1981-01-03 (vB.00) (4am crack).zip | 2022-06-29 13:44 | 40K | |
![[ ]](/icons/compressed.gif) | Diagnostic Tests- Vocabulary v01.17.89 (4am crack).zip | 2024-11-18 20:57 | 40K | |
![[ ]](/icons/compressed.gif) | Stickybear Word Problems rev. 2 (4am and san inc crack).zip | 2023-10-30 13:51 | 40K | |
![[ ]](/icons/compressed.gif) | The Heart Simulator (4am crack).zip | 2025-04-26 18:27 | 41K | |
![[ ]](/icons/compressed.gif) | German- Vocabulary for Shopping Use (4am crack).zip | 2022-06-30 16:34 | 41K | |
![[ ]](/icons/compressed.gif) | Counting Parade rev. 0 (4am crack).zip | 2022-07-06 21:17 | 41K | |
![[ ]](/icons/compressed.gif) | SYS-EX (4am crack).zip | 2024-07-22 20:31 | 42K | |
![[ ]](/icons/compressed.gif) | PFS File vB.01 (4am crack).zip | 2022-06-28 16:28 | 42K | |
![[ ]](/icons/compressed.gif) | Nibbles Away II vA1 (woz-a-day collection).zip | 2024-03-16 22:26 | 42K | |
![[ ]](/icons/compressed.gif) | Grammar- Building Better Language Skills- Sentences (4am crack).zip | 2024-04-17 16:45 | 43K | |
![[ ]](/icons/compressed.gif) | Kinder Critters- Address and Phone Number (4am crack).zip | 2024-04-17 19:08 | 44K | |
![[ ]](/icons/compressed.gif) | Super Boulderdash (woz-a-day collection).zip | 2025-01-21 17:01 | 44K | |
![[ ]](/icons/compressed.gif) | Profession Détective- Qui a volé Lily (4am crack).zip | 2022-06-30 16:56 | 45K | |
![[ ]](/icons/compressed.gif) | Magicalc v2.0-1984 (4am crack).zip | 2022-07-01 17:22 | 45K | |
![[ ]](/icons/compressed.gif) | Super Boulderdash II (woz-a-day collection).zip | 2025-01-21 17:27 | 45K | |
![[ ]](/icons/compressed.gif) | Note Detective I- Elementary Level (4am crack).zip | 2022-03-12 21:25 | 45K | |
![[ ]](/icons/compressed.gif) | Ray Tracing v1.0 (4am crack).zip | 2024-04-29 20:34 | 46K | |
![[ ]](/icons/compressed.gif) | Tap-It (4am crack).zip | 2022-03-28 00:55 | 46K | |
![[ ]](/icons/compressed.gif) | Car Builder rev. 4 (4am and san inc crack).zip | 2023-10-30 13:54 | 47K | |
![[ ]](/icons/compressed.gif) | Early Learning Adventures- Dragon's Keep (4am crack).zip | 2024-12-05 16:51 | 47K | |
![[ ]](/icons/compressed.gif) | Computer Bismarck v1.1 (4am and san inc crack).zip | 2022-06-12 20:16 | 47K | |
![[ ]](/icons/compressed.gif) | Learning Through Logo (4am crack).zip | 2025-03-25 18:44 | 47K | |
![[ ]](/icons/compressed.gif) | The Budgeting Simulation (4am crack).zip | 2024-12-04 21:40 | 48K | |
![[ ]](/icons/compressed.gif) | The Bubble Gum Machine (4am crack).zip | 2022-04-26 08:10 | 48K | |
![[ ]](/icons/compressed.gif) | Fractions en Folie (4am crack).zip | 2022-06-30 18:59 | 48K | |
![[ ]](/icons/compressed.gif) | The Budgeting Tutorial (4am crack).zip | 2024-12-04 21:40 | 48K | |
![[ ]](/icons/compressed.gif) | Spelling Strategy 1981 (4am crack).zip | 2024-09-12 20:42 | 48K | |
![[ ]](/icons/unknown.gif) | ClipCopyPlusV1.1.bxy | 2019-06-13 10:01 | 49K | |
![[ ]](/icons/compressed.gif) | Half Time v2.0 (4am crack).zip | 2022-07-06 17:49 | 49K | |
![[ ]](/icons/compressed.gif) | The Gem of Zephyrr v1.1.0 (4am crack).zip | 2023-12-07 10:41 | 49K | |
![[ ]](/icons/unknown.gif) | ClipCopyPlusV111.bxy | 2019-06-13 10:01 | 49K | |
![[ ]](/icons/compressed.gif) | Off Center v1.2 (4am crack).zip | 2025-01-19 14:06 | 49K | |
![[ ]](/icons/compressed.gif) | Stickybear Reading rev. 2 (4am and san inc crack).zip | 2023-10-30 13:46 | 49K | |
![[ ]](/icons/compressed.gif) | Math Blaster v080584 (4am crack).zip | 2022-06-17 21:26 | 49K | |
![[ ]](/icons/compressed.gif) | Stickybear Printer v1 (4am and san inc crack).zip | 2023-10-30 13:41 | 50K | |
![[ ]](/icons/compressed.gif) | The Time Tunnel- Sports Edition (4am crack).zip | 2022-09-24 17:16 | 50K | |
![[ ]](/icons/compressed.gif) | MIDI-8 Plus v1.2 for MPU-401 (4am and san inc crack).zip | 2024-09-16 14:36 | 50K | |
![[ ]](/icons/compressed.gif) | FAMMUSIC-V27.zip | 2019-12-26 01:10 | 51K | |
![[ ]](/icons/compressed.gif) | ACEWriter (4am crack).zip | 2024-11-18 20:44 | 52K | |
![[ ]](/icons/compressed.gif) | Language Carnival 2 (4am crack).zip | 2024-04-29 20:28 | 52K | |
![[ ]](/icons/compressed.gif) | Algebra Volume 3 v1.1 (4am crack).zip | 2024-12-05 16:38 | 52K | |
![[ ]](/icons/compressed.gif) | Shadow Hawk One rev. 1 (4am crack).zip | 2023-12-08 22:24 | 53K | |
![[ ]](/icons/compressed.gif) | MIDI-8 Plus v1.2 (4am and san inc crack).zip | 2024-12-07 17:37 | 53K | |
![[ ]](/icons/compressed.gif) | Keyboard Speed Reading (woz-a-day collection).zip | 2025-03-18 21:09 | 53K | |
![[ ]](/icons/compressed.gif) | Zoo Puppet Theater (woz-a-day collection).zip | 2025-03-18 21:30 | 53K | |
![[ ]](/icons/compressed.gif) | Battalion Commander (woz-a-day collection).zip | 2024-08-06 20:13 | 54K | |
![[ ]](/icons/compressed.gif) | poms14.zip | 2019-12-27 07:00 | 54K | |
![[ ]](/icons/compressed.gif) | Pixit v01331 (4am crack).zip | 2022-07-03 15:34 | 54K | |
![[ ]](/icons/compressed.gif) | Cyborg (Softsmith) (4am crack).zip | 2022-06-09 11:11 | 54K | |
![[ ]](/icons/compressed.gif) | Olympic Decathlon (woz-a-day collection).zip | 2025-03-19 18:18 | 54K | |
![[ ]](/icons/compressed.gif) | Number Explorer (4am crack).zip | 2022-06-28 10:23 | 55K | |
![[ ]](/icons/compressed.gif) | PFS Report 1985-09-10 (4am crack).zip | 2022-07-10 16:43 | 55K | |
![[ ]](/icons/compressed.gif) | Integrated Accounting on Microcomputers (4am crack).zip | 2024-12-05 14:05 | 55K | |
![[ ]](/icons/compressed.gif) | PFS File v10-SEP-85 (4am crack).zip | 2022-06-12 20:22 | 55K | |
![[ ]](/icons/layout.gif) | Dithertizer Setup & Review.pdf | 2021-01-18 00:49 | 55K | |
![[ ]](/icons/compressed.gif) | Microsoft Decathlon (woz-a-day collection).zip | 2025-03-20 22:09 | 56K | |
![[ ]](/icons/compressed.gif) | Clauses and Whole Sentences (4am crack).zip | 2024-02-03 21:43 | 56K | |
![[ ]](/icons/compressed.gif) | Shadow Hawk One rev. 2 (4am crack).zip | 2023-12-11 12:05 | 56K | |
![[ ]](/icons/compressed.gif) | Blazing Paddles rev. 0 (4am crack).zip | 2022-07-03 15:51 | 57K | |
![[ ]](/icons/compressed.gif) | Desktop Zoo (4am crack).zip | 2022-06-10 16:27 | 57K | |
![[ ]](/icons/compressed.gif) | Master Diagnostics II and II Plus (4am crack).zip | 2022-07-10 12:46 | 57K | |
![[ ]](/icons/compressed.gif) | Space Conquerors (4am and san inc crack).zip | 2022-03-12 21:17 | 57K | |
![[ ]](/icons/compressed.gif) | Blazing Paddles v04421 (4am crack).zip | 2022-06-30 13:01 | 58K | |
![[ ]](/icons/compressed.gif) | PFS Report 1984-03-20 (4am crack).zip | 2022-07-06 17:38 | 58K | |
![[ ]](/icons/compressed.gif) | Desktop Zoo rev. 2 (4am crack).zip | 2024-04-17 16:53 | 59K | |
![[ ]](/icons/compressed.gif) | Educational Games Demonstration Disk (4am crack).zip | 2025-03-21 13:33 | 59K | |
![[ ]](/icons/compressed.gif) | Factactics Trivia Game- Sports (4am crack).zip | 2024-05-02 13:21 | 59K | |
![[ ]](/icons/compressed.gif) | Car_Builder.zip | 2020-05-03 20:01 | 59K | |
![[ ]](/icons/compressed.gif) | Trigonometry of the Right Triangle (4am crack).zip | 2025-01-19 01:01 | 59K | |
![[ ]](/icons/compressed.gif) | EasyGraph rev. 2 (4am crack).zip | 2025-01-21 18:23 | 59K | |
![[ ]](/icons/compressed.gif) | PFS File vC.00 (4am crack).zip | 2022-06-28 16:44 | 60K | |
![[ ]](/icons/compressed.gif) | Video Vegas v12511 (4am crack).zip | 2022-06-29 15:23 | 61K | |
![[ ]](/icons/compressed.gif) | PFS Graph 1983-01-12 (4am crack).zip | 2022-06-28 16:44 | 62K | |
![[ ]](/icons/compressed.gif) | wizplus.zip | 2023-10-18 19:51 | 63K | |
![[ ]](/icons/compressed.gif) | PFS Etat 1984-11-26 (4am crack).zip | 2022-06-30 19:11 | 63K | |
![[ ]](/icons/compressed.gif) | ADD Reading Skills A (4am crack).zip | 2025-01-18 22:03 | 63K | |
![[ ]](/icons/compressed.gif) | Chemistry Demonstration Disk (4am crack).zip | 2025-03-21 13:27 | 63K | |
![[ ]](/icons/compressed.gif) | Locksmith v5.0G (4am crack).zip | 2022-06-10 16:53 | 63K | |
![[ ]](/icons/compressed.gif) | PFS Fichier 1984-11-26 (4am crack).zip | 2022-07-10 16:36 | 63K | |
![[ ]](/icons/compressed.gif) | Rainy Day Games (4am crack).zip | 2022-06-29 15:13 | 64K | |
![[ ]](/icons/compressed.gif) | Punctuation Skills- End Marks, Semicolon, and Colon (4am crack).zip | 2024-04-29 20:17 | 64K | |
![[ ]](/icons/compressed.gif) | Micro League Baseball rev. 1 (woz-a-day collection).zip | 2024-12-03 16:18 | 64K | |
![[ ]](/icons/compressed.gif) | Micro League Baseball rev. 3 (woz-a-day collection).zip | 2024-12-03 18:13 | 64K | |
![[ ]](/icons/compressed.gif) | Micro League Baseball rev. 2 (woz-a-day collection).zip | 2024-12-03 18:11 | 65K | |
![[ ]](/icons/compressed.gif) | Building Tens Strategy 1985-04-16 (4am crack).zip | 2025-03-24 13:57 | 65K | |
![[ ]](/icons/compressed.gif) | Biology Demonstration Disk (4am crack).zip | 2025-03-21 13:25 | 66K | |
![[ ]](/icons/compressed.gif) | PFS Write 1984-09-27 (4am crack).zip | 2022-06-29 13:31 | 66K | |
![[ ]](/icons/compressed.gif) | Alphabet Zoo (4am crack).zip | 2022-07-05 11:48 | 66K | |
![[ ]](/icons/compressed.gif) | Order Tracking System v1.3a (4am and san inc crack).zip | 2022-06-10 17:04 | 67K | |
![[ ]](/icons/compressed.gif) | The Division Facts (woz-a-day collection).zip | 2025-04-02 13:13 | 67K | |
![[ ]](/icons/compressed.gif) | The Multiplication Facts (woz-a-day collection).zip | 2025-04-02 13:13 | 67K | |
![[ ]](/icons/compressed.gif) | ADD Reading Skills B (4am crack).zip | 2025-01-18 22:09 | 68K | |
![[ ]](/icons/compressed.gif) | The Addition Facts (woz-a-day collection).zip | 2025-04-02 13:13 | 68K | |
![[ ]](/icons/compressed.gif) | PFS Graph 1984-01-31 (4am crack).zip | 2022-06-28 16:53 | 68K | |
![[ ]](/icons/compressed.gif) | PFS Write 1984-11-01 (4am crack).zip | 2022-06-30 16:28 | 69K | |
![[ ]](/icons/compressed.gif) | Ski Crazed v28701 (4am crack).zip | 2022-06-29 15:19 | 69K | |
![[ ]](/icons/compressed.gif) | Micro League Baseball Box Score-Stat Compiler Disk (woz-a-day collection).zip | 2024-12-11 11:16 | 69K | |
![[ ]](/icons/compressed.gif) | War (Adventure International) (woz-a-day collection).zip | 2024-04-28 13:25 | 69K | |
![[ ]](/icons/compressed.gif) | The Subtraction Facts (woz-a-day collection).zip | 2025-04-02 13:13 | 69K | |
![[ ]](/icons/compressed.gif) | Battle of Antietam v1.3 (4am and san inc crack).zip | 2022-06-12 20:10 | 70K | |
![[ ]](/icons/compressed.gif) | The Chambers of Vocab rev. 2 (4am crack).zip | 2022-07-03 15:15 | 70K | |
![[ ]](/icons/compressed.gif) | PFS Graph 1984-03-14 (4am crack).zip | 2022-06-29 13:28 | 70K | |
![[ ]](/icons/compressed.gif) | Aliencounter & Face Flash rev. 1 (woz-a-day collection).zip | 2024-12-08 22:22 | 70K | |
![[ ]](/icons/compressed.gif) | Dinosaur's Lunch (woz-a-day collection).zip | 2025-03-18 20:31 | 71K | |
![[ ]](/icons/compressed.gif) | Trickster Coyote 1984 (4am crack).zip | 2022-06-30 12:03 | 71K | |
![[ ]](/icons/compressed.gif) | Solo Flight (woz-a-day collection).zip | 2025-03-20 10:48 | 71K | |
![[ ]](/icons/compressed.gif) | Measuring Economic Activities (woz-a-day collection).zip | 2024-07-22 21:07 | 71K | |
![[ ]](/icons/compressed.gif) | Follow Me (woz-a-day collection).zip | 2025-03-18 20:38 | 73K | |
![[ ]](/icons/compressed.gif) | Nuclear Reactions (woz-a-day collection).zip | 2025-04-02 13:13 | 74K | |
![[ ]](/icons/compressed.gif) | Science Volume 1- The Environment (4am crack).zip | 2022-07-10 12:39 | 74K | |
![[ ]](/icons/compressed.gif) | PFS Report 1982-01-14 (4am crack).zip | 2022-06-30 13:14 | 74K | |
![[ ]](/icons/compressed.gif) | Battling Bugs & Concentraction rev. 2 (woz-a-day collection).zip | 2024-12-09 01:10 | 74K | |
![[ ]](/icons/compressed.gif) | Take 1 v06401 (4am crack).zip | 2022-07-03 15:23 | 75K | |
![[ ]](/icons/compressed.gif) | Boulder Dash Construction Kit (woz-a-day collection).zip | 2025-01-21 17:28 | 75K | |
![[ ]](/icons/compressed.gif) | Take 1 v06431 (4am crack).zip | 2022-07-06 17:33 | 75K | |
![[ ]](/icons/compressed.gif) | Key Lingo rev. 2 (4am crack).zip | 2022-06-27 20:28 | 75K | |
![[ ]](/icons/compressed.gif) | F-15 Strike Eagle v1.4 (woz-a-day collection).zip | 2024-04-19 22:17 | 76K | |
![[ ]](/icons/compressed.gif) | Aliencounter & Face Flash rev. 2 (woz-a-day collection).zip | 2024-12-08 22:22 | 77K | |
![[ ]](/icons/compressed.gif) | From The Beginning... Contraception (4am crack).zip | 2024-04-17 15:54 | 78K | |
![[ ]](/icons/compressed.gif) | B-24 v1.0 (woz-a-day collection).zip | 2024-08-04 17:06 | 79K | |
![[ ]](/icons/compressed.gif) | Reading for Comprehension Level C (4am crack).zip | 2025-01-19 00:56 | 80K | |
![[ ]](/icons/compressed.gif) | FourWord & WordLift (woz-a-day collection).zip | 2024-12-09 01:10 | 80K | |
![[ ]](/icons/compressed.gif) | Phantasie (4am and san inc crack).zip | 2024-03-04 18:05 | 81K | |
![[ ]](/icons/compressed.gif) | Writer's Helper v1.5 (4am crack).zip | 2022-06-10 17:24 | 81K | |
![[ ]](/icons/compressed.gif) | The New Step by Step (4am crack).zip | 2022-06-10 17:24 | 81K | |
![[ ]](/icons/compressed.gif) | Two Liners 10-2019.zip | 2021-02-17 22:00 | 81K | |
![[ ]](/icons/compressed.gif) | Aliencounter & Face Flash rev. 3 (woz-a-day collection).zip | 2024-12-08 22:22 | 81K | |
![[ ]](/icons/compressed.gif) | The Time Tunnel- Early America (woz-a-day collection).zip | 2024-07-22 21:21 | 83K | |
![[ ]](/icons/compressed.gif) | F-15 Strike Eagle rev. 3 (woz-a-day collection).zip | 2025-03-20 10:33 | 83K | |
![[ ]](/icons/compressed.gif) | Baltic 1985 (woz-a-day collection).zip | 2024-08-04 17:09 | 83K | |
![[ ]](/icons/compressed.gif) | Scott Adams Graphic Adventure 1 - Adventureland v2.2-416 (4am crack).zip | 2024-04-29 20:12 | 83K | |
![[ ]](/icons/compressed.gif) | Keyboard Arpeggios (woz-a-day collection).zip | 2025-03-18 20:42 | 84K | |
![[ ]](/icons/compressed.gif) | Ultima II rev. 2 (4am crack).zip | 2022-06-09 10:55 | 84K | |
![[ ]](/icons/compressed.gif) | Ultima II rev. 1 (4am crack).zip | 2022-06-09 10:55 | 84K | |
![[ ]](/icons/compressed.gif) | Word Machine & Word Machine with Spelling List (woz-a-day collection).zip | 2024-12-09 01:10 | 84K | |
![[ ]](/icons/compressed.gif) | The Graphics Magician Junior (woz-a-day collection).zip | 2025-03-21 20:14 | 84K | |
![[ ]](/icons/compressed.gif) | F-15 Strike Eagle rev. 2 (woz-a-day collection).zip | 2025-03-20 10:33 | 85K | |
![[ ]](/icons/compressed.gif) | Ace Detective rev. 3 (4am crack).zip | 2023-12-11 12:14 | 85K | |
![[ ]](/icons/layout.gif) | tarot_2021_rules_en.pdf | 2021-03-03 11:09 | 87K | |
![[ ]](/icons/compressed.gif) | Keyboard Note Drill (woz-a-day collection).zip | 2025-03-18 21:06 | 87K | |
![[ ]](/icons/compressed.gif) | F-15 Strike Eagle rev. 1 (woz-a-day collection).zip | 2025-03-20 10:32 | 87K | |
![[ ]](/icons/compressed.gif) | The Time Tunnel- The Presidents (woz-a-day collection).zip | 2024-07-22 21:31 | 88K | |
![[ ]](/icons/compressed.gif) | Keyboard Fingerings (woz-a-day collection).zip | 2025-03-18 20:55 | 90K | |
![[ ]](/icons/compressed.gif) | Pacific 231 (4am crack).zip | 2022-07-10 16:43 | 90K | |
![[ ]](/icons/compressed.gif) | The Jar Game & Chaos (woz-a-day collection).zip | 2024-12-08 22:22 | 91K | |
![[ ]](/icons/compressed.gif) | Note Detective I- Elementary Level (woz-a-day collection).zip | 2025-03-18 21:13 | 93K | |
![[ ]](/icons/compressed.gif) | Earthquakes and Volcanoes (4am crack).zip | 2024-04-29 20:37 | 93K | |
![[ ]](/icons/compressed.gif) | Colonial Conquest v1.1 (woz-a-day collection).zip | 2024-08-04 22:30 | 94K | |
![[ ]](/icons/compressed.gif) | Ultima II rev. 3 (4am crack).zip | 2022-06-09 10:55 | 94K | |
![[ ]](/icons/compressed.gif) | Magneto Bugs (woz-a-day collection).zip | 2025-03-21 18:20 | 96K | |
![[ ]](/icons/compressed.gif) | Bubble Bobble (woz-a-day collection).zip | 2024-04-19 14:15 | 96K | |
![[ ]](/icons/compressed.gif) | Advance to Boardwalk (woz-a-day collection).zip | 2024-04-20 19:48 | 97K | |
![[ ]](/icons/compressed.gif) | Silent Service v325.02 (woz-a-day collection).zip | 2025-03-20 10:45 | 97K | |
![[ ]](/icons/compressed.gif) | Keyboard Intervals (woz-a-day collection).zip | 2025-03-18 20:57 | 97K | |
![[ ]](/icons/unknown.gif) | gsummer.1.0.bxy | 2019-06-13 10:02 | 97K | |
![[ ]](/icons/compressed.gif) | Collamore Castle- Strategies for Problem Solving Level 1 (woz-a-day collection).zip | 2025-04-02 13:35 | 98K | |
![[ ]](/icons/compressed.gif) | NATO Commander (woz-a-day collection).zip | 2025-03-20 10:35 | 99K | |
![[ ]](/icons/compressed.gif) | The Bank Street Writer Plus v1.4 Tutorial (woz-a-day collection).zip | 2024-07-14 18:31 | 99K | |
![[ ]](/icons/compressed.gif) | Race Car Keys (woz-a-day collection).zip | 2025-03-18 21:27 | 99K | |
![[ ]](/icons/compressed.gif) | Carrier Force (woz-a-day collection).zip | 2024-08-06 20:21 | 99K | |
![[ ]](/icons/compressed.gif) | Learning Through Logo (woz-a-day collection).zip | 2025-03-25 18:40 | 99K | |
![[ ]](/icons/compressed.gif) | Beach-Head II (woz-a-day collection).zip | 2024-04-19 22:09 | 100K | |
![[ ]](/icons/compressed.gif) | NATO Commander v1.2 (woz-a-day collection).zip | 2025-03-20 10:37 | 100K | |
![[ ]](/icons/compressed.gif) | Questprobe featuring Spider-Man vF-261 (4am crack).zip | 2024-05-02 11:59 | 100K | |
![[ ]](/icons/compressed.gif) | Eagles (woz-a-day collection).zip | 2024-08-06 20:25 | 100K | |
![[ ]](/icons/compressed.gif) | NATO Commander v1.1 (woz-a-day collection).zip | 2025-03-20 10:36 | 101K | |
![[ ]](/icons/compressed.gif) | The Tournament Manager (woz-a-day collection).zip | 2025-04-02 13:13 | 102K | |
![[ ]](/icons/compressed.gif) | Silent Service v325.04 (woz-a-day collection).zip | 2025-03-20 10:46 | 103K | |
![[ ]](/icons/compressed.gif) | Murder on the Zinderneuf (woz-a-day collection).zip | 2025-01-21 12:17 | 103K | |
![[ ]](/icons/compressed.gif) | The Time Tunnel- Sports Edition (woz-a-day collection).zip | 2024-07-22 21:41 | 103K | |
![[ ]](/icons/compressed.gif) | Gulp!! & Frenzy (woz-a-day collection).zip | 2024-12-08 22:22 | 103K | |
![[ ]](/icons/compressed.gif) | Ginn Reading Program (4am crack).zip | 2022-06-14 15:34 | 103K | |
![[ ]](/icons/compressed.gif) | Faire le Point-Bac Physique 3 (4am crack).zip | 2022-07-06 21:05 | 103K | |
![[ ]](/icons/compressed.gif) | Destiny (4am crack).zip | 2022-09-24 16:58 | 104K | |
![[ ]](/icons/compressed.gif) | Questprobe featuring Spider-Man vB-258 (4am crack).zip | 2024-05-02 13:08 | 104K | |
![[ ]](/icons/compressed.gif) | Silent Service (woz-a-day collection).zip | 2025-03-20 10:44 | 104K | |
![[ ]](/icons/compressed.gif) | Situation- Critical (woz-a-day collection).zip | 2024-04-19 14:04 | 104K | |
![[ ]](/icons/compressed.gif) | The Bank Street Writer III v1.1 Tutorial (woz-a-day collection).zip | 2024-07-14 18:20 | 109K | |
![[ ]](/icons/compressed.gif) | Fighter Command (woz-a-day collection).zip | 2024-08-06 20:28 | 109K | |
![[ ]](/icons/compressed.gif) | The Bank Street Writer III v1.4 Tutorial (woz-a-day collection).zip | 2024-07-14 18:42 | 109K | |
![[ ]](/icons/compressed.gif) | Bomb Alley (woz-a-day collection).zip | 2024-08-06 20:16 | 109K | |
![[ ]](/icons/compressed.gif) | Prince v15521 (4am crack).zip | 2022-06-30 17:52 | 109K | |
![[ ]](/icons/compressed.gif) | Prince v15531 (4am crack).zip | 2022-07-03 15:55 | 110K | |
![[ ]](/icons/compressed.gif) | Keyboard Blues (woz-a-day collection).zip | 2025-03-18 20:48 | 110K | |
![[ ]](/icons/compressed.gif) | Blazing Paddles v04431 (woz-a-day collection).zip | 2025-01-25 21:53 | 110K | |
![[ ]](/icons/compressed.gif) | 50 Mission Crush v1.2 (woz-a-day collection).zip | 2024-08-04 17:03 | 111K | |
![[ ]](/icons/compressed.gif) | Early Music Skills (woz-a-day collection).zip | 2025-03-18 20:34 | 111K | |
![[ ]](/icons/compressed.gif) | Kittens, Kids, and a Frog 03.12.86 (4am crack).zip | 2022-06-09 20:16 | 111K | |
![[ ]](/icons/compressed.gif) | Math Blaster Plus v1.5 (4am crack).zip | 2024-09-05 20:37 | 112K | |
![[ ]](/icons/layout.gif) | Peeker Disk Content.pdf | 2020-11-25 04:26 | 113K | |
![[ ]](/icons/compressed.gif) | 50 Mission Crush v1.1 (woz-a-day collection).zip | 2024-08-04 17:02 | 113K | |
![[ ]](/icons/compressed.gif) | Guitar Wizard v11601 (woz-a-day collection).zip | 2025-01-25 21:57 | 113K | |
![[ ]](/icons/compressed.gif) | Pop 'R Spell & Pop 'R Spell Challenge (woz-a-day collection).zip | 2024-12-09 01:10 | 114K | |
![[ ]](/icons/compressed.gif) | Keyboard Extended Jazz Harmonies (woz-a-day collection).zip | 2025-03-18 21:05 | 114K | |
![[ ]](/icons/compressed.gif) | Blazing Paddles (woz-a-day collection).zip | 2025-01-25 21:50 | 115K | |
![[ ]](/icons/compressed.gif) | The Changing Earth (woz-a-day collection).zip | 2025-04-02 13:13 | 115K | |
![[ ]](/icons/compressed.gif) | Cotton's First Files (4am crack).zip | 2022-07-10 12:28 | 115K | |
![[ ]](/icons/compressed.gif) | Keyboard Chords (woz-a-day collection).zip | 2025-03-18 20:52 | 116K | |
![[ ]](/icons/compressed.gif) | Keyboard Jazz Harmonies (woz-a-day collection).zip | 2025-03-18 21:01 | 116K | |
![[ ]](/icons/compressed.gif) | Blazing Paddles v04421 (woz-a-day collection).zip | 2025-01-25 21:51 | 116K | |
![[ ]](/icons/compressed.gif) | Living Chess Library - 50 Classic Games (4am crack).zip | 2022-07-10 12:07 | 117K | |
![[ ]](/icons/compressed.gif) | Note Detective II- Intermediate Level (woz-a-day collection).zip | 2025-03-18 21:16 | 119K | |
![[ ]](/icons/compressed.gif) | Star Maze (woz-a-day collection).zip | 2024-12-06 15:30 | 119K | |
![[ ]](/icons/compressed.gif) | Wizimore - Nihonbashi (woz-a-day collection).zip | 2024-03-20 21:53 | 120K | |
![[TXT]](/icons/text.gif) | catalog_clipartdisk_zips.txt | 2019-07-21 09:49 | 120K | |
![[ ]](/icons/layout.gif) | Oral History Panel on 5.25 and 3.5 inch Floppy Drives [shugart-apple] 1-3-2005.pdf | 2020-07-27 20:18 | 120K | |
![[ ]](/icons/compressed.gif) | Guitar Wizard v11611 (woz-a-day collection).zip | 2025-01-25 21:59 | 120K | |
![[ ]](/icons/compressed.gif) | Muppetville rev. 2 (4am crack).zip | 2022-06-10 18:49 | 120K | |
![[ ]](/icons/compressed.gif) | Wizimore - The Scarlet Brotherhood of Hsi Ho (woz-a-day collection).zip | 2024-03-19 12:24 | 121K | |
![[ ]](/icons/compressed.gif) | Wizimore - The Emperor's Seal (woz-a-day collection).zip | 2024-03-20 22:04 | 122K | |
![[ ]](/icons/compressed.gif) | Wizimore - Catacombs of Vlad (woz-a-day collection).zip | 2024-03-20 22:12 | 123K | |
![[ ]](/icons/compressed.gif) | Wizimore - O'Connor's Mine (woz-a-day collection).zip | 2024-03-17 21:29 | 123K | |
![[ ]](/icons/compressed.gif) | Moonlight & Madness I v03.22.88 (4am crack).zip | 2024-11-18 21:16 | 124K | |
![[ ]](/icons/compressed.gif) | Multiscribe v3.01c (4am crack).zip | 2022-07-05 11:56 | 125K | |
![[ ]](/icons/compressed.gif) | The Bank Street Writer Plus v1.4 (woz-a-day collection).zip | 2024-07-14 18:26 | 126K | |
![[ ]](/icons/compressed.gif) | Peanuts Math Matcher (4am crack).zip | 2024-04-29 20:24 | 131K | |
![[ ]](/icons/compressed.gif) | Pirates (san inc crack).zip | 2025-06-05 21:18 | 135K | |
![[ ]](/icons/compressed.gif) | The Bank Street Speller (woz-a-day collection).zip | 2024-07-31 11:20 | 136K | |
![[ ]](/icons/compressed.gif) | Rebus Writer (4am crack).zip | 2022-06-09 20:43 | 136K | |
![[ ]](/icons/unknown.gif) | networker200.bxy | 2019-06-13 10:03 | 139K | |
![[ ]](/icons/compressed.gif) | Sherwood Forest (4am crack).zip | 2022-07-10 16:51 | 139K | |
![[ ]](/icons/unknown.gif) | 201_Zap_Lunar_Lander_Asteroid_Field_Eliminator_Star_Maze_Ceiling_Zero.dsk | 2022-03-11 22:17 | 140K | |
![[ ]](/icons/unknown.gif) | A2-3DA Saturn Navigator (with title screen)(b).dsk | 2021-09-28 17:18 | 140K | |
![[ ]](/icons/unknown.gif) | APPLE 1 AGE DIFFERENCE BY MATTEO TREVISAN (mod by GG).dsk | 2022-03-27 12:32 | 140K | |
![[ ]](/icons/unknown.gif) | A Thing.dsk | 2022-08-18 21:05 | 140K | |
![[ ]](/icons/unknown.gif) | Acey-Deucey PRODOS (4am pack).po | 2024-12-30 17:46 | 140K | |
![[ ]](/icons/unknown.gif) | Advance to Boardwalk PRODOS (4am pack).po | 2024-12-30 17:46 | 140K | |
![[ ]](/icons/unknown.gif) | AlanRat1.DO | 2022-07-20 01:27 | 140K | |
![[ ]](/icons/unknown.gif) | AlanRat1.dsk | 2022-07-20 01:18 | 140K | |
![[ ]](/icons/unknown.gif) | Anchorman (clean crack).dsk | 2024-02-06 08:59 | 140K | |
![[ ]](/icons/unknown.gif) | Anchorman PRODOS (4am pack).po | 2024-12-30 17:46 | 140K | |
![[ ]](/icons/unknown.gif) | AppleAccessII.1.2.Training.dsk | 2023-08-14 03:40 | 140K | |
![[ ]](/icons/unknown.gif) | AppleAccessII.1.2.dsk | 2023-08-14 03:40 | 140K | |
![[ ]](/icons/unknown.gif) | Apple II Johns Debugger 6502.dsk | 2024-02-11 13:10 | 140K | |
![[ ]](/icons/unknown.gif) | Apple IIgs Dealer Diagnostics 4.0 - 077-0234-E (1989).dsk | 2022-09-04 21:46 | 140K | |
![[ ]](/icons/unknown.gif) | AppleUserGamesDisk2.dsk | 2022-09-14 18:17 | 140K | |
![[ ]](/icons/unknown.gif) | Apventure to Atlantis.do | 2021-12-04 17:36 | 140K | |
![[ ]](/icons/unknown.gif) | BRANDON'S TREK.DSK | 2020-12-10 09:32 | 140K | |
![[ ]](/icons/unknown.gif) | CANAPPLE_V23.dsk | 2022-04-09 15:06 | 140K | |
![[ ]](/icons/unknown.gif) | Cannonball.blitz-ProDOS.dsk | 2023-10-03 04:45 | 140K | |
![[ ]](/icons/unknown.gif) | Cat Graphics.dsk | 2021-01-22 21:37 | 140K | |
![[ ]](/icons/unknown.gif) | Cave Girl Clair.dsk | 2021-05-28 14:42 | 140K | |
![[ ]](/icons/unknown.gif) | Checkers v2.1 PRODOS (4am pack).po | 2024-12-30 17:46 | 140K | |
![[ ]](/icons/unknown.gif) | Compilation_Akalabeth_Cannonball_Blitz_Penny_Arcade_Sabotage_Lunar_Lander.dsk | 2022-03-11 22:07 | 140K | |
![[ ]](/icons/unknown.gif) | Compilation_Draw_Poker_Sneakers_Lunar_Lander_Dragon_Maze_Invader.dsk | 2022-03-11 22:22 | 140K | |
![[ ]](/icons/unknown.gif) | Copy_II_Plus_6.3_Side_1.dsk | 2021-05-25 02:39 | 140K | |
![[ ]](/icons/unknown.gif) | Copy_II_Plus_6.3_Side_2.dsk | 2021-05-25 02:39 | 140K | |
![[ ]](/icons/unknown.gif) | Cora Tapes Disk 1.do | 2021-01-20 07:06 | 140K | |
![[ ]](/icons/unknown.gif) | Cora Tapes Disk 2.do | 2021-01-20 07:06 | 140K | |
![[ ]](/icons/unknown.gif) | Cora Tapes Disk 3.do | 2021-01-20 07:06 | 140K | |
![[ ]](/icons/unknown.gif) | Cora Tapes Disk 4.do | 2021-01-20 07:06 | 140K | |
![[ ]](/icons/unknown.gif) | Creeper DOS 1.0.dsk | 2019-05-18 13:38 | 140K | |
![[ ]](/icons/unknown.gif) | Crime and Punishment.dsk | 2019-04-07 04:47 | 140K | |
![[ ]](/icons/unknown.gif) | DClock_Y2K_MGFix.dsk | 2019-10-26 11:08 | 140K | |
![[ ]](/icons/unknown.gif) | Datacomm - For Pascal (no boot).dsk | 2021-01-22 21:28 | 140K | |
![[ ]](/icons/unknown.gif) | Datawatch Bookguard.do | 2021-01-18 19:03 | 140K | |
![[ ]](/icons/unknown.gif) | Don Hunter- Disk Edit & Text Invaders.dsk | 2024-02-12 12:04 | 140K | |
![[ ]](/icons/unknown.gif) | Donkey Kong (4am crack) IJKL.dsk | 2025-02-09 07:51 | 140K | |
![[ ]](/icons/unknown.gif) | Double LORES AMPCORE11.1.dsk | 2021-02-17 21:59 | 140K | |
![[ ]](/icons/unknown.gif) | Draw Poker PRODOS (4am pack).po | 2024-12-30 17:46 | 140K | |
![[ ]](/icons/unknown.gif) | Dungeon Campaign.dsk | 2021-12-04 17:36 | 140K | |
![[ ]](/icons/unknown.gif) | EAGLEDOS.DSK | 2021-09-27 01:30 | 140K | |
![[ ]](/icons/unknown.gif) | Elcuerphumano-Side1.dsk | 2019-12-27 16:20 | 140K | |
![[ ]](/icons/unknown.gif) | Elcuerphumano-Side2.dsk | 2019-12-27 16:20 | 140K | |
![[ ]](/icons/unknown.gif) | Elementary, My Dear Apple (Darts, Lemonade Stand, SuperMath, Don't Fall, Shell Games).dsk | 2021-01-22 21:38 | 140K | |
![[ ]](/icons/unknown.gif) | FANDOM ADVENTURE GAME.DSK | 2019-12-26 04:35 | 140K | |
![[ ]](/icons/unknown.gif) | Financial Statement Analyzer.do | 2021-01-18 19:03 | 140K | |
![[ ]](/icons/unknown.gif) | FlyingToasters.dsk | 2021-03-03 11:08 | 140K | |
![[ ]](/icons/unknown.gif) | French QuizMaster.dsk | 2021-01-22 21:41 | 140K | |
![[ ]](/icons/unknown.gif) | Fun House (Hi-Tech Expressions) - side 1.dsk | 2022-03-31 15:52 | 140K | |
![[ ]](/icons/unknown.gif) | Fun House (Hi-Tech Expressions) - side 2.dsk | 2022-03-31 15:53 | 140K | |
![[ ]](/icons/unknown.gif) | Go PRODOS (4am pack).po | 2024-12-30 17:46 | 140K | |
![[ ]](/icons/unknown.gif) | HELLO.dsk | 2024-02-10 08:52 | 140K | |
![[ ]](/icons/unknown.gif) | Hi-Res Football PRODOS (4am pack).po | 2024-12-30 17:46 | 140K | |
![[ ]](/icons/unknown.gif) | Hi-Res Soccer PRODOS (4am pack).po | 2024-12-30 17:46 | 140K | |
![[ ]](/icons/unknown.gif) | HiMaster.dsk | 2022-07-11 15:07 | 140K | |
![[ ]](/icons/unknown.gif) | Holidays & Seasons (1988-Polarware).dsk | 2025-03-25 15:35 | 140K | |
![[ ]](/icons/unknown.gif) | Home Tech.do | 2021-01-18 01:33 | 140K | |
![[ ]](/icons/unknown.gif) | IEEE-488 Pascal Attach Driver and Documentation (no boot).dsk | 2021-01-22 21:28 | 140K | |
![[ ]](/icons/unknown.gif) | II CONNECT.DSK | 2020-10-13 10:55 | 140K | |
![[ ]](/icons/unknown.gif) | INTRUDER.DSK | 2023-06-07 06:16 | 140K | |
![[ ]](/icons/unknown.gif) | INTRUDER final Version.DSK | 2023-06-10 04:39 | 140K | |
![[ ]](/icons/unknown.gif) | LOGIC_AppleII_Disk-DOS121.dsk | 2022-03-11 22:23 | 140K | |
![[ ]](/icons/unknown.gif) | Lauren of the 25th Century.dsk | 2022-07-21 23:48 | 140K | |
![[ ]](/icons/unknown.gif) | Lucifer's Revenge.do | 2021-08-13 22:58 | 140K | |
![[ ]](/icons/unknown.gif) | McMillPlus.dsk | 2020-05-23 20:04 | 140K | |
![[ ]](/icons/unknown.gif) | McMillPlusFigForth.dsk | 2020-05-23 20:04 | 140K | |
![[ ]](/icons/unknown.gif) | Micro Apple_1.dsk | 2020-11-25 09:15 | 140K | |
![[ ]](/icons/unknown.gif) | MicroChess PRODOS (4am pack).po | 2024-12-30 17:46 | 140K | |
![[ ]](/icons/unknown.gif) | Micro Golf PRODOS (4am pack).po | 2024-12-30 17:46 | 140K | |
![[ ]](/icons/unknown.gif) | Micro on the Apple_2.dsk | 2020-11-25 09:15 | 140K | |
![[ ]](/icons/unknown.gif) | Micro on the Apple_3.dsk | 2020-11-25 09:15 | 140K | |
![[ ]](/icons/unknown.gif) | MilleBornesV2.DSK | 2021-09-07 02:57 | 140K | |
![[ ]](/icons/unknown.gif) | Million.Perfect.Letters.v1.0.dsk | 2024-12-29 12:21 | 140K | |
![[ ]](/icons/unknown.gif) | Million.Perfect.Letters.v1.2.po | 2024-12-29 12:21 | 140K | |
![[ ]](/icons/unknown.gif) | Million.Perfect.Tiles.v1.0.po | 2024-12-30 11:46 | 140K | |
![[ ]](/icons/unknown.gif) | Million.Perfect.Tiles.v1.1.po | 2024-12-30 11:47 | 140K | |
![[ ]](/icons/unknown.gif) | Million Perfect Tiles v1.0.po | 2024-04-11 21:40 | 140K | |
![[ ]](/icons/unknown.gif) | Mockingboard Demonstration Disk Sweet Micro Systems 1984.dsk | 2019-04-07 04:48 | 140K | |
![[ ]](/icons/unknown.gif) | Mockingboard Sound and Speech Tool Disk No Demonstration Sweet Micro Systems 1984.dsk | 2019-04-07 04:48 | 140K | |
![[ ]](/icons/unknown.gif) | MouseDesk 1.5.dsk | 2021-01-08 20:01 | 140K | |
![[ ]](/icons/unknown.gif) | MouseDesk 1.6 Side 1.dsk | 2021-01-08 20:01 | 140K | |
![[ ]](/icons/unknown.gif) | MouseDesk 1.6 Side 2 (Selector 1.0).dsk | 2021-01-08 20:01 | 140K | |
![[ ]](/icons/unknown.gif) | MouseTrap.po | 2024-07-13 16:41 | 140K | |
![[ ]](/icons/unknown.gif) | Ms. Pac-Man (Atari) (4am crack) IJKL.dsk | 2025-02-09 07:51 | 140K | |
![[ ]](/icons/unknown.gif) | Murder Manor.dsk | 2020-07-22 01:12 | 140K | |
![[ ]](/icons/unknown.gif) | Murder Manor.po | 2020-07-22 01:12 | 140K | |
![[ ]](/icons/unknown.gif) | NeutTower.dsk | 2021-03-03 11:08 | 140K | |
![[ ]](/icons/unknown.gif) | Newton's Apple 1- Mirrors, Inertia.dsk | 2023-11-08 00:47 | 140K | |
![[ ]](/icons/unknown.gif) | Newton's Apple 2-Probability, Newton's Knowledge.dsk | 2023-11-08 00:47 | 140K | |
![[ ]](/icons/unknown.gif) | Number Recognition 10-20.dsk | 2021-01-22 21:28 | 140K | |
![[ ]](/icons/unknown.gif) | Odin PRODOS (4am pack).po | 2024-12-30 17:46 | 140K | |
![[ ]](/icons/unknown.gif) | Olin in Emerald side A.dsk | 2019-09-06 15:47 | 140K | |
![[ ]](/icons/unknown.gif) | Olin in Emerald side B.dsk | 2019-09-06 15:47 | 140K | |
![[ ]](/icons/unknown.gif) | Pascal Attach Bios (no boot).dsk | 2021-01-22 21:28 | 140K | |
![[ ]](/icons/unknown.gif) | Pascal Utility Pack 1 (no boot).dsk | 2021-01-22 21:28 | 140K | |
![[ ]](/icons/unknown.gif) | Pascal Utility Pack 2 (no boot).dsk | 2021-01-22 21:28 | 140K | |
![[ ]](/icons/unknown.gif) | Passport.20210904.dsk | 2021-09-04 18:32 | 140K | |
![[ ]](/icons/unknown.gif) | Passport.20240913.dsk | 2024-09-13 11:59 | 140K | |
![[ ]](/icons/unknown.gif) | Pay Day PRODOS (4am pack).po | 2024-12-30 17:46 | 140K | |
![[ ]](/icons/unknown.gif) | Playwriter (1984)(Woodbury)[cr][fixed].dsk | 2020-12-10 20:19 | 140K | |
![[ ]](/icons/unknown.gif) | Public_Domain_Software_DISK_2.dsk | 2020-06-28 23:53 | 140K | |
![[ ]](/icons/unknown.gif) | Public_Domain_Software_DISK_5.dsk | 2020-06-28 23:53 | 140K | |
![[ ]](/icons/unknown.gif) | Public_Domain_Software_DISK_6.dsk | 2020-06-28 23:53 | 140K | |
![[ ]](/icons/unknown.gif) | Public_Domain_Software_DISK_7.dsk | 2020-06-28 23:53 | 140K | |
![[ ]](/icons/unknown.gif) | Questmaster I- The Prism of Heheutotol - Side 1.dsk | 2024-03-05 11:42 | 140K | |
![[ ]](/icons/unknown.gif) | Questmaster I- The Prism of Heheutotol - Side 2.dsk | 2024-03-05 11:42 | 140K | |
![[ ]](/icons/unknown.gif) | Questmaster I- The Prism of Heheutotol - Side 3.dsk | 2024-03-05 11:42 | 140K | |
![[ ]](/icons/unknown.gif) | Questmaster I- The Prism of Heheutotol - Side 4.dsk | 2024-03-05 11:42 | 140K | |
![[ ]](/icons/unknown.gif) | Questmaster I- The Prism of Heheutotol - Side 5.dsk | 2024-03-05 11:42 | 140K | |
![[ ]](/icons/unknown.gif) | Questmaster I- The Prism of Heheutotol - Side 6.dsk | 2024-03-05 11:42 | 140K | |
![[ ]](/icons/unknown.gif) | Remote Control (Hi-Tech Expressions) - side 1.dsk | 2021-03-07 19:23 | 140K | |
![[ ]](/icons/unknown.gif) | Remote Control (Hi-Tech Expressions) - side 2.dsk | 2021-03-07 19:23 | 140K | |
![[ ]](/icons/unknown.gif) | Reversi PRODOS (4am pack).po | 2024-12-30 17:46 | 140K | |
![[ ]](/icons/unknown.gif) | SPETRIS.DSK | 2021-03-03 11:09 | 140K | |
![[ ]](/icons/unknown.gif) | Sidewalk Sneakers (1991-Sunburst Communications).dsk | 2021-04-23 15:02 | 140K | |
![[ ]](/icons/unknown.gif) | Sink The Bismarck.dsk | 2021-07-13 23:18 | 140K | |
![[ ]](/icons/unknown.gif) | Snowman's Mountain.do | 2021-01-18 01:34 | 140K | |
![[ ]](/icons/unknown.gif) | SpaceIntruder (By Raphael Rezende).dsk | 2023-06-07 06:18 | 140K | |
![[ ]](/icons/unknown.gif) | SpaceIntruder.dsk | 2023-08-26 16:15 | 140K | |
![[ ]](/icons/unknown.gif) | SpellWielder Program Disk 1.dsk | 2019-12-05 13:40 | 140K | |
![[ ]](/icons/unknown.gif) | SpellWielder Program Disk 2.dsk | 2019-12-05 13:40 | 140K | |
![[ ]](/icons/unknown.gif) | SpellWielder World Disk.dsk | 2019-12-05 13:40 | 140K | |
![[ ]](/icons/unknown.gif) | Sports Data Services- Baseball-Softball v2.1.dsk | 2023-01-24 21:06 | 140K | |
![[ ]](/icons/unknown.gif) | TETRIS.DSK | 2021-09-27 01:09 | 140K | |
![[ ]](/icons/unknown.gif) | The Graphics Magician Junior.dsk | 2025-03-21 20:14 | 140K | |
![[ ]](/icons/unknown.gif) | The Mailman.do | 2021-01-18 19:03 | 140K | |
![[ ]](/icons/unknown.gif) | The Novel Approach - A Tale of Two Cities side A.dsk | 2021-01-22 21:36 | 140K | |
![[ ]](/icons/unknown.gif) | The Novel Approach - A Tale of Two Cities side B.dsk | 2021-01-22 21:36 | 140K | |
![[ ]](/icons/unknown.gif) | The Novel Approach - The Call of the Wild side A.dsk | 2021-01-22 21:35 | 140K | |
![[ ]](/icons/unknown.gif) | The Novel Approach - The Call of the Wild side B.dsk | 2021-01-22 21:35 | 140K | |
![[ ]](/icons/unknown.gif) | Time Dungeon.dsk | 2019-04-07 04:48 | 140K | |
![[ ]](/icons/unknown.gif) | Ultracheckers PRODOS (4am pack).po | 2024-12-30 17:46 | 140K | |
![[ ]](/icons/unknown.gif) | Usborne - Write your own Adventure Programs.DSK | 2019-12-31 14:25 | 140K | |
![[ ]](/icons/unknown.gif) | Wild West (Keypunch, ProDOS version by Brandon Taylor).dsk | 2022-05-08 21:15 | 140K | |
![[ ]](/icons/unknown.gif) | Wilderness Campaign.dsk | 2021-12-04 17:36 | 140K | |
![[ ]](/icons/unknown.gif) | XONIX.DSK | 2021-09-27 01:10 | 140K | |
![[ ]](/icons/unknown.gif) | Xawaks - Ultima III Solve Disk.DSK | 2022-04-09 16:24 | 140K | |
![[ ]](/icons/unknown.gif) | Xawaks - Ultima IV Solve Disk.DSK | 2022-04-09 16:24 | 140K | |
![[ ]](/icons/unknown.gif) | aeronauts 17k file PRODOS (san inc pack).dsk | 2024-05-07 22:26 | 140K | |
![[ ]](/icons/unknown.gif) | anti-m-v2.1-2024-02-23.dsk | 2024-02-23 14:08 | 140K | |
![[ ]](/icons/unknown.gif) | anti-m-v2.2-2024-02-27.dsk | 2024-02-27 11:29 | 140K | |
![[ ]](/icons/unknown.gif) | anti-m-v2.3-2024-12-08.dsk | 2024-12-08 19:12 | 140K | |
![[ ]](/icons/unknown.gif) | crackman_slideshow.DSK | 2022-04-09 15:07 | 140K | |
![[ ]](/icons/unknown.gif) | d181s1-mon-rom-vaporlock.dsk | 2021-10-04 16:33 | 140K | |
![[ ]](/icons/unknown.gif) | deathbounce 5k file PRODOS (san inc pack).dsk | 2025-01-14 10:21 | 140K | |
![[ ]](/icons/unknown.gif) | electroarena PRODOS (san inc pack).dsk | 2025-01-29 01:43 | 140K | |
![[ ]](/icons/unknown.gif) | fido 18k file PRODOS (san inc pack).dsk | 2024-04-28 15:38 | 140K | |
![[ ]](/icons/unknown.gif) | free_trader.dsk | 2019-08-12 10:37 | 140K | |
![[ ]](/icons/unknown.gif) | gegeapple2_gegegraph_65c02_s1.DSK | 2022-04-09 15:33 | 140K | |
![[ ]](/icons/unknown.gif) | gegeapple2_gegegraph_65c02_s2.DSK | 2022-04-09 15:33 | 140K | |
![[ ]](/icons/unknown.gif) | helicopter rescue 25k file PRODOS (san inc crack).dsk | 2025-04-21 21:29 | 140K | |
![[ ]](/icons/unknown.gif) | mazy2 7k file PRODOS (san inc pack).dsk | 2025-05-25 14:59 | 140K | |
![[ ]](/icons/unknown.gif) | micmacandthesoftman.dsk | 2022-04-09 16:08 | 140K | |
![[ ]](/icons/unknown.gif) | micmacandthesoftman_speedyboot.dsk | 2022-04-09 16:08 | 140K | |
![[ ]](/icons/unknown.gif) | mutant 21k file PRODOS (san inc pack).dsk | 2024-05-02 18:45 | 140K | |
![[ ]](/icons/unknown.gif) | nibble_copy_v1981.dsk | 2019-06-11 00:26 | 140K | |
![[ ]](/icons/unknown.gif) | panic button PRODOS (san inc pack).dsk | 2024-05-09 10:49 | 140K | |
![[ ]](/icons/unknown.gif) | prince of persia one-sided (san inc crack).do | 2024-02-08 00:54 | 140K | |
![[ ]](/icons/unknown.gif) | robotics 20k file PRODOS (san inc pack).dsk | 2024-01-08 22:15 | 140K | |
![[ ]](/icons/unknown.gif) | silicondreams_level9 (san inc crack).dsk | 2024-01-31 13:25 | 140K | |
![[ ]](/icons/unknown.gif) | softmanandpaul.dsk | 2022-04-09 16:08 | 140K | |
![[ ]](/icons/unknown.gif) | spinout 17k file PRODOS (4am and san inc pack).dsk | 2025-01-31 21:42 | 140K | |
![[ ]](/icons/unknown.gif) | spud and mugshot PRODOS (san inc pack).dsk | 2025-01-17 15:21 | 140K | |
![[ ]](/icons/unknown.gif) | txtris.dsk | 2021-03-03 11:09 | 140K | |
![[ ]](/icons/unknown.gif) | ccb_copystory.2mg | 2022-04-09 15:09 | 140K | |
![[ ]](/icons/unknown.gif) | mcs_toolbox.2mg | 2022-04-09 14:57 | 140K | |
![[ ]](/icons/compressed.gif) | Chuck Yeager's Advanced Flight Trainer (woz-a-day collection).zip | 2024-04-16 18:38 | 143K | |
![[ ]](/icons/compressed.gif) | Compound Words and Contractions 1987-09-15 (4am crack).zip | 2025-03-26 13:19 | 143K | |
![[ ]](/icons/compressed.gif) | Living Chess Library - Paul Whitehead Teaches Chess (4am crack).zip | 2022-07-10 11:59 | 146K | |
![[ ]](/icons/compressed.gif) | Battling Bugs & Concentraction rev. 1 (woz-a-day collection).zip | 2024-12-08 22:22 | 146K | |
![[ ]](/icons/compressed.gif) | QuestDR.zip | 2019-03-14 09:56 | 148K | |
![[ ]](/icons/compressed.gif) | Battle of Antietam v1.5 (woz-a-day collection).zip | 2024-08-04 21:46 | 151K | |
![[ ]](/icons/compressed.gif) | Scoop Mahoney (4am crack).zip | 2024-11-19 00:16 | 152K | |
![[ ]](/icons/compressed.gif) | The Print Shop (4am crack).zip | 2025-01-04 20:59 | 153K | |
![[ ]](/icons/compressed.gif) | Keyboard Golf (Softsmith) (woz-a-day collection).zip | 2025-04-07 16:53 | 154K | |
![[ ]](/icons/compressed.gif) | The Print Shop Companion rev. 1 (woz-a-day collection).zip | 2025-03-19 21:28 | 154K | |
![[ ]](/icons/compressed.gif) | The $100,000 Pyramid (Box Office).zip | 2021-01-20 05:47 | 154K | |
![[ ]](/icons/compressed.gif) | Battle of Antietam v1.3 (woz-a-day collection).zip | 2024-08-04 17:12 | 155K | |
![[ ]](/icons/compressed.gif) | Frenzy & Flip Flop (woz-a-day collection).zip | 2024-12-08 22:22 | 156K | |
![[ ]](/icons/compressed.gif) | Sur les traces du Deirdron (4am crack).zip | 2022-07-03 15:31 | 157K | |
![[ ]](/icons/compressed.gif) | Breakthrough in the Ardennes v1.1 (woz-a-day collection).zip | 2024-08-04 21:58 | 157K | |
![[ ]](/icons/compressed.gif) | Classifying Animals with Backbones (woz-a-day collection).zip | 2025-04-02 13:13 | 159K | |
![[ ]](/icons/compressed.gif) | The Spy's Adventures in North America v1986-10-01 (4am crack).zip | 2024-03-26 17:09 | 159K | |
![[ ]](/icons/compressed.gif) | Learning about Geography, Maps, and Globes (4am crack).zip | 2022-07-10 12:33 | 159K | |
![[ ]](/icons/compressed.gif) | The All New Family Feud (woz-a-day collection).zip | 2024-04-20 19:22 | 159K | |
![[ ]](/icons/compressed.gif) | The Spy's Adventures in Europe v1986-09-30 (4am crack).zip | 2023-12-13 21:50 | 161K | |
![[ ]](/icons/compressed.gif) | The Print Shop Companion rev. 3 (woz-a-day collection).zip | 2025-03-19 21:28 | 161K | |
![[ ]](/icons/compressed.gif) | Gulp!! & Arrow Graphics (woz-a-day collection).zip | 2024-12-08 22:22 | 162K | |
![[ ]](/icons/compressed.gif) | Living Chess Library - King's Indian Defense (4am crack).zip | 2022-07-10 12:04 | 162K | |
![[ ]](/icons/compressed.gif) | Candy Land (woz-a-day collection).zip | 2024-04-16 20:49 | 166K | |
![[ ]](/icons/compressed.gif) | Developing Writing Skills (4am crack).zip | 2024-04-29 20:15 | 167K | |
![[ ]](/icons/compressed.gif) | The Print Shop Companion rev. 2 (woz-a-day collection).zip | 2025-03-19 21:28 | 167K | |
![[ ]](/icons/compressed.gif) | Strike Fleet (woz-a-day collection).zip | 2025-03-20 22:27 | 171K | |
![[ ]](/icons/compressed.gif) | Golf Classic & Compubar (woz-a-day collection).zip | 2024-12-08 22:22 | 172K | |
![[ ]](/icons/compressed.gif) | Geography- Our Country and Our World (4am crack).zip | 2022-06-13 17:37 | 173K | |
![[ ]](/icons/compressed.gif) | Where in the World is Carmen Sandiego v2.1 (woz-a-day collection).zip | 2024-04-19 15:58 | 176K | |
![[ ]](/icons/compressed.gif) | Card Sharks (woz-a-day collection).zip | 2024-04-20 17:55 | 176K | |
![[ ]](/icons/compressed.gif) | The Standing Stones (woz-a-day collection).zip | 2025-01-21 13:33 | 176K | |
![[ ]](/icons/compressed.gif) | Wipeout (woz-a-day collection).zip | 2024-04-20 19:31 | 177K | |
![[ ]](/icons/compressed.gif) | Superstar Ice Hockey (woz-a-day collection).zip | 2024-04-19 22:29 | 177K | |
![[ ]](/icons/compressed.gif) | Playing and Reading Music (4am crack).zip | 2022-06-23 11:10 | 184K | |
![[ ]](/icons/compressed.gif) | PFS Write 1986-01-01 (4am crack).zip | 2022-07-03 15:46 | 187K | |
![[ ]](/icons/compressed.gif) | Fantavision (woz-a-day collection).zip | 2025-01-24 20:53 | 195K | |
![[ ]](/icons/compressed.gif) | Dinosaur Construction Kit- Tyrannosaurus Rex 1988-02-24 (woz-a-day collection).zip | 2025-04-08 17:48 | 199K | |
![[ ]](/icons/compressed.gif) | Super Password (woz-a-day collection).zip | 2024-04-20 19:07 | 200K | |
![[ ]](/icons/compressed.gif) | Un Día Típico (4am crack).zip | 2024-10-06 18:28 | 201K | |
![[ ]](/icons/compressed.gif) | Win, Lose or Draw Junior (woz-a-day collection).zip | 2024-04-20 20:46 | 203K | |
![[ ]](/icons/compressed.gif) | Les Sports (woz-a-day collection).zip | 2025-04-02 13:35 | 203K | |
![[ ]](/icons/compressed.gif) | Decision in the Desert (woz-a-day collection).zip | 2025-03-20 10:27 | 206K | |
![[ ]](/icons/compressed.gif) | Battlecruiser (woz-a-day collection).zip | 2024-08-04 21:48 | 207K | |
![[ ]](/icons/compressed.gif) | Animal Watch- Tracks 1988-02-24 (woz-a-day collection).zip | 2025-04-08 17:48 | 212K | |
![[ ]](/icons/compressed.gif) | Conflict in Vietnam (woz-a-day collection).zip | 2025-03-20 10:18 | 214K | |
![[ ]](/icons/compressed.gif) | Press Your Luck (woz-a-day collection).zip | 2024-04-20 18:12 | 214K | |
![[ ]](/icons/compressed.gif) | Un Repas Français (woz-a-day collection).zip | 2025-04-02 13:35 | 215K | |
![[ ]](/icons/compressed.gif) | Echelon (woz-a-day collection).zip | 2024-04-28 13:43 | 215K | |
![[ ]](/icons/compressed.gif) | Rendezvous With Rama (Telarium re-release) (4am crack).zip | 2022-07-06 21:12 | 215K | |
![[ ]](/icons/compressed.gif) | Crusade in Europe v321.03 (woz-a-day collection).zip | 2025-03-20 10:21 | 216K | |
![[ ]](/icons/compressed.gif) | Pickleface and Other Stories v04.07.90 (4am crack).zip | 2024-11-18 21:26 | 216K | |
![[ ]](/icons/compressed.gif) | Crusade in Europe (woz-a-day collection).zip | 2025-03-20 10:19 | 216K | |
![[ ]](/icons/compressed.gif) | Just Around the Block (woz-a-day collection).zip | 2025-04-08 17:48 | 224K | |
![[ ]](/icons/compressed.gif) | The Newsroom v1987-05-08 (san inc crack).zip | 2024-11-28 15:52 | 225K | |
![[ ]](/icons/unknown.gif) | Moontracker_1987_Zephyr_Services.woz | 2021-04-25 06:45 | 228K | |
![[ ]](/icons/unknown.gif) | Nitemapper_1987_Zephyr_Services.woz | 2021-04-25 06:46 | 228K | |
![[ ]](/icons/unknown.gif) | Transylvania_128K.woz | 2020-07-25 00:23 | 228K | |
![[ ]](/icons/unknown.gif) | Rings of Saturn - Disk 1, Side A - Copy 2.woz | 2020-10-18 15:19 | 228K | |
![[ ]](/icons/unknown.gif) | Standard Synthesizer software - Disk 1, Side A.woz | 2019-04-26 10:32 | 228K | |
![[ ]](/icons/unknown.gif) | NTB Assembler & Debug Object - Disk 1, Side A.woz | 2019-04-26 10:32 | 228K | |
![[ ]](/icons/unknown.gif) | Hunt-The-Gulon.woz | 2020-07-21 14:13 | 229K | |
![[ ]](/icons/unknown.gif) | Murder Manor.woz | 2020-07-22 01:12 | 229K | |
![[ ]](/icons/unknown.gif) | Ski Writer.woz | 2022-08-12 18:27 | 229K | |
![[ ]](/icons/unknown.gif) | Don Hunter- Disk Edit & Text Invaders.woz | 2024-02-12 12:04 | 229K | |
![[ ]](/icons/unknown.gif) | Don Hunter- Games - Apple Bank 3.woz | 2024-02-12 12:04 | 229K | |
![[ ]](/icons/unknown.gif) | Don Hunter- Games - Apple Bank 4.woz | 2024-02-12 12:04 | 229K | |
![[ ]](/icons/unknown.gif) | Don Hunter- Games - Apple Bank 5.woz | 2024-02-12 12:04 | 229K | |
![[ ]](/icons/unknown.gif) | Don Hunter- Games - Bez Man, Snack Attack.woz | 2024-02-12 12:04 | 229K | |
![[ ]](/icons/unknown.gif) | Don Hunter- Games - Ceiling Zero, Spider Tag.woz | 2024-02-12 12:04 | 229K | |
![[ ]](/icons/unknown.gif) | Don Hunter- Games - Drelbs, Bellhop, AE Directory.woz | 2024-02-12 12:04 | 229K | |
![[ ]](/icons/unknown.gif) | Don Hunter- Games - Lunar, Asteroid.woz | 2024-02-12 12:04 | 229K | |
![[ ]](/icons/unknown.gif) | Don Hunter- Games - Lunar Lander, Phaser Zap.woz | 2024-02-12 12:04 | 229K | |
![[ ]](/icons/unknown.gif) | Don Hunter- Games - Night Flight.woz | 2024-02-12 12:04 | 229K | |
![[ ]](/icons/unknown.gif) | Don Hunter- Games - Nukewar, Black Hole.woz | 2024-02-12 12:04 | 229K | |
![[ ]](/icons/unknown.gif) | Don Hunter- Games - Pacman, EDD 3.woz | 2024-02-12 12:04 | 229K | |
![[ ]](/icons/unknown.gif) | Don Hunter- Games - QBert, Taipan, Golf, Taxman.woz | 2024-02-12 12:05 | 229K | |
![[ ]](/icons/unknown.gif) | Don Hunter- Games - Rings of Saturn, Starmaze, Outworld.woz | 2024-02-12 12:05 | 229K | |
![[ ]](/icons/unknown.gif) | Don Hunter- Games - Sabotage, Burger Time, Bolo.woz | 2024-02-12 12:05 | 229K | |
![[ ]](/icons/unknown.gif) | Don Hunter- Games - Shamus, Craft Copy.woz | 2024-02-12 12:05 | 229K | |
![[ ]](/icons/unknown.gif) | Don Hunter- Games - Snoggle, Pulsar II (DOS 3.2).woz | 2024-02-12 12:05 | 229K | |
![[ ]](/icons/unknown.gif) | Don Hunter- Games - Space Adventure, Defender.woz | 2024-02-12 12:05 | 229K | |
![[ ]](/icons/unknown.gif) | Don Hunter- Games - Space RPG Apple Trek.woz | 2024-02-12 12:05 | 229K | |
![[ ]](/icons/unknown.gif) | Don Hunter- Games - Star Raiders, Super Star Wars.woz | 2024-02-12 12:05 | 229K | |
![[ ]](/icons/unknown.gif) | Don Hunter- Games - Stargate, Diamond Mine.woz | 2024-02-12 12:05 | 229K | |
![[ ]](/icons/unknown.gif) | Don Hunter- Games - Wiz Fix, Hot Cider.woz | 2024-02-12 12:05 | 229K | |
![[ ]](/icons/compressed.gif) | Pirates v332.01 (woz-a-day collection).zip | 2025-03-20 10:41 | 229K | |
![[ ]](/icons/unknown.gif) | Remote Control (Hi-Tech Expressions) - side 1.woz | 2021-03-07 19:23 | 229K | |
![[ ]](/icons/unknown.gif) | Remote Control (Hi-Tech Expressions) - side 2.woz | 2021-03-07 19:23 | 229K | |
![[ ]](/icons/unknown.gif) | reach_for_the_stars.woz | 2019-06-10 11:39 | 229K | |
![[ ]](/icons/unknown.gif) | journey_3_side_5.woz | 2019-06-29 13:03 | 229K | |
![[ ]](/icons/unknown.gif) | Fun House (Hi-Tech Expressions) - side 2.woz | 2022-03-31 15:53 | 229K | |
![[ ]](/icons/unknown.gif) | Fun House (Hi-Tech Expressions) - side 1.woz | 2022-03-31 15:52 | 229K | |
![[ ]](/icons/unknown.gif) | kings_bounty_1a.woz | 2019-08-12 10:35 | 230K | |
![[ ]](/icons/unknown.gif) | journey_1a_side_1.woz | 2019-06-29 13:03 | 230K | |
![[ ]](/icons/unknown.gif) | journey_1b_side_2.woz | 2019-06-29 13:03 | 230K | |
![[ ]](/icons/unknown.gif) | journey_2a_side_3.woz | 2019-06-29 13:03 | 230K | |
![[ ]](/icons/unknown.gif) | journey_2b_side_4.woz | 2019-06-29 13:03 | 230K | |
![[ ]](/icons/compressed.gif) | Passport.20240913-source.zip | 2024-09-13 11:59 | 231K | |
![[ ]](/icons/unknown.gif) | lords_of_karma (alt).woz | 2019-08-19 02:13 | 236K | |
![[ ]](/icons/unknown.gif) | lords_of_karma.woz | 2019-06-02 11:01 | 236K | |
![[ ]](/icons/unknown.gif) | kings_bounty_1b.woz | 2019-08-12 10:35 | 236K | |
![[ ]](/icons/compressed.gif) | Win, Lose or Draw (woz-a-day collection).zip | 2024-04-20 20:31 | 237K | |
![[ ]](/icons/compressed.gif) | Primary Steps to Comprehension (4am crack).zip | 2024-08-06 18:39 | 237K | |
![[ ]](/icons/compressed.gif) | Animal Watch- Tracks 1987-06-27 (woz-a-day collection).zip | 2025-04-08 17:48 | 240K | |
![[ ]](/icons/compressed.gif) | Where in the USA is Carmen Sandiego v2.1 (woz-a-day collection).zip | 2024-04-19 15:49 | 243K | |
![[ ]](/icons/compressed.gif) | The Great Knowledge Race (woz-a-day collection).zip | 2025-04-20 14:09 | 245K | |
![[ ]](/icons/compressed.gif) | Win Lose or Draw Second Edition (woz-a-day collection).zip | 2024-04-20 20:38 | 245K | |
![[ ]](/icons/compressed.gif) | Card Sharks (ShareData).zip | 2021-01-20 05:46 | 248K | |
![[ ]](/icons/compressed.gif) | Animal Watch- Wolves 1987-06-26 (woz-a-day collection).zip | 2025-04-08 17:48 | 252K | |
![[ ]](/icons/compressed.gif) | Dazzle Draw 1985-09-16 (woz-a-day collection).zip | 2025-03-19 20:38 | 253K | |
![[ ]](/icons/compressed.gif) | Deathlord (woz-a-day collection).zip | 2025-01-21 14:26 | 270K | |
![[ ]](/icons/compressed.gif) | The U.S. Constitution- Nationalism and Federalism (woz-a-day collection).zip | 2024-07-22 21:07 | 274K | |
![[ ]](/icons/compressed.gif) | Classic Concentration (ShareData).zip | 2021-01-20 05:46 | 275K | |
![[ ]](/icons/compressed.gif) | The Bank Street Writer III v1.4 (woz-a-day collection).zip | 2024-07-14 18:38 | 282K | |
![[ ]](/icons/compressed.gif) | SuperPrint v1.2 (4am crack).zip | 2022-06-12 20:30 | 285K | |
![[ ]](/icons/compressed.gif) | Fortran_Recipes_2.0.zip | 2021-01-31 18:29 | 287K | |
![[ ]](/icons/compressed.gif) | Animal Watch- Whales 1988-02-24 (woz-a-day collection).zip | 2025-04-08 17:48 | 288K | |
![[ ]](/icons/layout.gif) | San Francisco press luncheon on future of the Apple II (April 1990).pdf | 2020-08-21 18:57 | 291K | |
![[ ]](/icons/compressed.gif) | Super Password (GameTek).zip | 2021-01-20 05:47 | 305K | |
![[ ]](/icons/compressed.gif) | Earl Weaver Baseball (woz-a-day collection).zip | 2024-04-19 21:44 | 306K | |
![[ ]](/icons/compressed.gif) | Call_Of_Cthulhu_20240325_fr-fr.hdv.gz | 2024-04-14 16:28 | 314K | |
![[ ]](/icons/compressed.gif) | Mindscape's Reading Workshop- Grade 6 (4am crack).zip | 2022-06-14 10:07 | 333K | |
![[ ]](/icons/compressed.gif) | Il Papero Inglese - Italian educational sofware for Apple II.zip | 2022-06-24 14:47 | 359K | |
![[ ]](/icons/compressed.gif) | Kem McNair - Graphics Tablet Utilities.zip | 2024-09-16 18:42 | 363K | |
![[ ]](/icons/compressed.gif) | Playing and Reading Music (woz-a-day collection).zip | 2025-03-18 21:24 | 366K | |
![[ ]](/icons/compressed.gif) | Mind Mirror (woz-a-day collection).zip | 2025-01-21 13:45 | 381K | |
![[ ]](/icons/compressed.gif) | Un Día Típico (woz-a-day collection).zip | 2025-04-02 13:35 | 392K | |
![[ ]](/icons/compressed.gif) | Two Liners 2020-1-Games.zip | 2021-02-17 22:01 | 394K | |
![[ ]](/icons/compressed.gif) | Pegasus_Pascal_2_1.zip | 2020-05-03 20:03 | 409K | |
![[ ]](/icons/compressed.gif) | Battles of Napoleon (woz-a-day collection).zip | 2024-08-04 21:55 | 420K | |
![[ ]](/icons/compressed.gif) | The Bard's Tale III (san inc crack).zip | 2021-05-06 02:23 | 445K | |
![[ ]](/icons/compressed.gif) | Language Activities Courseware Level 3 (4am crack).zip | 2024-04-29 20:26 | 504K | |
![[IMG]](/icons/image2.gif) | Apple Cassette - Telepong (Integer BASIC) PN A2T0012X (002-0016-00) - Audio Waveform Capture - Tape.jpeg | 2024-08-01 05:03 | 505K | |
![[ ]](/icons/compressed.gif) | Spanish for Mastery (4am and san inc crack).zip | 2022-07-03 15:15 | 511K | |
![[ ]](/icons/layout.gif) | Videx-UltraTerm Quick Reference Guide.pdf | 2025-04-07 18:23 | 523K | |
![[ ]](/icons/compressed.gif) | Ultima V v12-APR-88 (4am crack).zip | 2024-12-07 17:52 | 534K | |
![[IMG]](/icons/image2.gif) | Apple Cassette - Starwars PN A2T0002X (002-0006-00) - Audio Waveform Capture - Tape.jpeg | 2024-08-01 05:04 | 543K | |
![[IMG]](/icons/image2.gif) | ImageMaster- Basic Paint (1992)(JADA Graphics) - Program Disk - Side 0.png | 2021-06-09 21:45 | 579K | |
![[ ]](/icons/compressed.gif) | Binary_Gauge_A2_Trains.zip | 2020-11-08 17:47 | 607K | |
![[ ]](/icons/compressed.gif) | Realm-v120.zip | 2021-05-24 07:34 | 610K | |
![[ ]](/icons/compressed.gif) | Realm-v121.zip | 2021-05-31 06:57 | 626K | |
![[ ]](/icons/compressed.gif) | Bulgarian_Games_Stolen_V1.zip | 2019-04-17 00:33 | 647K | |
![[IMG]](/icons/image2.gif) | Apple Cassette - Data Mover (Machine Language Load) PN A2T0012X (002-0016-00) - Audio Waveform Capture - Tape.jpg | 2024-08-01 05:04 | 692K | |
![[ ]](/icons/compressed.gif) | Spanish for Mastery (woz-a-day collection).zip | 2025-04-02 13:35 | 697K | |
![[ ]](/icons/unknown.gif) | pdoshard.hdv | 2021-04-25 07:48 | 700K | |
![[IMG]](/icons/image2.gif) | Apple Cassette - Startrek PN A2T0002X (002-0006-00) - Audio Waveform Capture - Tape.jpeg | 2024-08-01 05:04 | 708K | |
![[ ]](/icons/compressed.gif) | List Plus IIgs (woz-a-day collection).zip | 2024-09-03 12:26 | 758K | |
![[ ]](/icons/layout.gif) | Insoft - Electric Duet - GraFORTH and Order Form.pdf | 2020-11-22 16:37 | 772K | |
![[ ]](/icons/compressed.gif) | The New Talking Stickybear Opposites IIgs (woz-a-day collection).zip | 2024-09-04 21:07 | 780K | |
![[ ]](/icons/compressed.gif) | The Bank Street Writer III v1.1 (woz-a-day collection).zip | 2024-07-14 13:31 | 782K | |
![[ ]](/icons/layout.gif) | TNM_ASCII_Express_Flyer.pdf | 2021-06-04 06:40 | 791K | |
![[ ]](/icons/compressed.gif) | ProDOS-NVRAM-Drive-512KB_v36.zip | 2022-10-23 02:55 | 797K | |
![[ ]](/icons/unknown.gif) | The Desktop Manager - Main Accessories (On Three Inc).po | 2020-06-09 10:57 | 800K | |
![[ ]](/icons/unknown.gif) | 1-2-3 Sequence Me (HDD compatible)(4am pack).po | 2024-12-30 18:39 | 800K | |
![[ ]](/icons/unknown.gif) | AppleWorksInitPack2024.po | 2024-05-12 14:31 | 800K | |
![[ ]](/icons/unknown.gif) | Chuck Yeager's Advanced Flight Trainer PRODOS (san inc crack).po | 2024-04-16 19:37 | 800K | |
![[ ]](/icons/unknown.gif) | F-15 Strike Eagle v1.4 PRODOS (san inc crack).po | 2024-04-17 18:50 | 800K | |
![[ ]](/icons/unknown.gif) | GFL Championship Football PRODOS (san inc pack).po | 2024-04-17 19:33 | 800K | |
![[ ]](/icons/unknown.gif) | Grid Designer (4am and san inc pack).po | 2025-03-26 13:07 | 800K | |
![[ ]](/icons/unknown.gif) | Grranny Applebee's Cookie Factory PRODOS (san inc pack).po | 2024-10-10 20:40 | 800K | |
![[ ]](/icons/unknown.gif) | High Wire Logic (HDD compatible)(4am pack).po | 2024-12-30 18:39 | 800K | |
![[ ]](/icons/unknown.gif) | Hugo Hound's Vowel Sounds - Long Vowels PRODOS (san inc pack).po | 2024-10-10 20:40 | 800K | |
![[ ]](/icons/unknown.gif) | Muppet Math (HDD compatible)(4am pack).po | 2024-12-30 18:39 | 800K | |
![[ ]](/icons/unknown.gif) | Numberball PRODOS (san inc pack).po | 2024-10-10 20:40 | 800K | |
![[ ]](/icons/unknown.gif) | Odd One Out (HDD compatible)(4am pack).po | 2024-12-30 18:39 | 800K | |
![[ ]](/icons/unknown.gif) | Reading Workshop- Distant Views (4am and san inc pack).po | 2025-03-26 13:07 | 800K | |
![[ ]](/icons/unknown.gif) | Reading Workshop- Grade 5 Set 1 (4am and san inc pack).po | 2025-03-26 13:07 | 800K | |
![[ ]](/icons/unknown.gif) | Reading Workshop- Grade 5 Set 2 (4am and san inc pack).po | 2025-03-26 13:07 | 800K | |
![[ ]](/icons/unknown.gif) | Reading Workshop- Grade 5 Set 3 (4am and san inc pack).po | 2025-03-26 13:07 | 800K | |
![[ ]](/icons/unknown.gif) | Reading Workshop- Grade 6 Set 1 (4am and san inc pack).po | 2025-03-26 13:07 | 800K | |
![[ ]](/icons/unknown.gif) | Reading Workshop- Grade 6 Set 2 (4am and san inc pack).po | 2025-03-26 13:07 | 800K | |
![[ ]](/icons/unknown.gif) | Reading Workshop- Grade 6 Set 3 (4am and san inc pack).po | 2025-03-26 13:07 | 800K | |
![[ ]](/icons/unknown.gif) | Reading Workshop- Running Free Set 1 (4am and san inc pack).po | 2025-03-26 13:07 | 800K | |
![[ ]](/icons/unknown.gif) | Reading Workshop- Running Free Set 2 (4am and san inc pack).po | 2025-03-26 13:07 | 800K | |
![[ ]](/icons/unknown.gif) | Reading Workshop- Running Free Set 3 (4am and san inc pack).po | 2025-03-26 13:07 | 800K | |
![[ ]](/icons/unknown.gif) | Reading Workshop- Running Free Set 4 (4am and san inc pack).po | 2025-03-26 13:07 | 800K | |
![[ ]](/icons/unknown.gif) | Regrouping (HDD compatible)(4am pack).po | 2024-12-30 18:39 | 800K | |
![[ ]](/icons/unknown.gif) | Sierra Championship Boxing PRODOS (san inc pack).po | 2024-04-19 19:00 | 800K | |
![[ ]](/icons/unknown.gif) | Taking Chances (HDD compatible)(4am pack).po | 2024-12-30 18:39 | 800K | |
![[ ]](/icons/unknown.gif) | Teddy's Playground (HDD compatible)(4am pack).po | 2024-12-30 18:39 | 800K | |
![[ ]](/icons/unknown.gif) | Teddy and Iggy (HDD compatible)(4am pack).po | 2024-12-30 18:39 | 800K | |
![[ ]](/icons/unknown.gif) | The Memory Machine (HDD compatible)(4am pack).po | 2024-12-30 18:39 | 800K | |
![[ ]](/icons/unknown.gif) | The Sporting News Baseball PRODOS (san inc pack).po | 2024-04-17 14:30 | 800K | |
![[ ]](/icons/unknown.gif) | The Spy's Adventures in Europe PRODOS (4am pack).po | 2024-12-30 18:08 | 800K | |
![[ ]](/icons/unknown.gif) | The Spy's Adventures in North America PRODOS (4am pack).po | 2024-12-30 18:08 | 800K | |
![[ ]](/icons/unknown.gif) | The Spy's Adventures in South America PRODOS (4am pack).po | 2024-12-30 18:08 | 800K | |
![[ ]](/icons/unknown.gif) | Uncle Clyde's Consonant Slides - Beginning Consonants PRODOS (san inc pack).po | 2024-10-10 20:40 | 800K | |
![[ ]](/icons/unknown.gif) | Uncle Clyde's Consonant Slides - Consonant Blends and Digraphs PRODOS (san inc pack).po | 2024-10-10 20:40 | 800K | |
![[ ]](/icons/unknown.gif) | Uncle Clyde's Consonant Slides - Ending Consonants PRODOS (san inc pack).po | 2024-10-10 20:40 | 800K | |
![[ ]](/icons/unknown.gif) | Wipeout PRODOS (4am and san inc pack).po | 2024-12-30 17:46 | 800K | |
![[ ]](/icons/unknown.gif) | Writing Skills Volume 2 (4am and san inc pack).po | 2025-03-26 13:07 | 800K | |
![[ ]](/icons/unknown.gif) | Writing Skills Volume 3 (4am and san inc pack).po | 2025-03-26 13:07 | 800K | |
![[ ]](/icons/unknown.gif) | Writing Skills Volume 4 (4am and san inc pack).po | 2025-03-26 13:07 | 800K | |
![[ ]](/icons/unknown.gif) | Writing Skills Volume 5 (4am and san inc pack).po | 2025-03-26 13:07 | 800K | |
![[ ]](/icons/unknown.gif) | card sharks PRODOS (san inc pack).po | 2024-04-18 22:43 | 800K | |
![[ ]](/icons/unknown.gif) | chipwits PRODOS (san inc pack).po | 2024-03-15 13:33 | 800K | |
![[ ]](/icons/unknown.gif) | crossbow PRODOS (san inc pack).po | 2025-01-09 20:21 | 800K | |
![[ ]](/icons/unknown.gif) | deathlord PRODOS (san inc crack).po | 2024-09-27 00:08 | 800K | |
![[ ]](/icons/unknown.gif) | family feud PRODOS (san inc pack).po | 2024-04-19 18:14 | 800K | |
![[ ]](/icons/unknown.gif) | networker200_bd.po | 2019-06-13 10:03 | 800K | |
![[ ]](/icons/unknown.gif) | press your luck PRODOS (san inc pack).po | 2024-04-19 00:01 | 800K | |
![[ ]](/icons/unknown.gif) | silent service PRODOS (san inc crack).po | 2024-04-19 21:58 | 800K | |
![[ ]](/icons/unknown.gif) | super password PRODOS (san inc pack).po | 2024-04-19 00:39 | 800K | |
![[ ]](/icons/unknown.gif) | ultima3 PRODOS (san inc crack).po | 2024-03-11 00:46 | 800K | |
![[ ]](/icons/unknown.gif) | ultima4 PRODOS (san inc pack).po | 2024-05-03 15:32 | 800K | |
![[ ]](/icons/unknown.gif) | AmperMacros-Plus.2mg | 2021-05-16 21:03 | 800K | |
![[ ]](/icons/unknown.gif) | Building Tens Strategy disk A (8-bit).2mg | 2021-01-28 17:42 | 800K | |
![[ ]](/icons/unknown.gif) | Building Tens Strategy disk B.2mg | 2021-01-28 17:42 | 800K | |
![[ ]](/icons/unknown.gif) | Companion Plus.2mg | 2021-05-16 21:03 | 800K | |
![[ ]](/icons/unknown.gif) | DB Master Professional (8-bit).2mg | 2022-09-10 18:42 | 800K | |
![[ ]](/icons/unknown.gif) | Dark Star source code.2mg | 2023-08-16 22:39 | 800K | |
![[ ]](/icons/unknown.gif) | Delta Drawing Today v4.3 (8-bit).2mg | 2022-09-10 18:41 | 800K | |
![[ ]](/icons/unknown.gif) | Design Your Own Railroad v1.1C (1990-Abracadata)(8-bit).2mg | 2021-07-25 10:34 | 800K | |
![[ ]](/icons/unknown.gif) | DoubleData v2.0.2mg | 2021-05-16 21:03 | 800K | |
![[ ]](/icons/unknown.gif) | First Aid with Reddy (8-bit).2mg | 2022-09-27 22:34 | 800K | |
![[ ]](/icons/unknown.gif) | Forecasting The Weather.2mg | 2021-05-16 21:04 | 800K | |
![[ ]](/icons/unknown.gif) | LEGO TC Logo (8-bit).2mg | 2022-09-10 18:49 | 800K | |
![[ ]](/icons/unknown.gif) | LogoWriter GS v2.0.2mg | 2021-05-16 21:04 | 800K | |
![[ ]](/icons/unknown.gif) | Micol Advanced BASIC (8-bit).2mg | 2022-09-10 18:51 | 800K | |
![[ ]](/icons/unknown.gif) | Pelican Software Family Clip Art Album (8-bit)(no boot).2mg | 2022-09-10 18:45 | 800K | |
![[ ]](/icons/unknown.gif) | Super Menu Pack v1.2.2mg | 2021-05-16 21:21 | 800K | |
![[ ]](/icons/unknown.gif) | The Weather Station.2mg | 2021-05-16 21:04 | 800K | |
![[ ]](/icons/unknown.gif) | Think Quick! IIgs v1.3.2mg | 2019-05-18 13:32 | 800K | |
![[ ]](/icons/unknown.gif) | TimeOut Thesaurus v2.0.2mg | 2021-06-08 00:17 | 800K | |
![[ ]](/icons/unknown.gif) | TimeOut UltraMacros v3.0.2mg | 2021-05-16 21:11 | 800K | |
![[ ]](/icons/unknown.gif) | TotalControl v2.1.2mg | 2021-05-16 21:03 | 800K | |
![[ ]](/icons/unknown.gif) | Tutor-Tech-v2.5.2mg | 2019-12-30 20:19 | 800K | |
![[ ]](/icons/unknown.gif) | UltraKey 2.0 (8-bit).2mg | 2019-05-18 13:32 | 800K | |
![[ ]](/icons/unknown.gif) | UniDOS 3.3 v2.0.1 master disk (8-bit).2mg | 2022-09-10 18:54 | 800K | |
![[ ]](/icons/unknown.gif) | Where in the World is Carmen Sandiego v2.1 (clean crack + HD install).2mg | 2024-04-21 09:35 | 800K | |
![[ ]](/icons/unknown.gif) | networker200_bd.2mg | 2019-06-13 10:03 | 800K | |
![[ ]](/icons/unknown.gif) | tarot_2021_en.2mg | 2021-03-03 11:09 | 800K | |
![[ ]](/icons/compressed.gif) | TopDraw IIgs v1.01A (woz-a-day collection).zip | 2024-09-04 20:50 | 802K | |
![[ ]](/icons/compressed.gif) | Draw Plus IIgs v1.0 (woz-a-day collection).zip | 2024-09-04 21:00 | 830K | |
![[ ]](/icons/compressed.gif) | DejaIIxAppleWorksEmulator2.0.beta109.zip | 2025-02-15 13:03 | 851K | |
![[ ]](/icons/compressed.gif) | Tomahawk IIgs (woz-a-day collection).zip | 2022-07-04 20:27 | 882K | |
![[ ]](/icons/compressed.gif) | Datamost Source Code.zip | 2021-01-08 15:13 | 918K | |
![[ ]](/icons/layout.gif) | MAE_Assembler_Manual.pdf | 2024-01-16 04:23 | 935K | |
![[ ]](/icons/unknown.gif) | pdoseric.hdv | 2021-04-25 07:48 | 962K | |
![[ ]](/icons/layout.gif) | DISKS, EDD, COPY PROTECTION, AND EMULATORS.pdf | 2020-07-17 15:24 | 963K | |
![[ ]](/icons/layout.gif) | Optimum Resource - Stickybear Math - User Guide.pdf | 2024-10-29 11:33 | 1.0M | |
![[ ]](/icons/layout.gif) | Optimum Resource - Math Word Problems - User's Guide.pdf | 2024-11-16 02:31 | 1.0M | |
![[ ]](/icons/compressed.gif) | Space_Snatchers_A2_Game.zip | 2020-11-08 17:47 | 1.1M | |
![[ ]](/icons/compressed.gif) | The New Talking Stickybear Alphabet IIgs (woz-a-day collection).zip | 2024-09-04 21:14 | 1.1M | |
![[ ]](/icons/compressed.gif) | A2 SubLOGIC Scenery Collection.zip | 2022-03-17 11:51 | 1.1M | |
![[ ]](/icons/compressed.gif) | peeker - all disks (approved by the author Ulrich Stiehl and the publisher Huethig).zip | 2020-11-25 04:26 | 1.2M | |
![[ ]](/icons/unknown.gif) | The Desktop Manager - Main Accessories (On Three Inc).woz | 2020-06-09 10:57 | 1.2M | |
![[ ]](/icons/compressed.gif) | Award Maker Plus v23611 (woz-a-day collection).zip | 2025-02-18 12:27 | 1.2M | |
![[ ]](/icons/layout.gif) | Optimum Resource - Stickybear Numbers - Manual 1982.pdf | 2024-10-29 11:34 | 1.3M | |
![[ ]](/icons/layout.gif) | Optimum Resource - Math Word Problems Series - User Guide.pdf | 2024-10-29 11:25 | 1.4M | |
![[ ]](/icons/compressed.gif) | Space Adventure manual _ Sierra Software.zip | 2021-05-12 15:38 | 1.4M | |
![[ ]](/icons/compressed.gif) | Pie Man.zip | 2019-03-14 09:55 | 1.4M | |
![[ ]](/icons/compressed.gif) | AppleWin1.30.20.0.zip | 2025-01-30 17:53 | 1.4M | |
![[ ]](/icons/compressed.gif) | RAppleWin.zip | 2025-01-30 18:01 | 1.5M | |
![[ ]](/icons/compressed.gif) | Spy South America.zip | 2019-03-14 09:57 | 1.5M | |
![[ ]](/icons/compressed.gif) | Spy Europe.zip | 2019-03-14 09:57 | 1.6M | |
![[ ]](/icons/layout.gif) | Inside Apple's ProDOS by Campbell, John L.pdf | 2021-05-10 13:23 | 1.6M | |
![[ ]](/icons/layout.gif) | Horizon V.pdf | 2021-04-20 15:03 | 1.6M | |
![[ ]](/icons/compressed.gif) | Crime Wave.zip | 2019-03-14 09:51 | 1.6M | |
![[ ]](/icons/layout.gif) | baudville video vegas registration & backup disk offer card - front & back.pdf | 2024-12-26 21:56 | 1.7M | |
![[ ]](/icons/compressed.gif) | Spy North America.zip | 2019-03-14 09:57 | 1.7M | |
![[ ]](/icons/compressed.gif) | Map Pack.zip | 2019-03-14 09:54 | 1.7M | |
![[ ]](/icons/compressed.gif) | Two Liners 2020-2-Fancy Screen-Stuff.zip | 2021-02-17 22:01 | 1.7M | |
![[ ]](/icons/compressed.gif) | MultiScribe GS v3.01c (woz-a-day collection).zip | 2024-09-04 20:55 | 1.8M | |
![[ ]](/icons/compressed.gif) | Halls of Montezuma IIgs (woz-a-day collection).zip | 2024-10-07 13:25 | 1.8M | |
![[ ]](/icons/compressed.gif) | Magic Paintbrush.zip | 2019-03-14 09:54 | 1.8M | |
![[ ]](/icons/compressed.gif) | Renegade Documentation.zip | 2019-05-27 05:27 | 1.9M | |
![[ ]](/icons/layout.gif) | Hayes Stack Chronograph Owner's Manual.pdf | 2020-07-25 00:21 | 2.0M | |
![[ ]](/icons/layout.gif) | The Bufferboard - Orange Micro.pdf | 2020-07-17 15:24 | 2.2M | |
![[ ]](/icons/layout.gif) | Tales_From_The_Arabian_Nights_Manual.pdf | 2020-05-03 19:59 | 2.2M | |
![[ ]](/icons/layout.gif) | baudville video vegas front cover.pdf | 2024-12-26 21:56 | 2.2M | |
![[ ]](/icons/layout.gif) | Optimum Resource - Stickybear BASIC - User's Guide.pdf | 2024-10-29 11:33 | 2.4M | |
![[ ]](/icons/layout.gif) | Prodos Supplement To The Apple Iie Owners Manual (z-lib.org).pdf | 2021-04-23 20:52 | 2.4M | |
![[ ]](/icons/layout.gif) | Optimum Resource - Stickybear Math 2 - User's Guide 2.pdf | 2024-10-29 11:33 | 2.4M | |
![[ ]](/icons/layout.gif) | ThunderScan Quick Reference Guide.pdf | 2025-04-07 18:18 | 2.4M | |
![[ ]](/icons/layout.gif) | Optimum Resource - Stickybear Bop - Manual 1982.pdf | 2024-10-29 11:33 | 2.4M | |
![[IMG]](/icons/image2.gif) | D-Generation.tif | 2021-11-23 23:44 | 2.4M | |
![[ ]](/icons/layout.gif) | SSI Computer Baseball.pdf | 2022-04-23 12:22 | 2.5M | |
![[ ]](/icons/layout.gif) | electric-duet-manual.pdf | 2021-09-25 00:05 | 2.6M | |
![[ ]](/icons/unknown.gif) | Ultima IV Remastered.rar | 2021-11-02 05:50 | 2.8M | |
![[ ]](/icons/compressed.gif) | The Spy Strikes Back.zip | 2019-03-14 09:58 | 2.8M | |
![[ ]](/icons/layout.gif) | Videx - AppleWorks Modifier.pdf | 2025-04-07 18:18 | 2.8M | |
![[ ]](/icons/layout.gif) | CPS-Alaska-Card-Addendum-KB.pdf | 2021-11-02 05:51 | 2.9M | |
![[ ]](/icons/compressed.gif) | Wheeler Dealers (woz-a-day collection).zip | 2024-05-10 14:14 | 3.0M | |
![[ ]](/icons/unknown.gif) | the gate GS PRODOS (san inc pack).po | 2025-03-20 01:32 | 3.0M | |
![[ ]](/icons/compressed.gif) | Ultima IV Remastered.zip | 2021-11-04 05:40 | 3.0M | |
![[ ]](/icons/compressed.gif) | Read-a-Rama-Manuals.zip | 2020-05-03 20:03 | 3.1M | |
![[ ]](/icons/layout.gif) | Optimum Resource - Reading Comprehension Series - User Guide.pdf | 2024-10-29 11:26 | 3.2M | |
![[ ]](/icons/layout.gif) | PC Transporter benchmarks.pdf | 2023-07-05 20:45 | 3.3M | |
![[ ]](/icons/layout.gif) | ThunderScan Tutorial Image.pdf | 2025-04-07 18:18 | 4.1M | |
![[ ]](/icons/layout.gif) | Versionsoft Procode Manual.pdf | 2021-06-08 05:57 | 4.2M | |
![[ ]](/icons/layout.gif) | CGS Tablet Commands .pdf | 2025-04-07 18:16 | 4.3M | |
![[ ]](/icons/layout.gif) | Optimum Resource - Stickybear ABC - Manual.pdf | 2024-10-29 11:32 | 4.4M | |
![[ ]](/icons/layout.gif) | baudville video vegas folder outside.pdf | 2024-12-26 21:56 | 4.5M | |
![[ ]](/icons/layout.gif) | Novation J-CAT MODEM.pdf | 2020-07-25 00:22 | 4.5M | |
![[ ]](/icons/layout.gif) | Optimum Resource - Stickybear Math 2 - User's Guide.pdf | 2024-10-29 11:33 | 4.8M | |
![[ ]](/icons/layout.gif) | Optimum Resource - Run For It - Diskette.pdf | 2024-10-29 11:26 | 4.8M | |
![[ ]](/icons/layout.gif) | Independence-Manual.pdf | 2020-05-03 20:02 | 4.9M | |
![[ ]](/icons/layout.gif) | Manual Firmware for the Apple-Cat II The 'Mirror' by Rak-Ware.pdf | 2020-07-17 15:30 | 5.0M | |
![[ ]](/icons/layout.gif) | Optimum Resource - Stickybear Music - Music Library 1 - Manual.pdf | 2024-10-29 11:34 | 5.1M | |
![[ ]](/icons/compressed.gif) | Adalab-software-manuals.zip | 2019-03-25 13:58 | 5.2M | |
![[ ]](/icons/compressed.gif) | Mind Mirror Documentation.zip | 2019-05-27 06:32 | 5.2M | |
![[ ]](/icons/layout.gif) | Plot II - Hardware.pdf | 2021-05-27 17:24 | 5.3M | |
![[ ]](/icons/layout.gif) | manual_imc_2001_2.01.pdf | 2024-11-08 14:06 | 5.3M | |
![[ ]](/icons/compressed.gif) | softcard_2e_programmers_manual.zip | 2022-09-16 16:23 | 5.4M | |
![[ ]](/icons/layout.gif) | Optimum Resource - Stickybear Drawing - User's Guide.pdf | 2024-10-29 11:33 | 5.5M | |
![[ ]](/icons/layout.gif) | Beneath Apple DOS Reference Card.pdf | 2024-10-12 11:52 | 5.7M | |
![[ ]](/icons/layout.gif) | Optimum Resource - Map Skills - User's Guide.pdf | 2024-11-16 02:31 | 5.7M | |
![[ ]](/icons/layout.gif) | Car_Builder-Users_Guide.pdf | 2020-05-03 20:02 | 5.8M | |
![[ ]](/icons/compressed.gif) | Magic-Pixels-26.zip | 2021-02-17 22:00 | 5.9M | |
![[ ]](/icons/compressed.gif) | ProDOS-NVRAM-Drive-4MB_v36.zip | 2022-10-23 02:55 | 5.9M | |
![[ ]](/icons/layout.gif) | baudville video vegas folder inside.pdf | 2024-12-26 21:56 | 6.4M | |
![[ ]](/icons/compressed.gif) | SecondSight document pack.zip | 2021-01-20 07:27 | 6.6M | |
![[ ]](/icons/layout.gif) | Optimum Resource - Run For It - Stickers.pdf | 2024-10-29 11:32 | 6.7M | |
![[ ]](/icons/layout.gif) | Apple II Forever Program of Events.pdf | 2025-04-07 10:07 | 6.8M | |
![[ ]](/icons/unknown.gif) | Learn AC:QuickBasic Now for the ][GS.zip.1.d580 | 2021-06-09 22:21 | 7.1M | |
![[ ]](/icons/compressed.gif) | Quentin-Big_Book_Maker.zip | 2019-06-13 10:03 | 7.2M | |
![[ ]](/icons/compressed.gif) | Robot_Writer_Plus.zip | 2019-06-13 10:04 | 7.2M | |
![[ ]](/icons/compressed.gif) | Popples.zip | 2019-12-24 19:48 | 7.3M | |
![[ ]](/icons/layout.gif) | ProLine BBS 1.6, 1.7, 1.8, 2.0 press releases, site listings & FAQ (GEnie A2 RoundTable 1990-93).pdf | 2023-07-27 20:01 | 7.6M | |
![[ ]](/icons/compressed.gif) | Letters_Numbers_and_Shapes-Big_Book_Maker.zip | 2019-06-13 10:03 | 7.7M | |
![[ ]](/icons/layout.gif) | Optimum Resource - Stickybear Math - Parent Guide.pdf | 2024-10-29 11:33 | 7.9M | |
![[ ]](/icons/layout.gif) | Optimum Resource - Reading Comprehension - User's Guide.pdf | 2024-11-16 02:32 | 7.9M | |
![[ ]](/icons/layout.gif) | Optimum Resource - Stickybear Numbers - Manual.pdf | 2024-10-29 11:34 | 8.3M | |
![[ ]](/icons/compressed.gif) | Special Effects.zip | 2019-03-14 09:56 | 8.5M | |
![[ ]](/icons/layout.gif) | Penguin 3-D Drawing System.pdf | 2025-04-07 18:16 | 8.6M | |
![[ ]](/icons/layout.gif) | quality computers appleworks 4 quick reference card.pdf | 2024-12-26 22:16 | 9.0M | |
![[ ]](/icons/compressed.gif) | ECNeilson woz lite 1.zip | 2021-04-26 20:50 | 9.1M | |
![[ ]](/icons/compressed.gif) | Images-Hardware-Storage-Disk-NVRAM_Drive_4MB_v34.zip | 2022-09-29 01:42 | 9.1M | |
![[ ]](/icons/compressed.gif) | NVRAM-Drive_4MB.zip | 2022-08-31 17:44 | 9.1M | |
![[ ]](/icons/layout.gif) | Optimum Resource - Stickybear Reading Comprehension - User's Guide.pdf | 2024-11-16 02:32 | 9.2M | |
![[ ]](/icons/layout.gif) | Apple II John's Debugger 6502.pdf | 2024-02-11 13:10 | 9.2M | |
![[ ]](/icons/layout.gif) | Apple II Cable and Connector Guide.pdf | 2022-09-14 17:13 | 9.3M | |
![[ ]](/icons/layout.gif) | Apple II Einführung in Applesoft BASIC.pdf | 2025-04-29 22:57 | 9.6M | |
![[ ]](/icons/layout.gif) | Optimum Resource - Stickybear Opposites - Parent Guide.pdf | 2024-10-29 11:34 | 9.9M | |
![[ ]](/icons/compressed.gif) | Transportation_Transformation.zip | 2019-06-13 10:06 | 10M | |
![[ ]](/icons/unknown.gif) | eric.hdv | 2021-04-25 07:49 | 10M | |
![[ ]](/icons/compressed.gif) | Dinosaur_Days.zip | 2019-06-13 10:02 | 10M | |
![[ ]](/icons/unknown.gif) | hard.hdv | 2021-04-25 07:49 | 11M | |
![[ ]](/icons/layout.gif) | The IceCable manual (Epson to ImageWriter converter from Automatic Ice Co).pdf | 2022-07-06 00:40 | 11M | |
![[ ]](/icons/compressed.gif) | Transitions.zip | 2019-03-14 09:58 | 11M | |
![[ ]](/icons/compressed.gif) | ClipArt_n_Sounds.zip | 2020-05-03 20:02 | 11M | |
![[SND]](/icons/sound2.gif) | Apple Cassette - Telepong (Integer BASIC) PN A2T0012X (002-0016-00) - Audio Waveform Capture.wav | 2024-08-01 05:04 | 12M | |
![[ ]](/icons/compressed.gif) | Robin_Hood_and_Peter_Pan.zip | 2019-06-13 10:04 | 12M | |
![[SND]](/icons/sound2.gif) | Apple Cassette - Data Mover (Machine Language Load) PN A2T0012X (002-0016-00) - Audio Waveform Capture.wav | 2024-08-01 05:04 | 12M | |
![[ ]](/icons/layout.gif) | Sirius_Software_Lemmings_Apple_II_manual.pdf | 2021-04-20 15:03 | 12M | |
![[ ]](/icons/layout.gif) | Penguin 100-Color Drawing System.pdf | 2025-04-07 18:17 | 13M | |
![[ ]](/icons/layout.gif) | CompUSA Macintosh Products Guide Winter (Apple Computer, Inc.) (z-lib.org).pdf | 2022-07-10 03:55 | 13M | |
![[ ]](/icons/layout.gif) | beagle bros poster.pdf | 2024-12-26 22:04 | 13M | |
![[ ]](/icons/layout.gif) | Basic_Computer_Games_Microcomputer_Edition_1978_Creative_Computing.pdf | 2025-05-06 14:19 | 13M | |
![[ ]](/icons/compressed.gif) | Home Data Manager.zip | 2019-03-14 09:54 | 13M | |
![[ ]](/icons/layout.gif) | Apple Dot Matrix Printer, ImageWriter I, Scribe - text font samples [300dpi].pdf | 2022-09-14 04:47 | 13M | |
![[ ]](/icons/layout.gif) | Optimum Resource - Stickybear Music - User's Guide.pdf | 2024-10-29 11:34 | 13M | |
![[ ]](/icons/compressed.gif) | Crimson Crown.zip | 2019-03-14 09:51 | 14M | |
![[ ]](/icons/compressed.gif) | IWM document pack.zip | 2021-01-20 07:49 | 14M | |
![[ ]](/icons/layout.gif) | Dakin5 Programming Aids 3.3.pdf | 2020-07-19 17:39 | 14M | |
![[ ]](/icons/layout.gif) | Optimum Resource - Sentence Fun - User's Guide.pdf | 2024-11-16 02:32 | 15M | |
![[ ]](/icons/layout.gif) | ASCII Express- The Professional - Tutorial by Lucien Van Elsen, Revised 6-8-85.pdf | 2024-07-26 02:18 | 15M | |
![[ ]](/icons/compressed.gif) | Transylvania.zip | 2019-03-14 09:59 | 15M | |
![[ ]](/icons/layout.gif) | Mindscape - Into the Eagle's Nest - Manual.pdf | 2025-06-09 15:52 | 15M | |
![[ ]](/icons/compressed.gif) | Music_Library.zip | 2020-05-03 20:03 | 15M | |
![[ ]](/icons/layout.gif) | Inside Apple's ProDOS.pdf | 2020-07-19 17:45 | 16M | |
![[ ]](/icons/layout.gif) | Inside Apple's ProDOS by John L Campbell.pdf | 2021-05-10 13:25 | 16M | |
![[ ]](/icons/layout.gif) | Optimum Resource - Punctuation Rules - User's Guide.pdf | 2024-11-16 02:31 | 16M | |
![[ ]](/icons/compressed.gif) | Shadowgate-Manuals.zip | 2020-05-03 19:55 | 16M | |
![[ ]](/icons/compressed.gif) | Paper Graphics Documents.zip | 2019-03-14 09:55 | 16M | |
![[ ]](/icons/layout.gif) | Apple SDS Topographic Mapping C2E0005 652-2052-00 disk.pdf | 2021-12-03 14:58 | 17M | |
![[ ]](/icons/layout.gif) | Micro on the Apple_3.pdf | 2020-11-25 09:15 | 17M | |
![[ ]](/icons/layout.gif) | topographic mapping photos.pdf | 2021-12-03 15:14 | 18M | |
![[ ]](/icons/compressed.gif) | Cat Graphics.zip | 2019-03-14 09:50 | 18M | |
![[ ]](/icons/compressed.gif) | a2c-games.zip | 2020-11-12 14:06 | 19M | |
![[ ]](/icons/layout.gif) | Micro on the Apple_2.pdf | 2020-11-25 09:15 | 19M | |
![[ ]](/icons/layout.gif) | Hot Rod III, Softalk JUL-1983.pdf | 2020-07-19 17:43 | 20M | |
![[ ]](/icons/layout.gif) | Super_Convert-Manual.pdf | 2020-05-03 19:59 | 20M | |
![[ ]](/icons/compressed.gif) | flux_images_2019-01-11-backups.zip | 2021-04-26 19:18 | 21M | |
![[ ]](/icons/compressed.gif) | Fatdog_System_6_Makeover.zip | 2020-05-03 20:02 | 21M | |
![[ ]](/icons/compressed.gif) | Tawala's Last Redoubt.zip | 2019-03-14 09:58 | 24M | |
![[ ]](/icons/unknown.gif) | TALA Archive.zip.0.156bc | 2021-05-23 05:44 | 25M | |
![[ ]](/icons/layout.gif) | Autostart ROM Installation And Operation Manual.pdf | 2020-07-19 17:41 | 25M | |
![[ ]](/icons/layout.gif) | Optimum Resource - Fat City - Manual.pdf | 2024-10-29 11:25 | 25M | |
![[ ]](/icons/layout.gif) | KoalaPad TouchTablet Owner's Manual v2.pdf | 2020-07-20 02:08 | 26M | |
![[ ]](/icons/layout.gif) | Apple IIe to IIgs - Performance Update.pdf | 2023-08-30 19:50 | 26M | |
![[ ]](/icons/layout.gif) | Optimum Resource - Run For It - Manual.pdf | 2024-10-29 11:27 | 26M | |
![[ ]](/icons/layout.gif) | Micro Apple_1.pdf | 2020-11-25 09:15 | 27M | |
![[ ]](/icons/layout.gif) | Apple SSAFE Project.pdf | 2023-07-19 14:03 | 27M | |
![[ ]](/icons/layout.gif) | Optimum Resource - Beach Landing - Manual.pdf | 2024-10-29 11:23 | 28M | |
![[ ]](/icons/layout.gif) | baudville video vegas manual.pdf | 2024-12-26 21:56 | 30M | |
![[ ]](/icons/layout.gif) | Optimum Resource - Old Ironsides - Manual.pdf | 2024-10-29 11:26 | 32M | |
![[ ]](/icons/unknown.gif) | Total Replay II v1.0-alpha.4.hdv | 2024-09-11 23:57 | 32M | |
![[ ]](/icons/unknown.gif) | Total Replay v5.1.hdv | 2024-02-16 12:48 | 32M | |
![[ ]](/icons/unknown.gif) | Total Replay v5.2.hdv | 2024-09-08 22:46 | 32M | |
![[ ]](/icons/unknown.gif) | Wizard Replay v1.1.hdv | 2024-09-23 12:32 | 32M | |
![[SND]](/icons/sound2.gif) | Apple Cassette - Starwars PN A2T0002X (002-0006-00) - Audio Waveform Capture.wav | 2024-08-01 05:04 | 33M | |
![[SND]](/icons/sound2.gif) | Apple Cassette - Startrek PN A2T0002X (002-0006-00) - Audio Waveform Capture.wav | 2024-08-01 05:04 | 34M | |
![[ ]](/icons/compressed.gif) | Virtual ][ - 12.zip | 2024-11-01 15:35 | 34M | |
![[ ]](/icons/compressed.gif) | Personal Newsletter 2.0 for Apple II (1988).zip | 2021-09-27 14:42 | 36M | |
![[ ]](/icons/compressed.gif) | Skyfox (Ariolasoft UK) box and manual.zip | 2021-01-19 12:28 | 37M | |
![[ ]](/icons/compressed.gif) | Crossrunner_v1.02.zip | 2024-01-06 07:06 | 38M | |
![[ ]](/icons/layout.gif) | Optimum Resource - Exploring Tables and Graphs - User Guide.pdf | 2024-10-29 11:24 | 38M | |
![[ ]](/icons/compressed.gif) | cowgod.org [winhttrack].zip | 2021-01-20 05:52 | 44M | |
![[ ]](/icons/compressed.gif) | Complete Graphics System manuals.zip | 2019-03-14 09:51 | 46M | |
![[ ]](/icons/compressed.gif) | cowgod.org.zip | 2021-01-20 05:52 | 51M | |
![[ ]](/icons/layout.gif) | The Apple Collection catalog Nineteen Hundred Eighty-Six_Eighty-Seven.pdf | 2020-07-20 04:47 | 53M | |
![[ ]](/icons/layout.gif) | Apple Logo II Introduction ProgBW.pdf | 2022-06-24 02:55 | 54M | |
![[ ]](/icons/compressed.gif) | AppleSoftwareProtectionDigest.zip | 2024-07-23 02:13 | 54M | |
![[ ]](/icons/layout.gif) | Videx Videoterm Installation & Operation Manual.pdf | 2025-04-07 18:23 | 54M | |
![[ ]](/icons/compressed.gif) | TERMINAPPLE DOS and PASCAL Communications Software Australia K-RAM Software manual-20240916T033710Z-001.zip | 2024-09-22 21:14 | 56M | |
![[ ]](/icons/layout.gif) | TheWarpFactorManual1981AppleII.pdf | 2021-04-26 19:46 | 57M | |
![[ ]](/icons/layout.gif) | Zardax Word Processor manual (1981 Computer Solutions) - COMPLETE VERSION.pdf | 2020-12-11 21:22 | 58M | |
![[ ]](/icons/layout.gif) | Apple II Guide 1990.pdf | 2023-08-30 19:49 | 61M | |
![[ ]](/icons/layout.gif) | Fast Reference Guide to CP-M.pdf | 2025-05-11 17:23 | 62M | |
![[ ]](/icons/layout.gif) | Sirius Joyport Manual.pdf | 2020-08-21 01:45 | 63M | |
![[ ]](/icons/compressed.gif) | Home Connection.zip | 2019-03-14 09:54 | 65M | |
![[ ]](/icons/layout.gif) | Mountain Computer CPS Multifunction Card - Reference Manual.pdf | 2025-05-12 02:05 | 88M | |
![[ ]](/icons/compressed.gif) | Brutal Deluxe French cracks 01-20-2021.zip | 2021-01-20 07:03 | 89M | |
![[ ]](/icons/layout.gif) | VisiCalc Advanced for Apple III.pdf | 2021-09-27 14:47 | 102M | |
![[ ]](/icons/layout.gif) | ProDOS 16 Reference Manual.pdf | 2023-08-30 20:01 | 113M | |
![[ ]](/icons/layout.gif) | QPAK-68UsersGuide.pdf | 2020-05-22 19:22 | 122M | |
![[ ]](/icons/layout.gif) | GS OS REFERENCE MANUAL.pdf | 2021-05-27 17:49 | 123M | |
![[ ]](/icons/layout.gif) | The CIA Apple II Disk Utilities-OCR.pdf | 2021-04-26 19:49 | 129M | |
![[ ]](/icons/compressed.gif) | cowgod.org (collection) [winhttrack].zip | 2021-01-20 07:05 | 160M | |
![[ ]](/icons/layout.gif) | Optimum Resource - Run For It - Map.pdf | 2024-10-29 11:32 | 160M | |
![[ ]](/icons/layout.gif) | Apple SDS Topographic Mapping C2E0005 manual.pdf | 2021-12-03 15:19 | 160M | |
![[ ]](/icons/compressed.gif) | cowgod.org (collection).zip | 2021-01-20 07:06 | 163M | |
![[ ]](/icons/layout.gif) | VisiCalc Advanced Version - VisiCorp.pdf | 2020-07-20 05:16 | 163M | |
![[ ]](/icons/layout.gif) | Beneath Apple DOS (first printing).pdf | 2024-10-12 11:52 | 163M | |
![[ ]](/icons/compressed.gif) | ACBasic Manual and Articles Archive.zip | 2021-09-25 00:11 | 166M | |
![[ ]](/icons/layout.gif) | The Applesoft Tutorial (A2L0018; 030-0044-D).pdf | 2024-10-16 22:32 | 171M | |
![[ ]](/icons/layout.gif) | Menu 1990 - Software Information Apple II.pdf | 2023-08-30 19:57 | 180M | |
![[ ]](/icons/layout.gif) | QPAK-68 Users Guide.pdf | 2020-05-22 19:31 | 185M | |
![[ ]](/icons/layout.gif) | TML_BASIC-Manual.pdf | 2020-05-03 20:01 | 185M | |
![[ ]](/icons/layout.gif) | Bag of Tricks (1982, Quality Software, Don Worth & Pieter Lechner).pdf | 2024-10-24 18:27 | 185M | |
![[ ]](/icons/compressed.gif) | APPLE III - WOZ FILES - EXTRACT TO APPLE III FOLDER.zip | 2020-05-17 14:38 | 247M | |
![[ ]](/icons/layout.gif) | The Apple Computer Clubs Activities Handbook - Miller-Caley-Casabonne.pdf | 2020-07-20 06:41 | 335M | |
![[ ]](/icons/compressed.gif) | Peeker_magazin_compßlete_german_1984_1987.zip | 2025-04-23 10:31 | 454M | |
![[ ]](/icons/layout.gif) | ASCII Express "The Pro" manual (photocopy scan).pdf | 2024-08-16 02:30 | 666M | |
|